14. In order for a gas to be a "greenhouse gas" it must A. transmit visible light and absorb infrared radiation. B. be radioactive. C. transmit infrared light and absorb visible light. D. be combustible. E. absorb both visible light and infrared radiation.

Q: Why chlorofluorocarbons (CFCs) are responsible for destroying ozone ?

A: Chlorofluorocarbons are chemical compounds made of chlorine, carbon and fluorine. These are…

Q: Explain what triggers the formation of the ozone hole over Antarctica.

A:

Q: How do dirty fuels cause air pollution and what pollutants would be of Interest to you?

A: Dirty fuels combustion (burns with O2) causes air pollution with the following released gases .

Q: b. Water vapor in the atmosphere is inert, that is, it does not react with other substances       c.…

A: Molecular formula of water is H2O, CH4 is the formula of methane and ammonia has molecular formula…

Q: (b) How does application of microwave in chemical reactions make it 'greener'?

A: Answer -

Q: Dilution was “the solution to pollution” for much of human history. What is the meaning of this…

A: Dilution was "the solution to pollution" for much of human history, when populations were small.…

Q: How does filtration work in the chemical industry? Explain each step of the filtration process in…

A:

Q: Climate change caused by greenhouse gases affect the environment and human health. Describe two…

A:

Q: Technician A says that detergents keep oil from forming wax deposits under cold temperatures.…

A: Detergents are amphiphilic substances with polar and non polar tails. Detergents are very useful in…

Q: Consider the reaction between solid zinc and hydrochloric acid where hydrogen gas is collected over…

A:

Q: Nitroglycerine ( C, H,N,0,) is a very strong explosive that degrades over time and is too shock…

A: Number of moles is calculated by using the formula: Number of moles=Given massMolar mass…

Q: More ozone is found in the stratosphere than the troposphere. Why is this?

A: The tropospheric zone is found in between earth surface and stratosphereic zone holds the other 10%…

Q: 9. The equipment of choice to treat particulate matter from electric power plants is____. 10. In…

A: Particulate matter : These are the suspended impurities present in atmosphere , it is  liquid…

Q: In 1970 standard established by the U.S. Government for carbon monoxide emission for automobiles…

A:

Q: In 2008 China was the host for the Olympic Games, however pollution and smog was a major concern for…

A: `In 2008 China was the host for the Olympic Games however pollution and smog was a major concern for…

Q: Saved cept- Calculate mass of Mg to produce hydrogen gas Magnesium metal is reacted with…

A:

Q: (a) What is the difference between chlorofluorocarbonsand hydrofluorocarbons? (b) Why are…

A: (a) Chlorofluorocarbon is a compound that contains chlorine, fluorine and carbon atoms, whereas…

Q: s.com/course.html?courseld%3D15828855&HeplD353706194671Of71a192e43597b01c6e0#10301 Principles of…

A: Given, Volume of gaseous CH4 burned = 0.55L. The balanced equation for combustion of methane with…

Q: Consider the Lewis structure for SO2. How do they compare with the Lewis structure for ozone?

A:

Q: Use the KMT THEORY-How can you put enough helium into a tank to fill 10,000 balloons even though the…

A: Introduction: Kinetic molecular theory (KMT) is the theory of the moving molecules. The gas…

Q: Scientists noticed that the ozone layer was thinning.What was occurring at the same time?

A: Scientists noticed that the ozone layer was thinning and what happens on  at the same time has to be…

Q: What do you mean by Flue gas conditioning?

A: Flue Gas Conditioning is the controlled injection of small quantities of sulfur trioxide into the…

Q: The amount of anthropogenic SO2 emission from Pakistan was 180 kilo tonnes (kt) in 20191 . How many…

A: Hours, minute,s and seconds are some common units of time. These units can be converted into each…

Q: What is illustrated in the following figure? extra half-plane of atoms atoms diffuse to regions of…

A: Each dislocation is associated with a strain field which contribute small and finite amount to the…

Q: Is other serious pollutant in smog carbon monoxide.

A:

Q: 11.4. a) Which layer contains the most ozone? b) How thick is the troposphere? c) What type of gas…

A: Given problem is based on earth atmosphere and how this atmosphere affects the climate of the earth.

Q: Explain why the concentration of CFCs increased in the atmosphere.

A: Chlorofluorocarbons(CFCs) are a chlorine-containing compound used in several appliances and cause…

Q: The vast majority of scientists believe that human activities are causing global warming. Describe…

A: Human activities causes global warming this can be explained by following phenomenon - 1) Due to…

Q: What effect could a volcanic eruption have on the ozone layer? Use your knowledge of atmospheric…

A: The layer which is made up of ozone molecules that protects Earth from almost all the sun's harmful…

Q: How many grams of water vapor is formed as a result of the reaction? How many liters of carbon…

A: Given Methane = 774 g

Q: ozone levels in urban areas reach unhealthy levels, residents are typically urged to avoid refueling…

A: Ozone is a very important chemical compound. When it is present in the stratosphere, it is very…

Q: Volcanoes release several different gases during eruptions. Which of these gases has been shown to…

A: The gas that causes cooling of climate for one or more years after an eruption has to be given.

Q: Differentiate between London smog and Los Angeles smog?

A: Given terms,             London smog and Los Angeles smog

Q: The chemical elements involved in MSG and the chemical bonding and properties for MSG.

A: MSG is the short form of chemical compound Monosodium glutamate, commonly known as ajinomoto. It is…

Q: When ozone levels in urban area reach unhealthy levels, residents are typically urged to avoid…

A: The chemical reactions that lead to the formation of smog are: Nitrogen dioxide breaks down in…

Q: Why is it important to have a good waste management in the laboratory. Explain and give example.

A: It is very important to have good waste management in the laboratory.

Q: Why does a smelly gas produced in a factory can move a long distance from where it was produced?

A:

Q: What is the Michaelis-Menten equation? a. What is the significance of a large Km? a small Km? b.…

A: Michaelis-Menten equation is used to describe the nature and rate of the enzyme-mediated reactions.…

Q: What is the difference between associated gas and natural gas

A: The energy source from fossils which are deep beneath the surface of the earth is natural gas. They…

Q: What is smog? The London smog is caused in which season and time of the day?

A: Smog is a mixture of smoke (the collection of airborne particulates) and fog (vapor form of water).…

Q: Suppose 295 gof NO3 flows into a swamp each day. What volume of N2 would be produced each day at…

A:

Q: Describe the principle of electrostatic precipitator and cyclone separator. How these…

A: Principle of Electrostatic Precipitator: Electrostatic precipitators work on the standard of the…