(8): the equilibrium constant K. at 375°C is 1.2. Starting with [H2lo 0.48 M, which gases will have increased in concen- tration and which will have decreased in concentra- tion when the mixture comes to equilibrium? 0.76 M, [N,lo D0.60 M, and [NH3J0 %3D %3D %3D For the reaction 'H,(g) + CO,(g) = H,O(g) + CO(g) at 700°C, K, = moles of H, that are present at equilibrium if a mix- ture of 0.300 mole of CO and 0.300 mole of H,O is 3D0.534. Calculate the number of heated to 700°C in a 10.0-L container. At 1000 K, a sample of pure NO2 gas decomposes: 2NO2(g) 2NO(g) + O2(g) The equilibrium constant Kp is 158. Analysis shows ilibrium

(8): the equilibrium constant K. at 375°C is 1.2. Starting with [H2lo 0.48 M, which gases will have increased in concen- tration and which will have decreased in concentra- tion when the mixture comes to equilibrium? 0.76 M, [N,lo D0.60 M, and [NH3J0 %3D %3D %3D For the reaction 'H,(g) + CO,(g) = H,O(g) + CO(g) at 700°C, K, = moles of H, that are present at equilibrium if a mix- ture of 0.300 mole of CO and 0.300 mole of H,O is 3D0.534. Calculate the number of heated to 700°C in a 10.0-L container. At 1000 K, a sample of pure NO2 gas decomposes: 2NO2(g) 2NO(g) + O2(g) The equilibrium constant Kp is 158. Analysis shows ilibrium

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter12: Chemical Equilibrium

Section12.5: Using Equilibrium Constants

Problem 12.6PSP

See similar textbooks

Similar questions

For the system SO3(g)SO2(g)+12 O2(g)at 1000 K, K=0.45. Sulfur trioxide, originally at 1.00 atm pressure, partially dissociates to SO2 and O2 at 1000 K. What is its partial pressure at equilibrium?
What is the pressure of BrCl in an equilibrium mixture of Cl2, Br2, and BrCl if the pressure of CI2 in the mixture is 0.115 atm and the pressure of Br2 in the mixture is 0.450 atm? Cl2(g)+Br2(g)2BrCl(g)KP=4.7102
Nitrogen, hydrogen, and ammonia are in equilibrium in a 1000-L reactor at 550 K. The concentration of N2 is 0.00485 M, H2 is 0.022 M, and NH3 is 0.0016 M. The volume of the container is halved, to 500 L. (a) Calculate the equilibrium constant. (b) Define y as the change in the concentration of nitrogen in the 500-L container. Is y positive or negative? (c) Write the iCe table and express the equilibrium constant in a polynomial in terms of y.
At a certain temperature, K=0.29 for the decomposition of two moles of iodine trichloride, ICl3(s), to chlorine and iodine gases. The partial pressure of chlorine gas at equilibrium is three times that of iodine gas. What are the partial pressures of iodine and chlorine at equilibrium?
Show that the complete chemical equation, the total ionic equation, and the net ionic equation for the reaction represented by the equation KI(aq)+I2(aq)KI3(aq) give the same expression for the reaction quotient. KI3 is composed of the ions K+ and I3-.
The ore cinnabar (HgS) is an important source of mercury. Cinnabar is a red solid whose solubility in water is 5.5 X 10-2 mol L-1. Calculate its \p. What is its solubility' in grams per 100 g of water?
For the reaction 2NO(g)+2H2(g)N2(g)+2H2O(g) it is determined that, at equilibrium at a particular temperature, the concentrations are as follows: [NO(g)] = 8.1 103 M, [H2(g)] = 4.1 105 M, [N2(g)] = 5.3 102 M, and [H2O(g)] = 2.9 103 M. Calculate the value of K for the reaction at this temperature.
The following equilibrium was studied by analyzing the equilibrium mixture for the amount of H2S produced. Sb2S3(s)+3H2(g)2Sb(s)+3H2S(g) A vessel whose volume was 2.50 L was filled with 0.0100 mol of antimony(III) sulfide, Sb2S3, and 0.0100 mol H2. After the mixture came to equilibrium in the closed vessel at 440C, the gaseous mixture was removed, and the hydrogen sulfide was dissolved in water. Sufficient lead(II) ion was added to react completely with the H2S to precipitate lead(II) sulfide, PbS. If 1.029 g PbS was obtained, what is the value of Kc at 440C?
A common type of reaction we will study is that having a very small K value (K 1). Solving for equilibrium concentrations in an equilibrium problem usually requires many mathematical operations to be perfomed. However, the math involved when solving equilibrium problems for reactions having small K values (K 1) is simplified. What assumption is made when solving the equilibrium concentrations for reactions with small K values? Whenever assumptions are made, they must be checked for validity. In general, the 5% rule is used to check the validity of assuming x (or 2 x, 3x, and so on) is very small compared to some number. When x (or 2 x. 3x. and so on) is less than 5% of the number the assumption was made against, then the assumption is said to be valid. If the 5% rule fails, what do you do to solve for the equilibrium concentrations?
In a particular experiment, the equilibrium constant measured for the reaction, Cl2(g)+NO2(g)Cl2NO2(g), is 2.8. Based on this measurement, calculate AG° for this reaction. Calculate AG° using data from Appendix E at the back of the book and discuss the agreement between your two calculations.
Because calcium carbonate is a sink for CO32- in a lake, the student in Exercise 12.39 decides to go a step further and examine the equilibrium between carbonate ion and CaCOj. The reaction is Ca2+(aq) + COj2_(aq) ** CaCO,(s) The equilibrium constant for this reaction is 2.1 X 10*. If the initial calcium ion concentration is 0.02 AI and the carbonate concentration is 0.03 AI, what are the equilibrium concentrations of the ions? A student is simulating the carbonic acid—hydrogen carbonate equilibrium in a lake: H2COj(aq) H+(aq) + HCO}‘(aq) K = 4.4 X 10"7 She starts with 0.1000 AI carbonic acid. What are the concentrations of all species at equilibrium?
A sample of gaseous nitrosyl bromide (NOBr) was placed in a container tiued with a frictionless, massless piston, where it decomposed at 25C according to the following equation: 2NOBr(g)2NO(g)+Br2(g) The initial density of the system was recorded as 4.495 g/L. After equilibrium was reached, the density was noted to be 4.086 g/L. a. Determine the value of the equilibrium constant K for the reaction. b. If Ar(g) is added to the system at equilibrium at constant temperature, what will happen to the equilibrium position? What happens to the value of K? Explain each answer