A 2.57 g sample of a substance suspected of being pure gold is warmed to 72.9 °C and submerged into 15.4 g of water initially at 25.0 °C. The final temperature of the mixture is 26.7 °C. What is the specific heat capacity of the unknown substance? Express your answer using two significant figures.

A 2.57 g sample of a substance suspected of being pure gold is warmed to 72.9 °C and submerged into 15.4 g of water initially at 25.0 °C. The final temperature of the mixture is 26.7 °C. What is the specific heat capacity of the unknown substance? Express your answer using two significant figures.

Chemistry: An Atoms First Approach

2nd Edition

ISBN:9781305079243

Author:Steven S. Zumdahl, Susan A. Zumdahl

Publisher:Steven S. Zumdahl, Susan A. Zumdahl

Chapter7: Chemical Energy

Section: Chapter Questions

Problem 109AE: A sample of nickel is heated to 99.8C and placed in a coffee-cup calorimeter containing 150.0 g...

See similar textbooks

Similar questions

A sample of 0.562 g of carbon is burned in oxygen in a bomb calorimeter, producing carbon dioxide. Assume both the reactants and products are under standard state conditions, and that the heat released is directly proportional to the enthalpy of combustion of graphite. The temperature of the calorimeter increases from 26.74 C to 27.93 C. What is the heat capacity of the calorimeter and its contents?
A 5.00-g sample of aluminum pellets (specific heat capacity = 0.89 J/C g) and a 10.00-g sample of iron pellets (specific heat capacity = 0.45 J/C g) are heated to 100.0C. The mixture of hot iron and aluminum is then dropped into 97.3 g water at 22.0C. Calculate the final temperature of the metal and water mixture, assuming no heat loss to the surroundings.
Microwave ovens convert radiation to energy. A microwave oven uses radiation with a wavelength of 12.5 cm. Assuming that all the energy from the radiation is converted to heat without loss, how many moles of photons are required to raise the temperature of a cup of water (350.0 g, specific heat =4.18J/gC) from 23.0C to 99.0C?
A piece of titanium metal with a mass of 20.8 g is heated in boiling water to 99.5 C and then dropped into a coffee-cup calorimeter containing 75.0 g of water at 21.7 C. When thermal equilibrium is reached, the final temperature is 24.3 C. Calculate the specific heat capacity of titanium.
The addition of 3.15 g of Ba(OH)28H2O to a solution of 1.52 g of NH4SCN in loo g of water in a calorimeter caused the temperature to fall by 3.1 C. Assuming the specific heat of the solution and products is 4.20 J/g C, calculate the approximate amount of heat absorbed by the reaction, which can be represented by the following equation: Ba(OH)28H2O(s)+2NH4SCN(aq)Ba(SCN)2(aq)+2NH3(aq)+10H2O(l)
9.100 Two baking sheets are made of different metals. You purchase both and bake a dozen cookies on each sheet at the same time in your oven. You observe that after 9 minutes, the cookies on one sheet are slightly burned on the bottom, whereas those on the other sheet are fine. (You are curious and you vary the conditions so you know the result is not caused by the oven.) (a) How can you use this observation to infer something about the specific heat of the materials in the baking sheets? (b) What is themathematical reasoning (equation) that you need to support your conclusion?
In which of the following systems is(are) work done by the surroundings on the system? Assume pressure and temperature are constant. a. 2SO2(g)+O2(g)2SO3(g) b.CO2(s)CO2(g) c. 4NH3(g)+7O2(g)4NO2(g)+6H2O(g) d.N2O4(g)2NO2(g) e.CaCO3(s)CaCO(s)+CO2(g)
9.50 When a 13.0-g sample of NaOH(s) dissolves in 400.0 mL of water in a coffee cup calorimeter, the temperature of the water changes from 22.6°C to 30.7C Assuming that the specific heat capacity of the solution is the same as for water, calculate (a) the heat transfer from system to surroundings and (b) H for the reaction NaOH(s)Na+(aq)+OH(aq)
The head of a strike anywhere match contains tetraphosphorus trisulfide, P4S3. In an experiment, a student burned this compound in an excess of oxygen and found that it evolved 3651 kJ of heat per mole of P4S3 at a constant pressure of 1 atm. She wrote the following thermochemical equation: P4S3(s)+8O2(g)P4O10(s)+3SO2(g);H=3651kJ Calculate the standard enthalpy of formation of P4S3, using this students result and the following standard enthalpies of formation: P4O10(s), 3009.9 kJ/mol; SO2(g), 296.8 kJ/mol. How does this value compare with the value given in Appendix C?
9.47 If 14.8 kJ of heat is given off when 1.6 g of HCl condenses from vapor to liquid, what is Hcond for this substance?
Nitrogen gas (2.75 L) is confined in a cylinder under constant atmospheric pressure (1.01 105 pascals). The volume of gas decreases to 2.10 L when 485 J of energy is transferred as heat to the surroundings. What is the change in internal energy of the gas?