A 7.24-g sample of ethane occupies 4.65 L at 294 K. (a) Calculate the work done when the gas expands isothermally against a constant external pressure of 0.500 atm until its volume is 6.87 L. (b) Calculate the work done if the same expansion occurs reversible.

How is the sign of q, heat, defined? How does it relate to the total energy of the system?

In which of the following systems is(are) work done by the surroundings on the system? Assume pressure and temperature are constant. a. 2SO2(g)+O2(g)2SO3(g) b.CO2(s)CO2(g) c. 4NH3(g)+7O2(g)4NO2(g)+6H2O(g) d.N2O4(g)2NO2(g) e.CaCO3(s)CaCO(s)+CO2(g)

Calculate the work donewhen 1.000 mole of an ideal gas expands reversiblyfrom 1.0L to 10L at 298.0K. Then, calculatethe amount ofwork done when the gasexpands irreversibly against aconstant external pressure of 1.00 atm. Compare thetwovaluesand comment.

A sample of ethanol, C2H5OH, weighing 2.84 g was burned in an excess of oxygen in a bomb calorimeter. The temperature of the calorimeter rose from 25.00C to 33.73C. If the heat capacity of the calorimeter and contents was 9.63 kJ/C, what is the value of q for burning 1.00 mol of ethanol at constant volume and 25.00C? The reaction is C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) Is q equal to U or H?

A volume of 1.50 L of argon gas is confined in a cylinder with a movable piston under a constant pressure of 1.22 105 Pa. When 1.25 kJ of energy in the form of heat is transferred from the surroundings to the gas, the internal energy of the gas increases by 1.11 kJ. What is the final volume of argon gas in the cylinder?

Apistonhaving0.033 mol ofgas at 35.0Cexpands from0.77 Lto 2.00L.Calculate the work performed if theexpansion occurs a against an externalpressure of 0.455atm,andbreversibly.

A sample of benzene, C6H6, weighing 3.51 g was burned in an excess of oxygen in a bomb calorimeter. The temperature of the calorimeter rose from 25.00C to 37.18C. If the heat capacity of the calorimeter and contents was 12.05 kJ/C, what is the value of q for burning 1.00 mol of benzene at constant volume and 25.00C? The reaction is C6H6(l)+152O2(g)6CO2(g)+3H2O(l) Is q equal to U or H?