Answered: A compound has an empirical formula of…

A compound has an empirical formula of C3H¬NO and a molar mass of 146.22 g. What is its molecular formula? C9H21N3O3 O C3H,NO O C6H14N202

Chemistry: An Atoms First Approach

2nd Edition

ISBN:9781305079243

Author:Steven S. Zumdahl, Susan A. Zumdahl

Publisher:Steven S. Zumdahl, Susan A. Zumdahl

Chapter5: Stoichiometry

Section: Chapter Questions

Problem 138AE: Terephthalic acid is an important chemical used in the manufacture of polyesters and plasticizers....

See similar textbooks

Related questions

Q: C. What is the mass (in grams) of 5.03 × 1022 molecules of CO2 molecules?

A: Number of molecules of any species is given by, => Number of molecules = moles X Avogadro's…

Q: What is the molecular formula of a compound with an empirical formula of CH and a molar mass of 78.1…

Q: 5. If a hydrocarbon compound has a formula mass of 16.04g, what is its empirical formula? О СН2 O…

A: Given :- Empirical formula CH2 CH4 C2H2 CH3 Empirical Formula mass = 16.04 g To identify :-…

Q: The empirical formula of a compound is C2H5O. Its molecular mass is 135.112. What is its molecular…

A: Molecular mass = n × Empirical formula mass

Q: What number of molecules (or formula units) are present in 2.93 g of each of the following…

Q: An unknown compound contains 57.14% carbon, 6.16% hydrogen, 9.52% nitrogen, and the rest oxygen, by…

Q: A compound is 43.7 % P, and 56.3 % O by mass, and has a molar mass of 283.88 g/mol. What is the…

A: Element % composition Atomic Mass Relative no of atom=% compositionatomic mass Simplest atomic ratio…

Q: The compound chloral hydrate, known in detective stories as knockout drops, is composed of 14.52% C,…

A: The empirical formula of a compound gives the proportions of the elements present in the compound.…

Q: What is the molecular formula of a compound if its molar mass is 183.2 g/mol and its empirical…

A: Consider the given information is as follows; Molar mass of compound = 183.2 g/mol…

Q: 3) The molar mass of Cu (CO3)2.3H20is: 237.562 g/mol a) b) 183.53 g/mol 201.53 g/mol 160.88 g/mol c)…

Q: A mole of a compound composed of nitrogen and oxygen (N xO y) has a molecular weight of 92.0 g/mol.…

A: Given, Empirical formula = NxOy Molecular weight of NxOy = 92 g/mol

Q: What is the empirical formula of a compound that is 62.0% C, 10.4% H, and 27.5% O by mass? C6HO3…

A: Given, percentage of C = 62.0 % percentage of H = 10.4 % percentage of O = 27.5 % we are asked to…

Q: 1. a. What is the empirical formula of a compound with the following mass composi- tion: 40.92% C…

Q: What is the molecular formula of a compound with the empirical formula CH2 if the molecular mass of…

A: Given : Empirical formula = CH2 And molar mass of compound = 56.10 g/mol

Q: A compound contains 24.3% C, 4.1% H, and 71.6% Cl by mass, and has a molar mass of 99 g/mol. What is…

Q: The compound is CH4N2O. If the molecular weight of the compound is 120.12 g/mol, what is the…

Q: A compound is composed of element X and hydrogen. Analysis shows the compound to be 80% X by mass,…

A: Given data :- A compound is composed of element X and hydrogen. Analysis shows the compound to be…

Q: C4H8O2 A compound has a molar mass of 120.10 g/mol. What is the molecular formula of this compound…

A: Since we know that Molecular formula = (empirical formula)y Hence molecular formula = (CH2O)y =…

Q: Suppose you have a compound which has an empirical formula of C4H5N2O and molar mass of 194 g/mol.…

A: We have empirical formula as C4H5N2O We have molar mass as 194 g/mol We have to calculate the…

Q: A compound composed of 3.3% H, 19.3% C, and 77.4% O3.3% H, 19.3% C, and 77.4% O has a molar mass of…

A: The following percentages are given: H => 3.3% C=> 19.3% O=>77.4% The molar mass of the…

Q: Calculate the mass in grams of 3.07×10243.07×1024 molecules of propane. The chemical formula for…

A: Given that : The number of molecules of propane = 3.07×1024 The chemical formula for propane is…

Q: The empirical formula of codeine is C18H21NO3. If the molar mass of codeine is 299 g/mol, what is…

A: In this question empirical formula of codeine is given and we want to determine the Molecular…

Q: What is the empirical formula of a compound with the following composition: 24.78% C, 1.05% H, and…

A: Empirical formula can be calculated by these steps dividing mass percent with molar mass to get…

Q: Codeine, a narcotic drug used to treat cough, has an empirical formula of C18H21NO3. What is the…

A: Please find your solution below :

Q: Calculate the mass in grams 5.40•1024 molecules of propane. The chemical formula for propane is…

A: The chemical formula of propane is C3H8. Chemical formula of a compound indicates 1 mole of its…

Q: What mass of oxygen difluoride OF2, contains the same number of fluorine atoms as 5.20 g of…

A: Mole concept: The number of molecules or atoms present in the one mole of the substance is equal to…

Q: A compound has an empirical formula of HgCl. If the molecular mass of the compound is 472.2 g/mol,…

A: Here we are required to find the molecular formula.

Q: A molecule is found to contain 64.27% by mass C, 7.191% by mass H, and 28.54% by mass O. It’s molar…

A: The given organic compound is made up of C, H and O atoms. Molar mass of the given compound is 168…

Q: What is the mass of each compound, h kilograms? a. 34.8 mol of sodium metasilicate, Na2Si03(s) b.…

A: The solution is given below -

Q: What is the empirical formula of a compound that is 40% carbon, 7% hydrogen and 53% oxygen by mass…

A: ANSWER : Option (ii) CH2O is correct answer. Solution: Empirical formula of a compound = ? that is…

Q: What is the mass percent composition of oxygen in a compound having the empirical formula C20H34O4?

Q: The chlorophyll-a molecule (C55H72MgN4O5) is important in photosynthesis. (a) Determine its…

A: a) Since molecular mass = sum of ( Atomic mass of atoms X number of atoms in the molecule) Hence…

Q: What is the molecular formula of a compound with the empirical formula CH2O and a formula mass of…

A: Empirical formula of compound=CH2O Mass of empirical formula=1 x atomic mass of C + 2 x atomic mass…

Q: What is the empirical formula and molecular formula

A: Given :- percentage composition of Na = 43.38 % percentage composition of C = 11.33 % percentage…

Q: A compound is found to contain 58.80 % xenon 7.166 oxygen, and 34.04% fluorine by mass.The molar…

Q: EDTA, which is short for ethylenediaminetetraacetic acid, is a chemical used in the textile industry…

Q: The empirical formula a compound is C 2H 40 and its molecular weight was determined to be…

A: Empirical formula is the simplest ratio of atoms present in molecule. Therefore ratio of elements C:…

Q: A mixture consisting of 11.6 g of calcium fluoride, CaF2, and 10.0 g of sulfuric acid, H2 SO4, is…

Q: A compound contains 39.0 % C, 6.72 % H and 53.4 % O by mass. a) What is its empirical formula? b)…

A: Given: A compound contains 39.0 % C, 6.72 % H and 53.4 % O by mass which means that 100 g of a…

Q: Aspartame is an artificial sweetener that is 160 times sweeter than sucrose (table sugar) when…

A: Hi, since there are multiple questions posted we will provide you with answers for the first two…

Q: What is the molecular formula of a compound with a percent composition of 49.47% C, 5.201% H, 28.84%…

A: The given data contains, Carbon =49.47% Hydrogen =5.201% Nitrogen =28.84% Oxygen =16.48 %

Q: Calculate the molar mass for each of the following compounds: CH₂ g/mol (a) cyclopropane, CH₂ Molar…

Q: What mass of compound is present in 5.80 moles of each of the following compounds? H. ON a. Mass b.…

Q: A compound has the empirical formula CH,O and a molar mass of approximately-180. g/mol. What is its…

A: Divide the molar mass of the compound by the empirical formula mass. The result should be a whole…

Q: What is the molecular formula of a compound if its molar mass is 183.2 g/mol and its empirical…

Q: A compound is composed of 85.6% C and 14.4% H. What is its molecular formula if the molar mass is…

A: Given data, The mass of carbon = 85.6% = 85.6 g The mass of hydrogen = 14.4% = 14.4 g The no. of…

Q: Glucose contains 39.95% C, 6.71% H, and 53.34% O, by mass. If the molar mass of glucose was found…

A: A numerical problem based on determination of molecular formula, which is to be accomplished.

Q: Which mass of the molecular elements below would just contain Avogadro’s number of molecules? a. 76…

Concept explainers

Mole Concept

Mole concept is a method to determine the amount of any substance that consists of some elemental particles using a grouping unit called ‘mole’. The mole concept enables one to handle the large amount of small elementary particles. The mole concept can be used in many calculations related to mole calculation, molar amount, mole ratio, and so on, which are significant in chemistry.

Question

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps with 2 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Cyanogen gas, C2N2, has been found in the gases of outer space. It can react with fluorine to form carbon tetrafluoride and nitrogen trifluoride. C2N2(g)+7F2(g)2CF4(g)+2NF3(g)(a) How many moles of fluorine react with 1.37 mol of cyanogen? (b) How many moles of CF4 are obtained from 13.75 mol of fluorine? (c) How many moles of cyanogen are required to produce 0.8974 mol of NF3? (d) How many moles of fluorine will yield 4.981 mol of nitrogen trifluoride?
True or false? The atom with the largest subscript in a formula is die atom with the largest percent by mass in the compound. If true, explain why with an example. If false, explain why with an example. In either case, provide mathematical support
or each of the following reactions, give the balanced chemical equation for the reaction and state the meaning of the equation in terms of individual molecules and in terms of moles of molecules. msp;MnO2(s)+Al(s)Mn(s)+Al2O3(s) msp;B2O3(s)+CaF2(s)BF3(g)+CaO(s) msp;NO2(g)+H2O(l)HNO3(aq)+NO(g) msp;C6H2(g)+H2C6(g)H12(g)
Copper(I) iodide (CuI) is often added to table salt as a dietary source of iodine. How many moles of CuI Are contained in 1.00 lb (454 g) of table salt containing 0.0100% CuI by mass?
Select the quantity that contains the greater number of atoms in each of the following pairs of substances. a. 0.100 mole C atoms or 0.200 mole Al atoms b. Avogadros number of C atoms or 0.750 mole Al atoms c. 6.02 1023 C atoms or 1.50 moles Al atoms d. 6.50 1023 C atoms or Avogadros number of Al atoms
Select the quantity that contains the greater number of atoms in each of the following pairs of substances. a. 0.100 mole N atoms or 0.300 mole P atoms b. 6.18 1023 N atoms or Avogadros number of P atoms c. Avogadros number of N atoms or 1.20 moles of P atoms d. 6.18 1023 N atoms or 2.00 moles P atoms
Para-cresol, a substance used as a disinfectant and in the manufacture of several herbicides, is a molecule that contains the elements carbon, hydrogen, and oxygen. Complete combustion of a 0.345-g sample of p-cresol produced 0.983 g carbon dioxide and 0.230 g water. Determine the empirical formula for p-cresol.
Freon- 12 (CCI2F2) is used as a refrigerant in air conditioners and as a propellant in aerosol cans. Calculate the number of molecules of Freon-12 in 5.56 mg of Freon-12. What is the mass of chlorine in 5.56 mg of Freon-12?
what is the percent yeild of carbon dioxide if the recaction of 75.0g of carbon monoxide produces 85.0g of carbon dioxide? Fe2O3(s) + 3CO(g)-->2Fe(s) +3CO2(g)
What is the mass in grams of NO that can be formed from 3.18 moles of NO₂ in the reaction below? 3 NO₂ (g) + H₂O (g) → 2 HNO₃ (g) + NO (g). Round to the right amount of sig figs.
Pls provide clear solution on B & C 1. The Freons are a class of compounds containing carbon, chlorine, and fluorine. While they have many valuable uses, they have been shown to be responsible for depletion of the ozone in the upper atmosphere. In 1991, two replacement compounds for Freons went into production: HFC 134a (CH₂FCF 3) and HCFC-124 (CHCIFCF 3). to a. Calculate the molar masses of these two compounds(CH₂FCF3 and CHCIFCF 3). b. What is the percent composition of CH₂FCF 3? c. What is the percentage of Chlorine present in CHCIFCF 3.
PERCENT COMPOSITION AND EMPIRICAL FORMULA OF A HYDRATE Partial empirical formula of the hydrate used: CoCl2 • -----> H2O Mass of empty beaker + watch glass: 154.00g Mass of beaker and hydrate (before heating): 155.58g Mass of beaker and anhydrous salt (after heating): 154.72g A. Show the calculations for determining the mass of the hydrate used: B. Show the calculations for determining the mass of anhydrous salt produced: C. Show the calculations for determining the mass of water in the original hydrate: D. Show the calculations for determining the expirimental percent of water in the hydrate: