A scientist measures the standard enthalpy change for the following reaction to be -14.6 kJ : Ca(OH)2(aq2 HCl(aq) CaCl2(s) 2 H2O(I) Based on this value and the standard enthalpies of formation for the other substances, the standard enthalpy of formation of HCl(aq) is kJ/mol

A scientist measures the standard enthalpy change for the following reaction to be -14.6 kJ : Ca(OH)2(aq2 HCl(aq) CaCl2(s) 2 H2O(I) Based on this value and the standard enthalpies of formation for the other substances, the standard enthalpy of formation of HCl(aq) is kJ/mol

Chemistry: Principles and Practice

3rd Edition

ISBN:9780534420123

Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Publisher:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Chapter5: Thermochemistry

Section: Chapter Questions

Problem 5.86QE: One of the components of jet engine fuel is n-dodecane, C12H26(), which has a standard enthalpy of...

See similar textbooks

Related questions

Q: A scientist measures the standard enthalpy change for the following reaction to be 79.4 kJ:…

A: The difference between the standard enthalpy of products and the reactants is known as change in…

Q: A scientist measures the standard enthalpy change for the following reaction to be -171.6 kJ :…

A: Given;

Q: A scientist measures the standard enthalpy change for the following reaction to be 316.2 kJ : H2S(g)…

Q: 5.99 From the enthalpy of formation for CO, and the following information, calculate the standard…

A: Given data: ∆H°=-283 kj/mol From standard table; ∆Hf°(CO2(g) is given by, ∆Hf°=-393.5 kj/mol

Q: A scientist measures the standard enthalpy change for the following reaction to be -17.2 kJ :…

A: Given- Reaction Ca(OH)2(aq) + 2 HCl (aq) → CaCl2(s) + 2 H2O(l) ∆H°rxn = -17.2 kJ To find- ∆H°fHCl…

Q: A scientist measures the standard enthalpy change for the following reaction to be -976.0 kJ:…

A: Answer :- The standard enthalpy of formation of H2O(g) = -253.5 kJ/mol.…

Q: A scientist measures the standard enthalpy change for the following reaction to be -1053.4 kJ :…

Q: A scientist measures the standard enthalpy change for the following reaction to be -19.4 kJ :…

A: Given reaction Ca(OH)2(aq) + 2 HCl(aq) ------- > CaCl2(s) + 2 H2O(l) Δ H rxn = -19.4 KJ…

Q: the standard enthalpy of formation of HCl(aq) is kJ/mol.

Q: A scientist measures the standard enthalpy change for the following reaction to be -138.8 kJ : H2(g)…

A: The given reaction is as follows: H2(g)+C2H4(g) → C2H6(g) The standard enthalpy change for the…

Q: A scientist measures the standard enthalpy change for the following reaction to be 5.4 kJ : Fe(s) +…

A: The Standard enthalpy change for the reaction (∆H°rxn) = 5.4 KJ Reaction: Fe(s) + 2 HCl (aq)…

Q: A scientist measures the standard enthalpy change for the following reaction to be -1054.0…

A: For H2S: ΔH∘f=−20.63 kJ/mol For O2: ΔH∘f=0 kJ/mol For H2O:ΔH∘f=−285.8 kJ/mol

Q: The combustion reaction of nitromethane fuel occurs as follows: → 2 CO2(g) + 3 H20(1) + N2(g) 2…

Q: A scientist measures the standard enthalpy change for the following reaction to be 7.8 kJ : Fe(s) +…

A: Consider the given information is as follows; Fes + 2 HClaq → FeCl2s + H2g…

Q: Many portable gas heaters and grills use propane, C3H$(g). Using enthalpies of formation, calculate…

A: The standard enthalpy of reaction is the enthalpy change that occurs in a system when matter is…

Q: A scientist measures the standard enthalpy change for the following reaction to be -189.6 kJ :…

Q: A scientist measures the standard enthalpy change for the following reaction to be -896.4 kJ:…

A: Given : a reaction And ∆H° = -896.4 KJ

Q: A scientist measures the standard enthalpy change for the following reaction to be 80.6…

A: Given, Standard enthalpy change = 80.6kJ. The given reaction is

Q: Pentane (C5H12) is a component of gasoline that burns according to the following balanced equation:…

Q: A scientist measures the standard enthalpy change for the following reaction to be -1152.8 kJ:…

Q: For which one of the following substances is the standard enthalpy of formation, AHf, equal to zero?…

A: Answer: option b: lead [Pb(s)]; having standard enthalpy of formation (∆Hf), equal to zero.

Q: A scientist measures the standard enthalpy change for the following reaction to be 11.0 kJ…

A: Given: Standard reaction enthalpy= 11.0 kJ

Q: A scientist measures the standard enthalpy change for the following reaction to be 209.8 kJ :…

A: Given: CH4(g) + H2O(g) --> 3H2(g) + CO(g) ∆H=209.8 kJ ∆H = ∑∆Hf (product) -∑∆Hf (Reactant) 209.8…

Q: A scientist measures the standard enthalpy change for the following reaction to be -145.7 kJ :…

A: The enthalpy of the reaction is considered as the state function that is it depends only on the…

Q: A scientist measures the standard enthalpy change for the following reaction to be -679.4 kJ :…

A: The given chemical reaction is as follows: 2NH3(g) + 2O2(g) → N2O(g) + 3H2O(l) ,…

Q: A scientist measures the standard enthalpy change for the following reaction to be 4.4 k) : Fe(s) +…

Q: A scientist measures the standard enthalpy change for the following reaction to be -168.0 kJ:…

Q: When a solid dissolves in water, the solution may become hotter or colder. The dissolution enthalpy…

A: Since your question has multiple parts, we will answer the first question for you. If you want…

Q: A scientist measures the standard enthalpy change for the following reaction to be -200.7 kJ :…

A: The given reaction is as follows: CO(g) + 3H2(g) → CH4(g) + H2O(g) The standard enthalpy change for…

Q: A scientist measures the standard enthalpy change for the following reaction to be -52.7 k) :…

Q: A scientist measures the standard enthalpy change for the following reaction to be 214.3 kJ :…

A: Based on this value and the standard enthalpies of formation for the other substances, the standard…

Q: A scientist measures the standard enthalpy change for the following reaction to be -349.0 kJ :…

A: Calculation as shown below

Q: standard enthalpy change for the following reaction to be -208.6 kJ : CO(g) + 3 H2(g)CH4(g) +…

Q: A scientist measures the standard enthalpy change for the following reaction to be -891.8 kJ :…

A: A) ΔHrxn= (Hf )products - (Hf )reactants Hf NH3 = -45.90 kJ/mol (2mol) Hf N2O = x kJ/mol (3mol) Hf…

Q: A scientist measures the standard enthalpy change for the following reaction to be 84.6 kJ :…

A: Known Value:∆Hf°NH4Cl (aq) = Standard enthapy of formation of NH4Cl (aq)…

Q: A scientist measures the standard enthalpy change for the following reaction to be 11.0 kJ…

A: Standard Enthalpy change of a reaction is the sum of the standard enthalpies of products minus the…

Q: A scientist measures the standard enthalpy change for the following reaction to be 98.4 kJ :…

A: In this question we want to determine the standard enthalpy of formation of NH4Cl(aq). You can see…

Q: A scientist measures the standard enthalpy change for the following reaction to be 208.5 kJ :…

Q: A scientist measures the standard enthalpy change for the following reaction to be -1122.2 kJ :…

Q: A scientist measures the standard enthalpy change for the following reaction to be -223.2 kJ :…

Q: A scientist measures the standard enthalpy change for the following reaction to be -348.6 kJ :…

A: The given reaction is : 2Na(s) + 2H2O(l) → 2NaOH(aq) + H2(g) The standard enthalpy change for…

Q: standard enthalpy change

Q: the standard enthalpy change for the following reaction to be -896.4 kJ : 4NH3(g) + 5 O2(g)4NO(g) +…

A: Given, 4 NH3(g) + 5 O2(g) ------> 4 NO(g) + 6 H2O(g) ∆H0Reaction = -896.4 kJ The standard…

Q: A scientist measures the standard enthalpy change for the following reaction to be -573.7 kJ:…

Q: A scientist measures the standard enthalpy change for the following reaction to be -104.0 kJ : CO(g)…

A: The given chemical reaction is as follows: CO(g) + Cl2(g) → COCl2(g) ∆rH°=-104 kJ The…

Q: the standard enthalpy change for the following reaction to be -912.5 kJ: 2NH3(g) + 3 N2O(g)4N2(g) +…

A: Enthalpy of a system is defined as sum of internal energy and its additional pressure volume energy.…

Q: Meals on wheels. Meals-ready-to-eat (MREs) are military meals that can be heated on a flameless…

Q: A scientist measures the standard enthalpy change for the following reaction to be -679.7 kJ :…

A: Thermodynamic is the branch of chemistry that mainly deals with the heat transfer between system and…

Q: A scientist measures the standard enthalpy change for the following reaction to be - 770.6 kJ:…

A: Thermodynamics is branch of chemistry in which we deal with amount of heat evolved or absorbed by…

Q: A scientist measures the standard enthalpy change for the following reaction to be 79.4 kJ:…

A: Consider the given reaction is as follows; NH4Cl(aq) → NH3(g) + HCl(aq)…

Question

A scientist measures the standard enthalpy change for the
following reaction to be -14.6 kJ :
Ca(OH)2(aq2 HCl(aq)
CaCl2(s) 2 H2O(I)
Based on this value and the standard enthalpies of formation
for the other substances, the standard enthalpy of formation
of HCl(aq) is
kJ/mol

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps with 2 images

SEE SOLUTION Check out a sample Q&A here

Similar questions

What is the difference between the enthalpy of reaction and the enthalpy of formation? For what chemical reaction(s) are the two quantities the same?
Another reaction that is used to propel rockets is N2O4(l)+2N2H4(l)3N2(g)+4H2O(g) This reaction has the advantage that neither product is toxic, so no dangerous pollution is released. When the reaction consumes 10.0 g liquid N2O4, it releases 124 kJ of heat. (a) Is the sign of the enthalpy change positive or negative? (b) What is the value of H for the chemical equation if it is understood to be written in molar quantities?
A 250-g sample of water at 20.0C is placed in a freezer that is held at a constant temperature of 20.0C. Considering the water as the system, answer the following questions: a What is the sign of qsys for the water after it is placed in the freezer? b After a few hours, what will be the state of the water? c How will the initial enthalpy for the water compare with the final enthalpy of the water after it has spent several hours in the freezer? d What will the temperature of the water be after several hours in the freezer?
9.50 When a 13.0-g sample of NaOH(s) dissolves in 400.0 mL of water in a coffee cup calorimeter, the temperature of the water changes from 22.6°C to 30.7C Assuming that the specific heat capacity of the solution is the same as for water, calculate (a) the heat transfer from system to surroundings and (b) H for the reaction NaOH(s)Na+(aq)+OH(aq)
Give the definition of the standard enthalpy of formation for a substance. Write separate reactions for the formation of NaCl, H2O , C6H12O6, and PbSO4 that have H values equal to Hf for each compound.
The head of a strike anywhere match contains tetraphosphorus trisulfide, P4S3. In an experiment, a student burned this compound in an excess of oxygen and found that it evolved 3651 kJ of heat per mole of P4S3 at a constant pressure of 1 atm. She wrote the following thermochemical equation: P4S3(s)+8O2(g)P4O10(s)+3SO2(g);H=3651kJ Calculate the standard enthalpy of formation of P4S3, using this students result and the following standard enthalpies of formation: P4O10(s), 3009.9 kJ/mol; SO2(g), 296.8 kJ/mol. How does this value compare with the value given in Appendix C?
9.53 Using these reactions, find the standard enthalpy change for the formation of 1 mol of PhO(s) from lead metal and oxygen gas. PbO(s)+C(graphite)Pb(s)+CO(g) H = 106.8 kJ 2C(graphite)+O2(g)2CO(g) H= -221.0 kJ If 250 g of lead reacts with oxygen to form lead(II) oxide, what quantity of thermal energy (in kJ) is ahsorhed or evolved?
A sample of nickel is heated to 99.8C and placed in a coffee-cup calorimeter containing 150.0 g water at 23.5C. After the metal cools, the final temperature of metal and water mixture is 25.0C. If the specific heat capacity of nickel is 0.444 J/C g, what mass of nickel was originally heated? Assume no heat loss to the surroundings.
A 50-mL solution of a dilute AgNO3 solution is added to 100 mL of a base solution in a coffee-cup calorimeter. As Ag2O(s) precipitates, the temperature of the solution increases from 23.78 C to 25.19 C. Assuming that the mixture has the same specific heat as water and a mass of 150 g, calculate the heat q. Is the precipitation reaction exothermic or endothermic?
Methanol (CH3OH) has also been proposed as an alternative fuel. Calculate the standard enthalpy of combustion per gram of liquid methanol, and compare this answer to that for ethanol in Exercise 87.
Ethylene glycol, HOCH2CH2OH, is used as antifreeze. It is produced from ethylene oxide, C2H4O, by the reaction C2H4O(g)+H2O(l)HOCH2CH2OH(l) Use Hesss law to obtain the enthalpy change for this reaction from the following enthalpy changes: 2C2H4O(g)+5O2(g)4CO2(g)+4H2O(l);H=2612.2kJHOCH2CH2OH(l)+52O2(g)2CO2(g)+3H2O(l);H=1189.8kJ
Hydrogen sulfide, H2S, is a poisonous gas with the odor of rotten eggs. The reaction for the formation of H2S from the elements is H2(g)+18S3(rhombic)H2S(g) Use Hesss law to obtain the enthalpy change for this reaction from the following enthalpy changes: H2S(g)+32O2(g)H2O(g)+SO2(g);H=518kJH2(g)+12O2(g)H2O(g);H=242kJ18S8(rhombic)+O2(g)SO2(g);H=297kJ

SEE MORE QUESTIONS

Recommended textbooks for you

Chemistry: Principles and Practice

Chemistry

ISBN:

9780534420123

Author:

Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Publisher:

Cengage Learning

Chemistry

ISBN:

9781133611097

Author:

Steven S. Zumdahl

Publisher:

Cengage Learning

Chemistry

ISBN:

9781305957404

Author:

Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:

Cengage Learning

Chemistry: An Atoms First Approach

Chemistry

ISBN:

9781305079243

Author:

Steven S. Zumdahl, Susan A. Zumdahl

Publisher:

Cengage Learning

General Chemistry - Standalone book (MindTap Cour…

Chemistry

ISBN:

9781305580343

Author:

Steven D. Gammon, Ebbing, Darrell Ebbing, Steven D., Darrell; Gammon, Darrell Ebbing; Steven D. Gammon, Darrell D.; Gammon, Ebbing; Steven D. Gammon; Darrell

Publisher:

Cengage Learning

Chemistry for Engineering Students

Chemistry

ISBN:

9781337398909

Author:

Lawrence S. Brown, Tom Holme

Publisher:

Cengage Learning

Chemistry: Principles and Practice

Chemistry

ISBN:

9780534420123

Author:

Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Publisher:

Cengage Learning

Chemistry

ISBN:

9781133611097

Author:

Steven S. Zumdahl

Publisher:

Cengage Learning

Chemistry

ISBN:

9781305957404

Author:

Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:

Cengage Learning

Chemistry: An Atoms First Approach

Chemistry

ISBN:

9781305079243

Author:

Steven S. Zumdahl, Susan A. Zumdahl

Publisher:

Cengage Learning

General Chemistry - Standalone book (MindTap Cour…

Chemistry

ISBN:

9781305580343

Author:

Steven D. Gammon, Ebbing, Darrell Ebbing, Steven D., Darrell; Gammon, Darrell Ebbing; Steven D. Gammon, Darrell D.; Gammon, Ebbing; Steven D. Gammon; Darrell

Publisher:

Cengage Learning

Chemistry for Engineering Students

Chemistry

ISBN:

9781337398909

Author:

Lawrence S. Brown, Tom Holme

Publisher:

Cengage Learning

SEE MORE TEXTBOOKS