107. A student ran the following reaction in the laboratory at 287 K:2CH₂Cl₂ (9) CH. (g) + CCl4 (9)When she introduced 0,0732 moles of CH₂Cl₂ (g) into a 1.00 liter container, she found the equilibrium concentration of CCL, (g)to be 0.0340 M.Calculate the equilibrium constant, Ke. she obtained for this reaction.Ke

Answered: Image /qna-images/answer/5ebe7c0c-73c7-4df6-91a8-2415187f2f16.jpg

A student ran the following reaction in the laboratory at 287 K: 2CH₂Cl₂ (9) CH. (g) + CCl4 (9) When she introduced 0.0732 moles of CH₂Cl₂ (9) into a 1.00 liter container, she found the equilibrium concentration of CCl4 (9) to be 0.0340 M. Calculate the equilibrium constant, Ke, she obtained for this reaction. Ke

A student ran the following reaction in the laboratory at 287 K: 2CH₂Cl₂ (9) CH. (g) + CCl4 (9) When she introduced 0.0732 moles of CH₂Cl₂ (9) into a 1.00 liter container, she found the equilibrium concentration of CCl4 (9) to be 0.0340 M. Calculate the equilibrium constant, Ke, she obtained for this reaction. Ke

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter19: The Chemistry Of The Main-group Elements

Section: Chapter Questions

Problem 60QRT

See similar textbooks

Similar questions

Because calcium carbonate is a sink for CO32- in a lake, the student in Exercise 12.39 decides to go a step further and examine the equilibrium between carbonate ion and CaCOj. The reaction is Ca2+(aq) + COj2_(aq) ** CaCO,(s) The equilibrium constant for this reaction is 2.1 X 10*. If the initial calcium ion concentration is 0.02 AI and the carbonate concentration is 0.03 AI, what are the equilibrium concentrations of the ions? A student is simulating the carbonic acid—hydrogen carbonate equilibrium in a lake: H2COj(aq) H+(aq) + HCO}‘(aq) K = 4.4 X 10"7 She starts with 0.1000 AI carbonic acid. What are the concentrations of all species at equilibrium?
In a particular experiment, the equilibrium constant measured for the reaction, Cl2(g)+NO2(g)Cl2NO2(g), is 2.8. Based on this measurement, calculate AG° for this reaction. Calculate AG° using data from Appendix E at the back of the book and discuss the agreement between your two calculations.
The decomposition of PCl5(g) to form PCl3(g) and Cl2(g) has Kc = 33.3 at a high temperature. If the initial concentration of PCl5 is 0.1000 M, what are the equilibrium concentrations of the reactants and products?
At room temperature, the equilibrium constant Kc for the reaction 2 NO(g) ⇌ N2(g) + O2(g) is 1.4 × 1030. Is this reaction product-favored or reactant-favored? Explain your answer. In the atmosphere at room temperature the concentration of N2 is 0.33 mol/L, and the concentration of O2 is about 25% of that value. Calculate the equilibrium concentration of NO in the atmosphere produced by the reaction of N2 and O2. How does this affect your answer to Question 11?
Hydrogen and carbon dioxide react at a high temperature to give water and carbon monoxide. H2(g) + CO2(g) H2O(g) + CO(g) (a) Laboratory measurements at 986 C show that there are 0.11 mol each of CO and H2O vapor and 0.087 mol each of H2 and CO2 at equilibrium in a 50.0-L container. Calculate the equilibrium constant for the reaction at 986 C. (b) Suppose 0.010 mol each of H2 and CO2 are placed in a 200.0-L container. When equilibrium is achieved at 986 C, what amounts of CO(g) and H2O(g), in moles, would be present? [Use the value of Kc from part (a).]
The following equilibrium was studied by analyzing the equilibrium mixture for the amount of H2S produced. Sb2S3(s)+3H2(g)2Sb(s)+3H2S(g) A vessel whose volume was 2.50 L was filled with 0.0100 mol of antimony(III) sulfide, Sb2S3, and 0.0100 mol H2. After the mixture came to equilibrium in the closed vessel at 440C, the gaseous mixture was removed, and the hydrogen sulfide was dissolved in water. Sufficient lead(II) ion was added to react completely with the H2S to precipitate lead(II) sulfide, PbS. If 1.029 g PbS was obtained, what is the value of Kc at 440C?
In a solution with carbon tetrachloride as the solvent, the compound VCl4. undergoes dimerization: 2VCl4V2Cl8 When 6.6834 g VCl4. is dissolved in 100.0 g carbon tetrachloride, the freezing point is lowered by 5.97C. Calculate the value of the equilibrium constant for the dimerization of VCl4 at this temperature. (The density of the equilibrium mixture is 1.696 g/cm3, and Kf = 29.8C kg/mol for CCl4.)