At a particular temperature, K = 1.62 x 102 for the reaction H2 (9) + I2 (9) = 2HI(9) In an experiment, 2.80 moles of H2, 2.80 moles of I2, and 2.80 moles of HI are introduced into a 1.00-L container. Calculate the concentrations of all species when equilibrium is reached. Concentration of H2 = M Concentration of I2 = M Concentration of HI M Submit Answer Try Another Version 2 item attempts remaining

At a particular temperature, K = 1.62 x 102 for the reaction H2 (9) + I2 (9) = 2HI(9) In an experiment, 2.80 moles of H2, 2.80 moles of I2, and 2.80 moles of HI are introduced into a 1.00-L container. Calculate the concentrations of all species when equilibrium is reached. Concentration of H2 = M Concentration of I2 = M Concentration of HI M Submit Answer Try Another Version 2 item attempts remaining

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter12: Chemical Equilibrium

Section: Chapter Questions

Problem 51QRT: At room temperature, the equilibrium constant Kc for the reaction 2 NO(g) ⇌ N2(g) + O2(g) is 1.4 ×...

See similar textbooks

Similar questions

Suppose a reaction has the equilibrium constant K = 1.3 108. What does the magnitude of this constant tell you about the relative concentrations of products and reactants that will be present once equilibrium is reached? Is this reaction likely to be a good source of the products?
The equilibrium constant Kc for the reaction PCl3(g)+Cl2(g)PCl3(g) equals 4.1 at 300C. a A sample of 35.8 g of PCl5 is placed in a 5.0-L reaction vessel and heated to 300C. What are the equilibrium concentrations of all of the species? b What fraction of PCl5 has decomposed? c If 35.8 g of PCl5 were placed in a 1.0-L vessel, what qualitative effect would this have on the fraction of PCl5 that has decomposed (give a qualitative answer only; do not do the calculation)? Why?
At room temperature, the equilibrium constant Kc for the reaction 2 NO(g) ⇌ N2(g) + O2(g) is 1.4 × 1030. Is this reaction product-favored or reactant-favored? Explain your answer. In the atmosphere at room temperature the concentration of N2 is 0.33 mol/L, and the concentration of O2 is about 25% of that value. Calculate the equilibrium concentration of NO in the atmosphere produced by the reaction of N2 and O2. How does this affect your answer to Question 11?
The following equilibrium was studied by analyzing the equilibrium mixture for the amount of H2S produced. Sb2S3(s)+3H2(g)2Sb(s)+3H2S(g) A vessel whose volume was 2.50 L was filled with 0.0100 mol of antimony(III) sulfide, Sb2S3, and 0.0100 mol H2. After the mixture came to equilibrium in the closed vessel at 440C, the gaseous mixture was removed, and the hydrogen sulfide was dissolved in water. Sufficient lead(II) ion was added to react completely with the H2S to precipitate lead(II) sulfide, PbS. If 1.029 g PbS was obtained, what is the value of Kc at 440C?
At 25C. Kp = 5.3 105 for the reaction N2(g)+3H2(g)2NH3(g) When a certain partial pressure of NH3(g) is put into an otherwise empty rigid vessel at 25C, equilibrium is reached when 50.0% of the original ammonia has decomposed. What was the original partial pressure of ammonia before any decomposition occurred?
The experiment in Exercise 12.33 was redesigned so that the reaction started with 0.15 mol each of N2 and O2 being injected into a 1.0-L container at 2500 K. The equilibrium constant at 2500 K is 3.6 X 10“’. What was the composition of the reaction mixture after equilibrium was attained? The following reaction establishes equilibrium at 2000 K: N2(g) + O2(g) *2 2 NO K = 4.1 X IO-4 If the reaction began with 0.100 mol L-1 of N2 and 0.100 mol L-’ ofO2, what were the equilibrium concentrations of all species?
Consider the decomposition of ammonium hydrogen sulfide: NH4HS(s) ⇌ NH3(g) + H2S(g) In a sealed flask at 25 °C are 10.0 g NH4HS, ammonia with a partial pressure of 0.692 atm, and H2S with a partial pressure of 0.0532 atm. When equilibrium is established, it is found that the partial pressure of ammonia has increased by 12.4%. Calculate KP for the decomposition of NH4HS at 25 °C.
The equilibrium constant Kc, for the reaction 2 NOCI(g) 2 NO(g) + Cl2(g) is 3.9 103 at 300 C. A mixture contains the gases at the following concentrations: [NOCl] = 5.0 103 mol/L, [NO] = 2.5 103 mol/L, and [Cl2] = 2.0 103 mol/L. Is the reaction at equilibrium at 300 C? If not, in which direction does the reaction proceed to come to equilibrium?
Because calcium carbonate is a sink for CO32- in a lake, the student in Exercise 12.39 decides to go a step further and examine the equilibrium between carbonate ion and CaCOj. The reaction is Ca2+(aq) + COj2_(aq) ** CaCO,(s) The equilibrium constant for this reaction is 2.1 X 10*. If the initial calcium ion concentration is 0.02 AI and the carbonate concentration is 0.03 AI, what are the equilibrium concentrations of the ions? A student is simulating the carbonic acid—hydrogen carbonate equilibrium in a lake: H2COj(aq) H+(aq) + HCO}‘(aq) K = 4.4 X 10"7 She starts with 0.1000 AI carbonic acid. What are the concentrations of all species at equilibrium?
A sample of gaseous nitrosyl bromide (NOBr) was placed in a container tiued with a frictionless, massless piston, where it decomposed at 25C according to the following equation: 2NOBr(g)2NO(g)+Br2(g) The initial density of the system was recorded as 4.495 g/L. After equilibrium was reached, the density was noted to be 4.086 g/L. a. Determine the value of the equilibrium constant K for the reaction. b. If Ar(g) is added to the system at equilibrium at constant temperature, what will happen to the equilibrium position? What happens to the value of K? Explain each answer
The equilibrium constant for the dissociation of iodine molecules to iodine atoms I2(g) 2 I(g) is 3.76 103 at 1000 K. Suppose 0.105 mol of I2 is placed in a 12.3-L flask at 1000 K. What are the concentrations of I2 and I when the system comes to equilibrium?
A solution is prepared by dissolving 0.050 mol of diiodocyclohexane, C5H10I2, in the solvent CCl4.The total solution volume is 1.00 L When the reaction C6H10I2 C6H10 + I2 has come to equilibrium at 35 C, the concentration of I2 is 0.035 mol/L. (a) What are the concentrations of C6H10I2 and C6H10 at equilibrium? (b) Calculate Kc, the equilibrium constant.