Answered: Balance the following chemical equation…

Science

Chemistry

Balance the following chemical equation (if necessary): ZnS(s) + AlP(s) ---> Al2S3(s) + Zn3P2(s)

Principles of Modern Chemistry

8th Edition

ISBN:9781305079113

Author:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Publisher:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Chapter2: Chemical Formulas, Equations, And Reaction Yields

Section: Chapter Questions

Problem 20P

See similar textbooks

Related questions

Q: In a blast furnace, iron (III) oxide is used to produce iron by the following (unbalanced) reaction:…

Q: Balance the following equations in basic solution. MnO4-(aq) + CN-(aq) --> MnO2(s) + OCN-(aq) S(s)…

Q: Balance the following chemical equation with the smallest whole numbercoefficients. What is the…

A: The given unbalanced equation is, C4H10 + O2 → CO2 + H2O

Q: When the following equation is balanced, the coefficient of Al2O3 is __________. ___Al2O3 (s) +…

A: Balance reaction : The reaction in which number of atom in reactant side is equal to number of atom…

Q: balance the chemical reaction _______Fe +_______ O2 →________ Fe2O3

A: We have to balance the given reaction..

Q: I CottizO, ,+ L6O2-76ocOz+ Lott2+362.5 KJ what are the molors masses You You might need ? H2O? +20?

A: 1 mole of glucose and 6 mole of oxygen gives 6 mole of carbon dioxide and 6 mole of water. As shown…

Q: Complete and balance the following reactions. Don’t worry about state symbols for the second one.…

A: Introduction: The chemical equation shows the reaction between the two or chemical species and their…

Q: (Use the lowest possible coefficients. Be sure to specify states such as (ag) or (s). If a box is…

A: Displacement of halogens: More electronegative halogen displaces a less electronegative halogen…

Q: 5.79 Suggest ways (with appropriate equations) that wouldallow you to measure the ΔH°f values of…

A: The standard enthalpy of formation is the enthalpy change throughout the production of 1 mol of the…

Q: 1. Iron (Fe) nail + CuSO4 solution ? turned into the rusty Iron (Fe) nail turned into black…

A: We have to predict product of reaction, and name of salt.

Q: For all of the following experiments, under standard conditions, which species could be…

A: A. Lead is more reactive than Cu, thus can replace Cu from its aqueous solution. Pb+Cu2+→Pb2++Cu…

Q: The reusable booster rockets of the space shuttle use a mixture of aluminum and ammonium perchlorate…

A: Given Reaction 3Al(s) +3NH4ClO4(s) →Al2O3(s) + AlCl3(s) +3NO(g) + 6H2O(g) ∆H° of this…

Q: How much solute (g) is required to prepare 850 mL of a 0.5 M solution of CuSO4 (MW = 159.61 g/mol)…

A: Molarity = moles ÷ volume

Q: How do you balance the following equation using the lowest possible coefficients? C4H10 + O2 --->…

A: Butane reacts with oxygen to form carbon dioxide and water. The equation for the reaction is as…

Q: a dilution is needed to prepare a standard of 10 mg Zn/L from 0.5g Zn/L. To carry out the dilution…

A: We will discuss which bulb pipette and which corresponding volumetric flask you would choose to…

Q: Write the net equation for precipitation of AgI when aqueous solutions of AgNO3 and Nal are mixed.…

A: AgNO3 react with NaI to give AgI.

Q: Balance this reaction:_Fe2O3(s) +_Co(g)->_fe(s)+_Co2(g)

A: According to the Law of Conservation of mass " all atoms of different elements must be equal on both…

Q: Question attached

A: Given: The first balanced reaction is, 2ClFg+O2g→Cl2Og+OF2g ∆H°=167.5 kJ......(1) The second…

Q: How to calculte % compsotion for each trial of two-metal alloy (Al-Zn) reacting with HCL? Zn(s) +…

A: The given chemical reaction : Zn(s) + 2 H+ (aq) --> Zn2+ (aq) + H2 2 Al(s) + 6 H+(aq) --> 2…

Q: Fe + Cuo-Fe2O3+ Cu

A: In this problem the provided equation has to be balanced: Fe + CuO → Fe2O3 + Cu Iron reacts with…

Q: Balance the reaction for the combustion of pentane: ?C5H12+?O2→?CO2+?H2O?C5H12+?O2→?CO2+?H2O Enter…

A: Welcome to bartleby !

Q: The solubility product (Ksp) for Pb(OH)2 (s) is 2.5 x 10-16. What would be the quantity of…

A: KSP = SOLUBILITY PRODUCT KSP =[ Pb ]+2 [OH]-2

Q: (a) MnO + SO – MnO, + SO?-

A: The reaction given is, => MnO4- + SO32- → MnO2 + SO42-

Q: Balance the following chemical equation using the smallest possible wholenumber coefficients: P4 +…

A: Before proceed , first we should know that what does it mean to be a Balanced Chemical equation of a…

Q: The Ecell of a reaction was found to be +0.78 V. What is the ∆G° of the reaction? ne=1 mol

A: Redox reaction are those in which both oxidation and reduction reaction occurs simultaneously.

Q: Balance the chemical equation below using the smallest possible whole number stoichiometric…

A: In a balanced chemical reaction the no of atoms present at reactant side is equal to the no of atoms…

Q: STAEDTLER Mars plastic s) Use the following unbalanced chemical reaction to answer the questions…

A: Balanced Reaction 2 Al(s) +3 H2SO4 --> Al2(SO4)3 + 6 H2 Al reacts with sulfuric acid to produce…

Q: Which represents the balance reaction with correct phase labels of Mg(OH)2 (aq) + H2 SO4 (aq) –→? O…

A: Given reactants of the reaction is, Mg(OH)2(aq)+H2SO4(aq)→

Q: Balance the equation by inserting coefficients as needed. ___C2H6O+____O2⟶___CO2+____H2O

A: Balancing the equation by inserting coefficients

Q: Balance the following equation Mg+O2-mgo

A: Balancing equation involves equal number of atoms of each element on both the sides i.e. the…

Q: What is the observable result of: Cl + Ag AgCl(s) + 2NH3(aq) AgCl(s) + sunlight

A: Since this question contains multiple subparts, the answer for first three sub parts are given…

Q: balance the following equation and then select the correct ordering of coefficients ___C8H18 + ____…

A: If the number of atoms on each element in each side are same then it is called balanced equation

Q: Balance the following equation and select the correct sequence of coefficients with respect to this…

A: The given chemical reaction, Cr(s) +Fe(NO3)2(aq) → Fe(s) +Cr(NO3)3(aq)

Q: Under standard state conditions, the complete combustion of a hydrocarbon, primarily produces: O…

A: -> Combustion is a chemical reaction between fuel and an oxidant that produces an oxidized…

Q: Calculate the emf cell of each overall reactions. Then, compare them with the actual emf cell of a…

A: The cell potential (Ecell) for battery is calculated as shown in equation (1) where ECathod and…

Q: ΔH = 0 is a(n) _____________ process.

A: Enthalpy is the heat content of the system. Change is enthalpy is roughly equivalent to amount of…

Q: Balance the reaction of NaBr + CaO --> CaBr2 + Na2O

A: In a balanced chemical reaction, the number of atoms of each element is same on the reactant and…

Q: Balance in basic solution: CN- + MnO4---->CNO + MnO2

A: Balancing of a redox reaction in basic medium :

Q: Balance the following chemical equation (if necessary) for the combustion reaction of glucose:…

A: The chemical equation for the combustion reaction of glucose needs to be balanced. Given chemical…

Q: 9. Calculate and contrast the Atom Economies of the following four reactions: + 2CO2 + 2H20 + 4.5 O2…

A: The objective of the question is to calculate the atom economy of the following reaction.

Q: Balance the following equation using the set of smallest whole-number coefficients. What is the sum…

A: Given : ____PbO + ___NH3 ---> ___Pb + ___N2 + ___H2O To find : Balance the given equation. Sum of…

Q: Balance the following combustion reaction and report the sum of the stoichiometric coefficients: __…

A: A balanced chemical equation means that the number of sameatoms on both sides of the chemical…

Q: Balance the following equation and calculate its ΔSo in units of J mol-1 K-1. Fe(s) + H2O(l) →…

A: Balancing : Fe(s) + H2O(l) → Fe3O4(s) + H2(g) Since in the above reaction we have 3 Fe in RHS while…

Q: Balance the following chemical equation (if necessary): V₂O₅(s)+HCl(aq)→VOCl₃(s)+H₂O(l)

A: V₂O₅ + HCl → VOCl₃ + H₂O Balance V. 2 on the left, 1 on the right. Add a coefficient of 2 in front…

Q: e full balanced chemical inolu

A: A double displacement reaction is defined as a type of chemical reaction in which two compounds…

Q: Question attached

A: Hg(l) + Cl2 (g) → HgCl2 (s) ; ∆H1o = -162.0 kJ/mol ---------(i) Hg(l) +…

Q: Consider the following chemical reaction: What is AH for the following reaction? 2Mg(s) + O₂(g) →…

A: Given, 2Mg(s) + O2(g) → 2MgO(s) ∆H = -1204 kJ 4MgO(s) → 4Mg(s) + 2O2(g) ∆H = ?

Q: What is the balanced equation of 3m? What is the balance equation of Ksp= [Ag+]²[CrO4²-]

A: We have to just write the balanced equation.

Question

Balance the following chemical equation (if necessary):

ZnS(s) + AlP(s) ---> Al2S3(s) + Zn3P2(s)

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps with 2 images

SEE SOLUTION Check out a sample Q&A here

Similar questions

When jump-starting a car with a dead battery, the ground jumper should be attached to a remote part of the engine block. Why?
A chemist dissolves a 1.497-g sample of a type of metal (an alloy of Sn, Pb, Sb, and Cu) in nitric acid, and metastannic acid, H2SnO3, is precipitated. She heats the precipitate to drive off the water, which leaves 0.4909 g of tin(IV) oxide. What was the percentage of [in in the original sample?
The carbon dioxide exhaled in the breath of astronauts is often removed from the spacecraft by reaction with lithium hydroxide 2LiOH(s)+CO2(g)Li2CO3(s)+H2O(l) Estimate the grams of lithium hydroxide required per astronaut per day. Assume that each astronaut requires 2.50 103 kcal of energy per day. Further assume that this energy can be equated to the heat of combustion of a quantity of glucose, C6H12O6, to CO2(g) and H2O(l). From the amount of glucose required to give 2.50 103 kcal of heat, calculate the amount of CO2 produced and hence the amount of LiOH required. The H for glucose(s) is 1273 kJ/mol.
One of the few industrial-scale processes that produce organic compounds electrochemically is used by the Monsanto Company to produce1,4-dicyanobutane. The reduction reaction is 2CH2CHCH+2H++2eNC(CH2)4CN The NC(CH2)4CN is then chemically reduced using hydrogen gas to H2N(CH2)6NH2, which is used in the production of nylon. What current must be used to produce 150.kg NC(CH2)4CN per hour?
Magnesium metal (a component of alloys used in aircraft and a reducing agent used in the production of uranium, titanium, and other active metals) is isolated from sea water by the following sequence of reactions: Mg2+(aq)+Ca(OH)2(aq)Mg(OH)2(s)+Ca2+(aq)Mg(OH)2(s)+2HCl(aq)MgCl2(s)+2H2O(l)MgCl2(l)electrolysisMg(s)+Cl2+Cl2(g) Sea water has a density of 1.026 g/cm3 and contains 1272 parts per million of magnesium a5 Mg2+(aq) by mass. What mass, in kilograms, of Ca(OH)2; is required to precipitate 99.9% of the magnesium in 1.00103 L of sea water?
Write balanced chemical equations for the following reactions: (a) zinc metal heated in a stream of oxygen gas (b) zinc carbonate heated until loss of mass stops (c) zinc carbonate added to a solution 0f acetic acid, CH3CO2H (d) zinc added to a solution of hydro-bromic acid
Balance the following equations: (a) for the reaction to produce "superphosphate" fertilizer Ca3(PO4)2(s) + H2SO4(aq) Ca(H2PO4)2(aq) + CaSO4(s) (b) for the reaction to produce diborane, B2H6 NaBH4(s) + H2SO4(aq) B2H6(g) + H2(g) + Na2SO4(aq) (c) for the reaction to produce tungsten metal from tungsten(VI) oxide WO3(s) + H2(g) W(s) + H2O() (d) for the decomposition of ammonium dichromate (NH4)2Cr2O7(s) N2(g) + H2O() + Cr2O3(s)
Chlorine gas was first prepared in 1774 by C. W. Scheele by oxidizing sodium chloride with manganese(IV) oxide. The reaction is NaCl(aq)+H2SO4(aq)+MnO2(s)Na2SO4(aq)+MnCl2(aq)+H2O(l)+Cl2(g) Balance this equation.
Balance the following equations: a. Li3N(s)Li(s)+N2(g) b. Cu2O(s)+O2(g)CuO(s) c. Zn(s)+HNO3(aq)Zn(NO3)2(aq)+H2(g) d. K2SO4(aq)+BaCl2(aq)BaSO4(s)+KCl(aq) e. dinitrogenmonoxidenitrogen+oxygen f. dinitrogenpentoxidenitrogendioxide+oxygen g. P4O10(s)+H2O(l)H4P2O7(aq) h. CaCO3(s)+HCl(aq)CaCl2(aq)+H2O(l)+CO2(g)
The reusable booster rockets of the space shuttle use a mixture of aluminum and ammonium perchlorate as fuel. A possible reaction is 3Al(s)+3NH4ClO4(s)Al2O3(s)+AlCl3(s)+3NO(g)+6H2O(g) Calculate H for this reaction
4.112 A metallurgical firm wishes to dispose of 1300 gallons of waste sulfuric acid whose molarity is 1.37 M. Before disposal, it will be reacted with calcium hydroxide (slaked lime), which costs $0.23 per pound. (a) Write the balanced chemical equation for this process. (b) Determine the cost that the firm will incur from this use of slaked lime.
Write balanced net ionic equations for the following reactions in acid solution. (a) Liquid hydrazine reacts with an aqueous solution of sodium bromate. Nitrogen gas and bromide ions are formed. (b) Solid phosphorus (P4) reacts with an aqueous solution of nitrate to form nitrogen oxide gas and dihydrogen phosphate (H2PO4-) ions. (c) Aqueous solutions of potassium sulfite and potassium permanganate react. Sulfate and manganese(II) ions are formed.