Answered: Balance the following equation by…

Science

Chemistry

Balance the following equation by filling the gaps with appropriate numbers. Mg HCI MgCl2 H2

World of Chemistry, 3rd edition

3rd Edition

ISBN:9781133109655

Author:Steven S. Zumdahl, Susan L. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan L. Zumdahl, Donald J. DeCoste

Chapter7: Chemical Reactions: An Introduction

Section: Chapter Questions

Problem 41A

See similar textbooks

Related questions

Q: How many atoms of oxygen are present in the reactants of this chemical equation? Mg(OH)2 + 2 HCI →…

A: In a chemical equation, reactants are placed on the left-hand side and the products are placed at…

Q: Balance the equation: Ni(s) + H2O(l) + O2(g) → Ni(OH)2(s)

A: In Balanced chemical reaction the number or each atom on reactant side should be equal to number of…

Q: 2nh4no3(s) =2n2(g) 4h2o(g) +o2(g) balance the chemical equation in tabular form?

A: The balanced chemical equation, for the given reaction is shown below; 2NH4NO3(s)→2N2(g)+4H2O(g)+O2…

Q: Write the net ionic equation of the following reaction: 3Ca(OH)2(aq) + 2H3PO4(aq) → 6H20(1) +…

A: The net ionic equation is the representation of all ions involved in chemical reactions. It is a…

Q: Balance the following chemical reaction equation: ___ Ca3P2 + ___ H2O → ___ Ca(OH)2 + ___ PH3

A: The reaction taking place is given as, => Ca3P2 + H2O --------> Ca(OH)2 + PH3

Q: Balance the following equation by filling the gaps with appropriate numbers. OKOH + OH3PO4 OkaPO4 +…

A: We have to predict the balanced chemical reaction.

Q: Balance the following chemical equation (if necessary): (NH4):PO:(aq) + MgCl2(aq) → Mg3(PO4)2(s) +…

A: Since you have asked multiple questions, we will solve the first question for you. If you want any…

Q: Complete and balance the following equations. If no reactionoccurs, write NR:(a) Cl2(g) + I2(aq)…

A: Greater the reduction potential of a substance, higher is its oxidizing power. Fluorine gas (F2) has…

Q: (NH₄)₃PO₄(aq)+MgCl₂(aq)→Mg₃(PO₄)₂(s)+NH₄Cl(aq)

A: I have give in written form.

Q: Cl2O7(g) + Ca(OH)2(aq)à Ca(ClO4)2(aq) + H2O(l) how do i balance this equation

A: The given chemical reaction is as follows: Cl2O7g + CaOH2aq → CaClO42aq + H2Ol

Q: 2. (Balance the equation) FeCl+NaOH>Fe(OH);+Nacl

A: A balanced chemical reaction equation has equal number of atoms and charges on both reactant and…

Q: Balance the following equation by filling the gaps with appropriate numbers. CSH8 CO2 + H20

Q: CaCl2+NA2CO3-CACO3+NaCl

A: Given equation: CaCl2 + Na2CO3 → CaCO3 + NaCl

Q: Balance the following equation by filling the gaps with appropriate numbers. OMn + 0HCI » OMncl, +…

A: “Since you have asked multiple questions, we will solve the first question for you. If you want any…

Q: How do we balance chemical equations? LAW OF CONSERVATION OF MASS N2 + H2 NH3

A: A balanced chemical equation can be termed as the equation in which all the elements at the reactant…

Q: Aluminum phosphate (s) + sodium nitrate (aq) Al(NO3)3 + Na3PO4 Balanced equation:

Q: What type of chemical reaction is shown in the chemical equation below? * CaF2 + 2 Na 2 NaF + Ca

A: Given :- CaF2 + 2 Na → 2 NaF + Ca To identify :- Type of reaction

Q: balance the reaction equation Si2H6 + O2 ⎯→ SiO2 + H2O

A: Chemical equation is the representation of a chemical reaction, in which the reactants and products…

Q: How many atoms of oxygen are present in the reactants of this chemical equation? Mg(OH)2 + 2 HCI →…

A: Introduction : We have to tell how many atoms of oxygens are present in the reactant .

Q: Balance the following equation by filling the gaps with appropriate numbers. PCI5 H20 H3PO4 HCI + +

A: In a balanced chemical equation number of atoms of each element on the reactant and products side…

Q: N2* H2 NH3

A: According to the Law of conservation of mass " all atoms of different elements must be equal on both…

Q: Balance the following chemical equation (if necessary): NH3(g) + O2(g) NO(g) + H20(g)

Q: Balance the following chemical equation (if necessary): Ca(C2H3O2)2(aq) + Na,CO3(aq) CaCO3(s) +…

A: The reaction given is => Ca(C2H3O2)2 (aq) + Na2CO3 (aq) ---------> CaCO3 (s) + NaC2H3O2 (aq)

Q: Balance the following equation by algebraic method. C3H6 O2 CO2 H20

A: Let us cosider the balanced equation be, a C3H6 + b O2 = c CO2 + d H2O C 3a = c…

Q: 3) NaCl + F2> NaF + Cl2

A: In a chemical reaction, the mass of the reactants must be equal to the mass of the product. Balanced…

Q: What is the balanced equation? NaOH + Cu (NO3)2 + H2O2 = O2 (g) + H2O + NaNO3+ Cu (s)

A: In balanced reaction number of each atom on reactant side is equal to number of each atom on product…

Q: Explain what is wrong with this balanced chemical equation: 2 Zn (s) →2 ZnCl2 (aq) + 2 H2 (g) + 4…

A: Most of the metals react with excess acid to produce salt and hydrogen gas. Zinc also, reacts with…

Q: What are the coefficients when the equation is balanced? HNO3 + _H;S _NO + _S + _H;0

Q: Explain what is wrong with this balanced chemical equation: 2 Zn (s) → 2 ZNCI2 (aq) + 2 H2 (g) + 4…

Q: What number should be placed in front of KBr to balance this chemical equation? Br2+ 2KI → KBr+ 12…

Q: Balance the following chemical equation (if necessary): Ca(C2H3O2)2(aq) + Na:CO:(aq) – CaCOs(s)'+…

A: Balanced chemical equation will be-

Q: Balance the following equation by filling the gaps with appropriate numbers. Co + HCI → CoCl2 +…

A: For balancing an equation, easiest way is to 1st balance that group of elements (compund) which has…

Q: Balance the equation below 2 H2O + ______ CH4 ? 2 H2 + ______ CO2

A: Given equation is, 2 H2O + ______ CH4 -----> 2 H2 + ______ CO2 Let's balance this,

Q: Balance the following equation by filling the gaps with appropriate numbers. Co + HCI COCl2 H2

A: We know that Balanced chemical equation : A chemical equation in which the number of each type of…

Q: Balance the following equation by filling the gaps with appropriate numbers. Oco + OHCI - (cocl, +…

A: The question is based on the concept of chemical reactions . We have to correctly balance the given…

Q: Balance the following equation by filling the gaps with appropriate numbers. [5] C +....... [2]…

Q: How to balance this equation? Ba(ClO3)2(s) ----> BaCl2(s) + O2(s)

A: To balance the equation, number of atoms on the reactant side must be equal to number of atoms on…

Q: Balance the following equation by filling the gaps with appropriate numbers. Sr HCI SrCl2

A: Sr + HCl -> SrCl2 + H2 Balance Chlorine Sr + 2HCl -> SrCl2 + H2

Q: Balance the following chemical reaction: __NH4OH + __KAl(SO4)2·12H2O → __Al(OH)3 + __(NH4)2SO4 +…

A: Given equation is NH4OH + KAl(SO4)2·12H2O → Al(OH)3 + (NH4)2SO4 + KOH + H2O Reactant side…

Q: balance this chemical reaction ____ NaHCO3 + ____ C6H8O7 → ____ Na3C6H5O7…

Q: Balance the following equation by filling the gaps with appropriate numbers. Sr + HCI SrCl2 + H2

Q: Balance the following equation by filling the gaps with appropriate numbers. CH4 C2 H20 +

A: The representation of a chemical reaction in the form of substances is known as a chemical equation.…

Q: Balance the following equation by Algebraic method: ____ Na3PO4 + ____ CaCl2  ____ NaCl + ____…

A: The reaction taking place is given as, => Na3PO4 + CaCl2 -------> NaCl + Ca3(PO4)2

Q: C2H2 (g) + O2 (g) → CO2 (g) + H2O (l) 1) (2 pts) Balance this reaction equation.

A: Soln

Q: When the equation below is balanced, the coefficient of the product is: Fe + O2→FE2O3 4. O 1 2] 3.

Q: Fill in the blanks to balance the equation, ___ C3H8 + ___ O2 →

A: This is the combustion reaction of propane. Propane is a hydrocarbon during combustion reaction of…

Q: (a) Balance the chemical equation or brea + Cr₂O72- + Cr3+ OH OH Compound X Compound Y

Q: In an amazingly violent reaction, water can be synthesized from hydrogen gas a oxygen gas. What is…

A: In water synthesis from hydrogen gas and Oxygen gas, hydrogen gas and Oxygen gas should in molecular…

Q: Balance the following equation by filling the gaps with appropriate numbers. Ва + HCI BaCl2

A: The given unbalanced equation is : ? Ba+? HCl→? BaCl2+?H2

Q: Balanced this equation. Cu + HNO3 > Cu (NO3)2 + NO2 + H2O

A: In a balanced chemical equation, all the reactants and products are written with their…

Concept explainers

States of Matter

The substance that constitutes everything in the universe is known as matter. Matter comprises atoms which in turn are composed of electrons, protons, and neutrons. Different atoms combine together to give rise to molecules that act as a foundation for all kinds of substances. There are five states of matter based on their energies of attraction, namely solid, liquid, gases, plasma, and BEC (Bose-Einstein condensates).

Chemical Reactions and Equations

When a chemical species is transformed into another chemical species it is said to have undergone a chemical reaction. It consists of breaking existing bonds and forming new bonds by changing the position of electrons. These reactions are best explained using a chemical equation.

Question

Balance the following equation by filling the gaps with appropriate numbers.
Mg +
HCI
MgCl2
H2

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Balance the following equations representing combustion reactions: a. b. c. C12H22O11 (s) + O2(g) CO2 (g) + H2O (g) d. Fe(s) + O2(g) Fe2O3(s) e. FeO(s) + O2(g) Fe2O3(s)
One of relatively few reactions that takes place directly between two solids at room temperature is Ba(OH)2+8H2O(s)+NH4SCN(s)Ba(SCN)2(s)+H2O(l)+NH3(g) In this equation, the 8H2O in Ba(OH)2 8H2O indicates the presence of eight water molecules. This compound is called barium hydroxide octahydrate. a. Balance the equation. b. What mass of ammonium thiocyanate (NH4SCN) must be used if it is to react completely with 6.5 g barium hydroxide octahydrate?
3.88 One Step in the enrichment of uranium for use in nuclear power plants involves the reaction of UO2 with hydro- fluoric acid (HF) solution. The products are solid UF4 and water. Write a balanced chemical equation for this reaction.
Iron oxide ores, commonly a mixture of FeO and Fe2O3, are given the general formula Fe3O4. They yield elemental iron when heated to a very high temperature with either carbon monoxide or elemental hydrogen. Balance the following equations for these processes: Fe3O4(s)+H2(g)Fe(s)+H2O(g)Fe3O4(s)+CO(g)Fe(s)+CO2(g)
Balance the following equations: (a) PCl5(s)+H2O(l)POCl3(l)+HCl(aq) (b) Cu(s)+HNO3(aq)Cu( NO3)2(aq)+H2O(l)+NO(g) (c) H2(g)+I2(s)HI(s) (d) Fe(s)+O2(g)Fe2O3(s) (e) Na(s)+H2O(l)NaOH(aq)+H2(g) (f) ( NH4)2Cr2O7(s)Cr2O3(s)+N2(g)+H2O(g) (g) P4(s)+Cl2(g)PCl3(l) (h) PtCl4(s)Pt(s)+Cl2(g)
3.14 A number of compounds are used in cement, and reactions among them occur when water is added. In one, CaO reacts with Al2O3 and water to form Ca3Al2(OH)12. Write a bal- anced chemical equation for this process.
In a common experiment in the general chemistry laboratory, magnesium metal is heated in air to produce MgO. MgO is a white solid, but in these experiments it often looks gray, due to small amounts of Mg3N2, a compound formed as some of the magnesium reacts with nitrogen. Write a balanced equation for each reaction.
Balance the following equations, and name each reactant and product: (a) SF4(g) + H2O() SO2(g) + HF() (b) NH3(aq) + O2(aq) NO(g) + H2O() (c) BF3(g) + H2O() HF(aq) + H3BO3(aq)
Disulfur dichloride, S2Cl2, is used to vulcanize rubber. It can be made by treating molten sulfur with gaseous chlorine. S8() + 4 Cl2(g) 4 S2Cl2(g) Complete this table of reaction quantities for the production of 103.5 g S2Cl2.
(a) Butane gas, C4H10, can burn completely in air [use O2(g) as the other reactant] to give carbon dioxide gas and water vapor. Write a balanced equation for this combustion reaction. (b) Write a balanced chemical equation for the complete combustion of C3H7BO3, a gasoline additive. The products of combustion are CO2(g), H2O(g), and B2O3(s).
Silicon is produced for the chemical and electronics industries by the following reactions. Give the balanced equation for each reaction. a. SiO2(s)+C(s)arefurnaceElectricSi(s)+CO(g) b. Liquid silicon tetrachloride is reacted with very pure solid magnesium, producing solid silicon and solid magnesium chloride. c. Na2SiF6(s) + Na(s) Si(s) + NaF(s)
You take 1.00 g of an aspirin tablet (a compound consisting solely of carbon, hydrogen, and oxygen), burn it in air, and collect 2.20 g CO2 and 0.400 g H2O. You know that the molar mass of aspirin is between 170 and 190 g/mol. Reacting 1 mole of salicylic acid with I mole of acetic anhydride (C4H6O3) gives you 1 mole of aspirin and 1 mole of acetic acid (C2H4O2). Use this information to determine the molecular formula of salicylic acid.