Calculate the standard molar entropy of vaporization of water at 43.0 °C, given that its standard molar entropy of vaporization at 100.0 °C is 109.0 J-K-1-mol and the molar heat capacities at constant pressure for liquid water and water vapor are 75.3 J-K-1-mol-1 and 33.6 J-K-.mol-, respectively, in this temperature range. ASvap J.K-1. mol- TOOLS x10

Calculate the standard molar entropy of vaporization of water at 43.0 °C, given that its standard molar entropy of vaporization at 100.0 °C is 109.0 J-K-1-mol and the molar heat capacities at constant pressure for liquid water and water vapor are 75.3 J-K-1-mol-1 and 33.6 J-K-.mol-, respectively, in this temperature range. ASvap J.K-1. mol- TOOLS x10

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter16: Thermodynamics: Directionality Of Chemical Reactions

Section: Chapter Questions

Problem 92QRT: The standard molar entropy of methanol vapor, CH3OH(g), is 239.8 J K1 mol-1. (a) Calculate the...

See similar textbooks

Similar questions

Under what conditions is the entropy of a substance equal to zero?
Billions of pounds of acetic acid are made each year, much of it by the reaction of methanol with carbon monoxide. (AssumeT= 298 K.) CH3OH() + CO(g) CH3COOH() (a) By calculating the standard Gibbs free energy change, rG, for this reaction, show that it is product-favored. (b) Determine the standard Gibbs free energy change, rG,for the reaction of acetic acid with oxygen to form gaseous carbon dioxide and liquid water. (c) Based on this result, is acetic acid thermodynamicallystable compared with CO2(g) and H2O()? (d) Is acetic acid kinetically stable compared with CO2(g)and H2O()?
Use data from Appendix D to calculate the standardentropy change at 25°C for the reaction CH3COOH(g)+NH3(g)CH3NH2(g)+CO2(g)+H2(g) Suppose that 1.00 mol each of solid acetamide, CH3CONH2(s), and water, H2O(l), react to give thesame products. Will the standard entropy change belarger or smaller than that calculated for the reactionin part (a)?
Appendix J lists standard molar entropies S, not standard entropies of formation rS. Why is this possible forentropy but not for internal energy, enthalpy, or Gibbsfree energy?
For the process A(l) A(g), which direction is favored by changes in energy probability? Positional probability? Explain your answers. If you wanted to favor the process as written, would you raise or lower the temperature of the system? Explain.
A 220-ft3 sample of gas at standard temperature and pressure is compressed into a cylinder, where it exerts pressure of 2000 psi. Calculate the work (in J) performed when this gas expands isothermally against an opposing pressure of 1.0 atm. (The amount of work that can be done is equivalent to the destructive force of about 1/4 lb of dynamite, giving you an idea of how potentially destructive compressed gas cylinders can be if improperly handled!)
What is the sign of the standard Gibbs free-energy change at low temperatures and at high temperatures for the combustion of acetaldehyde? CH3CHO(l)+52O2(g)2CO2+2H2O(l)
In the thermodynamic definition of a spontaneous process, why is it important that the phrase “continuous intervention” be used rather than just “intervention?”
Explain why absolute entropies can be measured.
The standard molar entropy of iodine vapor, I2(g), is 260.7 J Kl mol-1 and the standard molar enthalpy of formation is 62.4 kJ/mol. a) Calculate the entropy change for vaporization of 1 mol of solid iodine (use data from Table 16.1 or Appendix J). b) Calculate the enthalpy change for sublimation of iodine. c) Assuming that rSdoes not change with temperature, estimate the temperature at which iodine would sublime (change directly from solid to gas).
The standard molar entropy of methanol vapor, CH3OH(g), is 239.8 J K1 mol-1. (a) Calculate the entropy change for the vaporization of 1 mol methanol (use data from Table 16.1 or Appendix J). (b) Calculate the enthalpy of vaporization of methanol, assuming that rS doesnt depend on temperature and taking the boiling point of methanol to be 64.6C.
Explain why the statement No process is 100 efficient is not the best statement of the second law of thermodynamics.