5.16 Classify the following complex ions as inert or labile: (a) [Ru(NH3)5py]3+ (b) [Cr(acac)3] (c) [Cr(en)3]Cl2 (d) [Mo(CN)6]3- (e) [V(H2O)6]³+

Q: You have a neutral, 4-coordinate macrocyclic ligand that binds to Ni(II). When a weakly-coordinating…

A: Square-planar Ni(II) complexes are diamagnetic and their colour is usually red, yellow or…

Q: How many different formulas are there for octahedral complexes with a metal M and four ligands A, B,…

A: The complexes in which the central metal atom is surrounded by six ligands are called an octahedral…

Q: By using valence bond theory and ligand field theory, prove [Fe(acac)3] is a paramagnetic high spin…

A: The valence bond theory provides information about the structure and magnetic properties of the…

Q: [Cr(H2O)6] 2+ is violet. Another CrL6 complex is green. Can ligand L be CN-? Can it be Cl-? Explain.

A: The octahedral splitting energy of transition elements is the difference in the energy of the…

Q: Illustrate the Transition-Metal Complexes?

A: Transition metals are d-block elements. These elements can co-ordinate with negative or neutral…

Q: The complex [CoFg]³¯ absorbs light at a wavelength of 290 nm. What is the value of the crystal filed…

A: Given: Wavelength = 290 nm Convert nm into m as follows.

Q: (a) Draw all the possible isomers of [Fe(NH3);Br3] and for each isomer clearly indicate the…

A: a) There are two possible isomers of the given compound, fac and mer. These are shown as below:…

Q: 3. The following complexes are charged. Give possible cou neutral coordination compound. Include the…

A: In this question, name, charge and stoichiometry of counterions are to be determined which are used…

Q: 6a. Some ligands are multifunctional; that is, they have two or more atoms which can bind to the…

A:

Q: By using valence bond theory and ligand field theory, prove [Fe(acac)3] is a paramagnetic high spin…

A:

Q: CoCl3(H2N-CH2-CH2-NH2)2(H2O) corresponds to the empirical formula of two coordination compounds…

A: Coordination compounds are those in which a metal atom or ion forms coordinate bonds with the…

Q: The complex was synthesized with the formula [Co(CO)2(CN)2Br2] The spectre infrared shows two bands…

A: The complex synthesized is: [Co(CO)2(CN)2Br2]

Q: Among the complex ions formed by M³* (M is a transition metal in 3d block) are the following:…

A: From given  Each of the given complexes is correctly matched with the respective colors.

Q: A complex, ML62+, is violet. The same metal forms a complex with another ligand, Q, that creates a…

A: Given: The complex given is  This complex is violet. The metal gets attached to the weak field…

Q: Is it possible for a complex of a metal in the transition series to have six unpaired electrons?…

A: Transition metals form stable ions due to its incompletely filled d-orbitals. The d-subshell in…

Q: *The drug Nipride, Naz[Fe(CN)5NO], is an inorganic complex which is used as a source of NO to lower…

A:

Q: The compound 1,1,1-trifluoroacetylacetone (tfa- is a bidentate ligand: CF,CC H2CCH3 2+ It forms a…

A:

Q: In the coordination compound (NH4)2[Fe(OH2)F;], the e is octahedrally coordinated. (a) Based on the…

A: a) The given compound is (NH4)2[Fe(OH2)F5] or [Fe(OH2)F5]2-. The oxidation state of Fe is +3 and it…

Q: A four-coordinate complex MA2B2 is prepared and found tohave two different isomers. Is it possible…

A:

Q: 2. Red crystalline [NiCl,(PPh,CH,Ph)2] is diamagnetic. On heating to 387 K for 2 hours, a blue-…

A: In this complex, nickel is in +2 oxidation state and it has valence shell electronic configuration…

Q: 9 A complex with the composition [MA₂B₂]X₂ is found to have no geometrical isomers. Both A and B are…

A:

Q: By taking into account the following complexes: A) [Co(en):]³* B)[CoCl3Br3]+ a) Give the oxidation…

A: In this question, we have to find out the correct answer of given problem by the help of the…

Q: Answer the following questions about the transition metals complexes with the chemicalformulas…

A: The answer to these above questions are as follows;

Q: 3(a) Considering a Fe coordination complex, [Fe(CN),d, state whether you expect the complex to be…

A:

Q: Though both [COF6]3 and [Co(CN)6]³- octahedral complexes, the crystal field stabilization energy…

A: If weak field ligand is present,than no pairing occur and filling of electron occur according to…

Q: Werner first published his thoughts concerning the possibiolity of chiral coordination compounds in…

A: Geometrical isomer Geometrical isomer having the same molecular formula and same structure but it…

Q: For each of the following metals, write the electronic configurationof the atom and its 3+ ion: (a)…

A:

Q: Write the formula and the name of each complex ion- a complexion with Co3+ as the central ion and…

A: (1) a complexion with Co3+ as the central ion and three NH3 molecules and three CN-ions as ligands…

Q: example of four-Coordinate Zinc(II) Complex with square planer shape

A:

Q: Give the systematic name for the following coordination compound: CI- .F Со

A: While naming any complex ion, the ligands are always named before the metal ion. If multiple ligands…

Q: Ocatahedral” Cu (II) complexes are often described as having a (4+2)- coordination pattern. Suggest…

A: The central metal copper is attached with the six H2O ligands then this complex will be the…

Q: b) The high-spin đ complex (Cr(H:O)J* is labile, but the low-spin d' complex ion [Cr(CN)e]* is…

A:

Q: Most Zn2+complexes are colorless.

A:

Q: Below are five pairs of transition metal complexes. For each pair, select the complex that is more…

A: Since you have posted multiple subparts , we are doing first 3 for you. To do the rest repost the…

Q: 3. Considering an octahedral complex for the d system,what are the effect of T-donor and t- acceptor…

A: Pi donar Ligands produce lesser splitting energy so high spin will be favored. Pi accepting lingands…

Q: 7. For an octahedral transition metal complex with maximum absorbance at a wavelength of 580 nm,…

A:

Q: Alfred Werner, found the key to understanding coordination compounds by synthesizing the series of…

A: The coordination complexes can be defined as the complex compounds which have coordinate linkage…

Q: The ion [Fe(CN)6]3- has one unpaired electron, whereas[Fe(NCS)6]3- has five unpaired electrons. From…

A: The coordination complexes can be defined as the complex compounds which have coordinate linkage…

Q: Give the IUPAC name for this coordination compound. [Cr(H, O),CIJSO4

A: Write IUPAC name of the given coordination compound-

Q: The complex diamminedichloronickel(II), (Ni(NH3)2C12], is paramagnetic and does not have any…

A: When a metal linked with the ligands then it is known as coordination compound.

Q: b) Experimentally, it is found that the value of Ao varies with the chemical nature of the ligand…

A: In presence of the strong ligand (CO) the value of the crystal field splitting energy is higher and…

Q: A certain first-row transition metal ion forms many different colored solutions. When four…

A: During the formation of octahedral compounds, the d-orbital electrons can arrange in two different…

Q: [NİCI2(PPH3)2] is paramagnetic while [PtCl2(PPH3)2] is diamagnetic, what are the possible structures…

A: Though Ni(II) and Pt (II) are both d8 system, Ni complex is tetrahedral, whereas Pt complex is…

Q: Determine whether the following complexes are low spin or high spin complex (i) [Co(CN)6]* [CoF6]3-…

A: In low spin 3d metal complexes, the electrons are paired in the lowest energy state before filling…

Q: b) Calculate the orbital multiplicity for a Cr3+ assuming it is a free ion (Not complex). c)…

A: Orbital multiplicity of a metal is its total no.of orientations of orbital angular momentum L. which…

Atomic Structure

The basic structure of an atom is defined as the component-level of atomic structure of an atom. Precisely speaking an atom consists of three major subatomic particles which are protons, neutrons, and electrons. Many theories have been stated for explaining the structure of an atom.

Shape of the D Orbital

Shapes of orbitals are an approximate representation of boundaries in space for finding electrons occupied in that respective orbital. D orbitals are known to have a clover leaf shape or dumbbell inside where electrons can be found.