Coal can be converted to methane, a chief component of natural gas, according to thefollowing reaction.C(e) + 2H2(g)CH4G)For which AH° and AS° for the reaction are -74.85 kJ/mol and -80.69J/K-mol respectively.Calculate the AG° for this reaction at 25°C.

Answered: Image /qna-images/answer/70fde5fa-682e-4f4f-b3fa-240e452281af.jpg

Coal can be converted to methane, a chief component of natural gas, according to the following reaction. Ce) + 2H2(g) CHa(a) For which AH° and AS° for the reaction are -74.85 kJ/mol and -80.69J/K-mol respectively. Calculate the AG° for this reaction at 25°C.

Coal can be converted to methane, a chief component of natural gas, according to the following reaction. Ce) + 2H2(g) CHa(a) For which AH° and AS° for the reaction are -74.85 kJ/mol and -80.69J/K-mol respectively. Calculate the AG° for this reaction at 25°C.

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter4: Energy And Chemical Reactions

Section4.6: Reaction Enthalpies For Chemical Reactions

Problem 4.8PSP

See similar textbooks

Related questions

Q: The lead-acid storage battery is the oldest rechargeable battery in existence. It was invented in…

A: Given that : There are two reactions that take place during the discharge of the lead-acid storage…

Q: 0 g each of three metals, A, B and C absord the same amount of heat. The temperature of A increases…

A: Heat capacity is an intrinsic physical property of a substance . It is the measure of the amount of…

Q: What would be the final temperature of 231.6mL of NaCI solution upon releasing 24.1kJ of energy to…

A: The heat released/absorbed is calculated by using the formula : q = mCsΔT q = Heat released/absorbed…

Q: what quantity of coal must be burned to supply 3.18*10^6 KJ, assuming that the only combustion…

A: Given: The heat released = 3.18 × 106 kJ Standard data: The heat of combustion of solid carbon =…

Q: When NaOH is neutralized by HCl as shown: NaOH (aq) + HCl (aq) H2O (l) + NaCl (aq) ΔH = - 56.13…

A: The balanced reaction taking place is given as, => NaOH (aq) + HCl (aq) ---------> NaCl (aq)…

Q: How much energy is transferred by 1 mol of 02(g) reacting in the equation below? C6) + ½ O2e) → CO),…

A: In this,half mole of oxygen react to release 110.5kj/mol of energy then when half mole of oxygen…

Q: Given the reactions, X(s)+1/2O2(g)⟶XO(s) Δ?=−807.5 kJ XCO3(s)⟶XO(s)+CO2(g) Δ?=+390.3 kJ…

A: It is given that the change in enthalpy of the given net reaction need to be calculated and the…

Q: The AG° for the combustion of propane is -2073 kJ/mole. What is the AG° for the following reaction?…

Q: For the autoionization of water at 25 ° C, H2O(l) ⇌ H+(aq) + OH−(aq) Kw is 1.0 × 10−14. What is…

A: The change in the Gibbs free energy for a given system is the change in energy that takes place…

Q: 2 CIF(g) + O2(g) 2 CIF3(g) + 2 O2(g)- 2F2(g) + O2(g) - Cl20(g) + F2(g) Cl20(g) + 3 F2O(g) 2 F20(g)…

Q: How much heat is released at constant pressure if 12.3 mL of 0.161 M silver nitrate is mixed with…

A: Calculation for number of moles of AgNO3:

Q: The lead-acid storage battery is the oldest rechargeable battery in existence. It was invented in…

A: H2SO4 (l) ----> SO3 (g) + H2O (l) ∆H1= +113…

Q: using the information given below, calculate the Δ So at 25oC for the given reaction.…

A: Entropy change of a reaction can be calculated by sum of standard entropy of product - sum of…

Q: How much heat is produced when 6.26 g of zinc metal reacts with oxygen gas under standard…

A: We have to calculate energy release in combustion of Zn.

Q: When AH = -133 kJ and AS = -0.133 kJ/K, calculate AG at room temperature, 25 °C, for the following…

A: The spontaneous nature of the reaction is determined by calculating the change of free energy of the…

Q: How much energy is absorbed during the complete reaction of 233.0 g calcium oxide (MW = 56.08 g/mol)…

A: First convert the given mass of CaO into moles. Moles=MassMolar mass=233.0g56.08 g/mol=4.155 mol

Q: The following thermochemical equation is for the reaction of tetraphosphorus decaoxide(s) with…

Q: Be sure to answer all parts. Deterioration of buildings, bridges, and other structures through the…

A: The balance chemical equation for rusting of iron is as follow 4Fe(s)…

Q: 8.) Determine AG°rxn using the following information. (assume 298 K) H2(g) + CO(g) → CH2O(g)…

A: This question is related to Gibbs energy formula. Gibbs free energy is a quantity that is used to…

Q: The enthalpy changes, AH, for three reactions are given. H, (g) + 0,®) – H,0) AH = -286 kJ/mol Са2+…

A: The 3 reactions given are, 1) 2) 3)

Q: At 869 K, ΔGo equals -82.7 kJ for the reaction, Cl2(g) 2 Cl(g). Calculate the value of ln K for…

A: The equilibrium constant can be written as the ratio of concentration of products to the…

Q: Enter your answer in the provided box. Calculate AG for the following reaction at 25°C: H₂O() →…

Q: The specific heat of octane, C8H181l2, is 2.22 J>g@K. (a) Howmany J of heat are needed to raise…

A: Molar mass of octane: 114 g/molSpecific heat: 2.22 J/g-K Molar mass of water: 18 g/molSpecific heat:…

Q: A 200 ml sample of 0.600 M aqueous hydrochloric acid is added to 300 mL of 0.400 M aqueous ammonia…

Q: If the same amount of heat is added to 5.00 g samples of each of the metals below, which metal will…

A: GIVEN DATA:- mass of samples = 5.00 g each & amount of heat provided to each…

Q: Consider the following balanced thermochemical equation for the decomposition of the mineral…

A: Thermochemical equation :- A chemical equation in which heat changes involved during the reaction…

Q: 0 70 Using tabulated thermodynamic data, calculate AG° for these reactions. (a) Mg,N,(s) + 6 H,0(()…

A: Since you have posted a question with multiple sub-parts, we will solve first three subparts for…

Q: Exactly 46.33 kJ of heat is transferred to a 1.389 kg slab of nickel at a temperature of 12.7°C. (a)…

Q: The lead-acid storage battery is the oldest rechargeable battery in existence. It was invented in…

Q: (a) FeCl, NABH., ELOH (b) then H,O* КОН (c) OMe H,0 Br heat (d) NaOCH; heat (e) NBS, AIBN heat (f)…

Q: Calcium hydroxide reacts with hydrochloric acid by the following equation: Ca(OH)2(aq) + 2HCI(aq) →…

A: The sign of the enthalpy of any reaction is changed if the reaction is reversed. So if the forward…

Q: Which of the following processes is endothermic? a hot cup of soup (system) cools on a…

A: Answer:- this question is answered by using the simple concept of endothermic reaction in which heat…

Q: Calculate how much heat is released or absorbed

A: This is a dissociation reaction. In this reaction, Molecular weight of NH3=17.031g/mol 2…

Q: 3. Calculate the AH for the reaction NO(g) + O(g) NO2(g) given the following information: NO(g) +…

Q: Given the reactions, X(s)+12O2(g)⟶XO(s) ΔH=−637.9 kJ XCO3(s)⟶XO(s)+CO2(g)ΔH=+480.9 kJ what…

A: The given reactions are:

Q: Calculate AH for each of the following reactions (use the data in Appendix II): (a) 2 CH10 (g) + 13…

Q: Consider the data about gold metal in Exercise 5.26(b).(a) Based on the data, calculate the specific…

A: a.

Q: A metal sample weighing 56.7 g at temperature of 98.0°C was placed in 50.0 g of water in a…

Q: 10. Calculate AH for the reaction CH4 (g) + NH3 (g) → HCN (g) + 3 H2 (g), given: a. N2 (g) + 3 H2…

A: Ans Enthalpy change for the reaction can be calculated by using Hess laws

Q: 2. Calculate AH for the reaction: CH4 (g) + 4 Cl2 (g) CCI4 (g) +4 HCI (g) Use the following…

A: We have to calculate ∆Hrxn for the reaction CH4(g) + 4Cl2(g) → CCl4(g) + 4HCl(g).

Q: the laboratory, POCl3 (phosphorus oxychloride) is used in the manufacture of phosphate esters, which…

Q: If you have a reaction that occurs in aqueous solution, and raises the temperature of 15.9 g of…

A: As the reaction is exothermic , it liberates heat which rises the temperature of water so sign of…

Q: How much work in L*atm is done by 1.44 moles of a gas that has an initial volume of 22.5 liters and…

A: Initial Volume of gas = 22.5 L Calculation of final volume of gas: where P is the final pressure, V…

Q: How much heat is released at constant pressure if 12.3 mL of 0.161 M silver nitrate is mixed with…

A: Given, AgNO3(aq) + KCl(aq) ➝ AgCl(s) + KNO3(aq) ∆H° = -65.5 kJ Here (-) sign indicate the release…

Q: Predict the sign of AG for the following reactions if each reaction was an exothermic. Does the…

A: We know , ∆G = ∆H -T∆S For exothermic reaction ∆H is a negetive quantity.

Q: Consider the following reaction: N2(g) + 3H2(g) - 2NH3(g); AH° = - 91.8 kJ The density of ammonia at…

A: Calculate the mass of nitrogen gas. Mass of nitrogen gas = Volume of nitrogen gas × Density of…

Q: Calculate AH for the reaction 4 NH3 (g) + 5 02 (g) --> 4 NO (g) + 6 H2O (g), from the following…

A: ∆H depends on Stoichiometry of thermochemical reaction If a thermochemical equation is reversed…

Q: Q1. Describe the change in temperature in diagram A and diagram B. Q2. Interpret AE 0. When do we…

A: In diagram A, the heat energy is released from the system In diagram B, the heat energy is absorbed…

Q: (a) What is meant by the term fuel value? (b) Which is a greatersource of energy as food, 5 g of fat…

A: A) Fuel value is defined as amount of energy releasing during burning of 1 g of fuel. For example on…

Question

Coal can be converted to methane, a chief component of natural gas, according to the
following reaction.
C(e) + 2H2(g)
CH4G)
For which AH° and AS° for the reaction are -74.85 kJ/mol and -80.69J/K-mol respectively.
Calculate the AG° for this reaction at 25°C.

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step by step

Solved in 2 steps with 2 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Using data from Appendix 4, calculate G for the reaction 2H2S(g)+SO2(g)3Srhombic(s)+2H2O(g) for the following conditions at 25C: PH2S=1.0104atmPSO2=1.0102atmPH2O=3.0102atm
Shown below is a diagram depicting the enthalpy change of a chemical reaction run at constant pressure. a Is the reaction exothermic or endothermic? b What is the sign of H? c What is the sign of q? d If the reaction does no work, what is the sign of E for this process?
Define the standard enthalpy of formation. What are standard states for elements and for compounds? Using Hess's law, illustrate why the formula Hreaction=npHf(products)nfHf(reactants) works to calculate H for a reaction.
9.98 Hydrogen combines with oxygen in fuel cells according to the thermochemical equation 2H2(g)+O2(g)2H2O(g) H= -571.7 kJ Suppose that you are working with a firm that is using hydrogen fuel cells to power satellites. The satellite requires 4.0105 kJ of energy during its useful lifetime to stabilize its orbit. Describe how you would determine the mass of hydrogen you would need in your fuel cells for this particular satellite.
Given the following data 2O3(g) 3O2(g)H = 427 kJ O2(g) 2O(g)H = 495 kJ NO(g) + O3(g) NO2(g) + O2(g)H = 199 kJ Calculate H for the reaction NO(g) + O(g) NO2(g)
A piece of lead of mass 121.6 g was heated by an electrical coil. From the resistance of the coil, the current, and the Time the current flowed, it was calculated that 235 J of heat was added to the lead. The temperature of the lead rose from 20.4C to 35.5C. What is the specific heat of the lead?
How many L atm are equal to 12.2 kJ of work?
The combustion of methane can be represented as follows: a. Use the information given above to determine the value of H for the combustion of methane to form CO2(g) and 2H2O(l). b. What is Hf for an element in its standard state? Why is this? Use the figure above to support your answer. c. How does H for the reaction CO2(g) + 2H2O (1) CH4(g) + O2(g) compare to that of the combustion of methane? Why is this?
A piece of unknown solid substance weighs 437.2 g, and requires 8460 J to increase its temperature from 19.3 °C to 68.9 °C. (a) What is the specific heat of the substance? (b) If it is one of the substances found in Table 5.1, what is its likely identity?
9.53 Using these reactions, find the standard enthalpy change for the formation of 1 mol of PhO(s) from lead metal and oxygen gas. PbO(s)+C(graphite)Pb(s)+CO(g) H = 106.8 kJ 2C(graphite)+O2(g)2CO(g) H= -221.0 kJ If 250 g of lead reacts with oxygen to form lead(II) oxide, what quantity of thermal energy (in kJ) is ahsorhed or evolved?
How many kJ are equal to 3.27 L atm of work?
Use the values of Hf in Appendix 4 to calculate H for the following reactions. (See Exercise 77 .) a. b. SiCl4(l)+2H2O(l)SiO2(s)+4HCl(aq) c. MgO(s)+H2O(l)Mg(OH)2(s)