Combine the following equations to determine the enthalpy change for the combustion of 1 mole of propane. Assume that solid carbon is graphite. 3C(s,graphite) + 4H,(g) → C,Hg(g) AH° = -103.8 kJ/mol C(s,graphite) + O,(g) → CO,(9) AHº= -393.5 kJ/mol H, (9) + 0,(9) → H,0(9) AH°= -285.8 kJ/mol

Combine the following equations to determine the enthalpy change for the combustion of 1 mole of propane. Assume that solid carbon is graphite. 3C(s,graphite) + 4H,(g) → C,Hg(g) AH° = -103.8 kJ/mol C(s,graphite) + O,(g) → CO,(9) AHº= -393.5 kJ/mol H, (9) + 0,(9) → H,0(9) AH°= -285.8 kJ/mol

Physical Chemistry

2nd Edition

ISBN:9781133958437

Author:Ball, David W. (david Warren), BAER, Tomas

Publisher:Ball, David W. (david Warren), BAER, Tomas

Chapter2: The First Law Of Thermodynamics

Section: Chapter Questions

Problem 2.79E: The enthalpy of combustion of diamond is -395.4 kJ/mol. C s, dia O2 g CO2 g Determine the fH of C...

See similar textbooks

Related questions

Q: THERMODYNAMICS: A 1.61 g sample of acetic acid (HC2H302) was burned in excess oxygen in a bomb…

Q: THERMODYNAMICS: A 1.61 g sample of acetic acid (HC2H3O2) was burned in excess oxygen in a bomb…

Q: Calculate the enthalpy of combustion of propane, C3H8(g), for the formation of H2O(g) and CO2(g).…

A: The standard enthalpy of formation is also known as the standard heat of formation of a compound. It…

Q: The combustion of 1 mol of glucose, C6H12O6 liberates 2.82 x 103 kJ of heat. If 1.25 g of glucose is…

Q: THERMODYNAMICS: A 1.09 g sample of acetic acid (HC2H302) was burned in excess oxygen in a bomb…

A: Mass of acetic acid = 1.09 g ∆T = 27.95 - 24.3 = 3.65 oC

Q: THERMODYNAMICS: A 1.21 g sample of acetic acid (HC2H3O2) was burned in excess oxygen in a bomb…

Q: Consider the following reaction: CH4 (9) + 20, (9) → CO2 (g) + 2H, O(1) AH=-891 kJ a. Calculate the…

A: We have enthalpy of combustion of methane as -891 KJ. a) we have to calculate the enthalpy change…

Q: Consider the following reaction equation of combustion of glucose, C6H12O6: a. Calculate the…

A: Mass of Glucose = 5.25 g C6H12O6 (s) + 6O2(g) ------> 6CO2(g) + 6H2O(g)

Q: If 0.315 moles of hexane (C6H14) is combusted in a bomb calorimeter containing 5.65 liters of water,…

A: The reaction’s enthalpies are determined by the calorimeter. The reactions inside calorimeter are…

Q: When 150 mL of 1.00 M NaOH is added to 100 mL of 1.30 M HCl in an insulated calorimeter, the…

A: To calculate the enthalpy change for the neutralization reaction, the following quantities are…

Q: Zinc metal reacts with hydrochloric acid according to the following reaction: % Zn (s) + HCI (aq) →…

A: The reaction given is, Given: Mass of Zn reacting = 0.9807 g. Concentration of HCl = 0.250 M Volume…

Q: Under constant-volume conditions, the heat of combustion of benzoic acid is 26.38 KJ/g. A 2.760-g…

A: The change in temperature,∆T is calculated below.

Q: THERMODYNAMICS: A 1.17 g sample of acetic acid (HC2H3O2) was burned in excess oxygen in a bomb…

A: Given: 1.17 g of acetic acid is burnt in oxygen in a calorimeter.

Q: In an experiment, a 0.7520 g sample of 1,2-benzenediol (C6H6O₂) is burned completely in a bomb…

A: we have to calculate the molar heat of combustion for 1,2-benzenediol

Q: 4. A 15.0 g sample of ethanol in an alcohol burner, is used as fuel to heat up 2.0 L of coffee from…

A: The heat generated during the combustion of 15.0 g is used to increase the temperature of the 2.0 L…

Q: Top fuel dragsters and funny cars burn nitromethane as fuel according to the following balanced…

A: Given,Standard enthalpy of combustion = -1,418 kJ.

Q: THERMODYNAMICS: A 1.1 g sample of acetic acid (HC2H302) was burned in excess oxygen in a bomb…

Q: I. Give the thermochemical data below, find the change in enthalpy for the following reactions: NO…

A: ∆H of a reaction is the amount of heat released in the reaction.

Q: THERMODYNAMICS: A 1.66 g sample of acetic acid (HC2H302) was burned in excess oxygen in a bomb…

A: Mass of acetic acid = 1.66 g Molar mass of Acetic acid = 60g/mol Temperature change = 4.56°C Heat…

Q: For the chemical reaction %3D Ca (s) + ½ O2 (g) → CaO (s) AH° = -635 kJ/mol. What is the enthalpy…

A: Since you have asked multiple questions, we will solve the first question for you. If you want any…

Q: A bomb calorimeter has a heat capacity of 675.0 J/°C and contains 925.0 g of water. If the…

Q: Methanol is known to be the simplest alcohol, and is used as an antifreeze agent, a solvent, a…

Q: The combustion of benzoic acid, C7H6O2, can be used to determine the heat capacity of a bomb…

A: The heat capacity of the calorimeter-water is 3.36 KJ/°c Below attached file showing the details…

Q: 2. To study the possible amount of energy generated by a person, the person can be roughly viewed as…

Q: Hydrobromic acid (HBr) is a commonly used acid for adding bromine to organic compounds. As bromine…

Q: What is the standard enthalpy change for the combustion of 3.50 mol of methanol? 2CH 3OH(l) + 3O 2 →…

A: Standard enthalpy of combustion of methanol is -715 kJ/mole

Q: 3. A 10.0 g sample of pure acetic acid, CH3CO2H, is completely burned. The heat released warms 2.0 L…

Q: The combustion of methanol is described by the following equation. 2 CH3OH (l) + 3O2 (g) → 2 CO2…

A: The combustion reaction of methanol is 2 CH3OH (l) + 3O2 (g) → 2 CO2(g) + 4 H2O (l), ΔH = −1454 kJ…

Q: Calcium hydroxide is prepared by adding calcium oxide to water: CaO (s) + H2O (l) → Ca(OH)2 (s)…

A: Given, Calcium hydroxide is prepared by adding calcium oxide to water: CaO (s) + H2O (l) → Ca(OH)2…

Q: Rapid walking through a distance of 2.2 km for 30 minutes per day requires 41 J while swimming for…

A: Since walking consume 41 J per day(for 30 minutes). Energy consumed in one week = 7×41= 287J. Energy…

Q: A scientist measures the standard enthalpy change for the following reaction to be 11.0 kJ…

A: Standard Enthalpy change of a reaction is the sum of the standard enthalpies of products minus the…

Q: 2) A 0.500 g sample of Trinitrotoluene (C7H$N2O6) is burned in a bomb calorimeter containing 610…

A: Given: Sample weight = 0.5 g Heat of combustion (q) = 3374 kJ/mol Weight of water = 610 g Initial…

Q: solve for the enthalpy of the following: 1. A car performs 6000 joules of work on its surroundings…

A: From the First law of thermodynamics,ΔU = q - w where q is the heat added to the system and w is the…

Q: When a piece of unknown metal weighing 63.40 grams, and at a temperature of 87.80 °C, is placed in a…

A: We will use calorimetry principle

Q: Consider the following reaction: 6 CH. (9) + 20, (g) CO2(9) + 2H,O(1) AH=-891 kJ a. Calculate the…

Q: In an experiment, a 0.3513 g sample of diphenylacetylene (C₁4H10) is burned completely in a bomb…

Q: temperature of the calorimeter increases from 22.14°C to 26.82°C. What is the heat of combustion per…

A: #(a): Given: Initial temperature of the calorimeter, Ti = 22.25 oC Final temperature of the…

Q: Cyanamide is a compound containing two hydrogen atoms and some amount of C and N. There are a total…

A: From the give data, in total of 5 atoms, 2 atoms are Hydrogen, in remaining 3 atoms, let consider…

Q: Ethanol (C2H5OH) is currently blended with gasoline as an automobile fuel. Part A Write a balanced…

A: Given: The blending of ethanol with gasoline is used as an automobile fuel. The combustion of…

Q: Calculate the enthalpy of reaction for the combustion of 9.25 g of butane, C4H10, using the…

A: Given data - Enthalpy of formation - CO2(g) = -394 kJ/mol; H2O(l) = - 286 kJ/mol; C4H10(g) = -484…

Q: 4. 1.922 g methanol (CH3OH) was burned in a constant-volume bomb calorimeter. Consequently, the…

A: “Since you have asked multiple questions, we will solve the first question for you. If you want any…

Q: Calculate the standard molar enthalpy for the complete combustion of liquid ethanol (C2H5OH) using…

Q: 0.500 g of ethanol [CH3CH2OH(l)] was burned in a bomb calorimeter. The temperature of the water rose…

Q: 1 If the standard enthalpy of cembustion of gaseous cyclopropane, C3H6, is -2091.2 kJ mol- at 25 C,…

A: The negative enthalpy of formation means the formation of the compound is spontaneous. The enthalpy…

Q: An equation for the combustion of propane is given below. C3H8(g) + 502(g) →3CO2(g) + 4H2O(g) 18a.…

A: ∆H°rxn can be calculated using enthalpies of bond by subtraction of enthalpies of bond of products…

Q: Her) is a commonly used acid for adding bromine to organic compounds. As bromine makes for an easily…

A: The enthalpies of the reactions are given . We have to calculate enthalpy for the synthesis of HBr…

Q: The combustion of 1.778 g of glucose, C6H₁₂O6 (s), in a bomb calorimeter with a heat capacity of…

Q: THERMODYNAMICS: A 1.96 g sample of acetic acid (HC;H3O2) was burned in excess oxygen in a bomb…

Q: 8. Liquid ethanol, C,H;OH(1), has been proposed as an alternative fuel. Calculate the standard…

Question

Combine the following equations to determine the enthalpy change for the combustion of 1 mole of propane. Assume that solid carbon
is graphite.
3C(s,graphite) + 4H,(g) → C,Hg(g)
AH° = -103.8 kJ/mol
C(s,graphite) + O,(g) → CO,(9)
AHº= -393.5 kJ/mol
H, (9) + 0,(9) → H,0(9)
AH°= -285.8 kJ/mol

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

Step 2

Step 3

Step 4

Step 5

Step 6

Step 7

Trending now

This is a popular solution!

Step by step

Solved in 7 steps with 5 images

SEE SOLUTION Check out a sample Q&A here

Similar questions

sample of natural gas is analyzed and found to be88.4% methane (CH4) and 11.6% ethane (C2H6) bymass. The standard enthalpy of combustion of methaneto gaseous carbon dioxide (CO2) and liquid water (H2O) is -891 kJ/mol. Write the equation for the combustionof gaseous ethane to carbon dioxide and water.Calculate the standard enthalpy of combustion of ethaneusing standard enthalpies of formation from Table R-11on page 975. Using that result and the standard enthalpyof combustion of methane in Table 15.3, calculate theenergy released by the combustion of 1 kg of natural gas.
In a coffee-cup calorimeter, 1.60 g NH4NO3 is mixed with 75.0 g water at an initial temperature of 25.00C. After dissolution of the salt, the final temperature of the calorimeter contents is 23.34C. Assuming the solution has a heat capacity of 4.18 J/C g and assuming no heat loss to the calorimeter, calculate the enthalpy change for the dissolution of NH4NO3 in units of kJ/mol.
The octane number of gasoline is based on a comparison of the gasolines behavior with that of 2,2,4-trimethylpentane, C8H18(), which is arbitrarily assigned an octane number of 100. The standard enthalpy of combustion of this compound is 5456.6 kJ/mol. (a) Write the thermochemical equation for the combustion of 2,2,4-trimethylpentane. (b) Use the standard enthalpies of formation in Appendix G to calculate the standard enthalpy of formation of 2,2,4-trimethylpentane.
Nitrogen gas (2.75 L) is confined in a cylinder under constant atmospheric pressure (1.01 105 pascals). The volume of gas decreases to 2.10 L when 485 J of energy is transferred as heat to the surroundings. What is the change in internal energy of the gas?
Calculate the standard enthalpy of combustion for benzene, C6H6. C6H6() + 15/2 O2(g) 6 CO2(g) + 3 H2O() rH = ? The enthalpy of formation of benzene is known [rH[C6H6()] = +49.0 kJ/mol], and other values needed can be found in Appendix L.
Gasohol, a mixture of gasoline and ethanol, C2H5OH, is used as automobile fuel. The alcohol releases energy in a combustion reaction with O2. C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) If 0.115 g ethanol evolves 3.62 kJ when burned at constant pressure, calculate the combustion enthalpy for ethanol.
Write reactions for which the enthalpy change will be a. Hf for solid aluminum oxide. b. the standard enthalpy of combustion of liquid ethanol, C2H5OH(l). c. the standard enthalpy of neutralization of sodium hydroxide solution by hydrochloric acid. d. Hf for gaseous vinyl chloride, C2H3Cl(g). e. the enthalpy of combustion of liquid benzene, C6H6(l). f. the enthalpy of solution of solid ammonium bromide.
When one mol of KOH is neutralized by sulfuric acid, q=56 kJ. (This is called the heat of neutralization.) At 23.7C, 25.0 mL of 0.475 M H2SO4 is neutralized by 0.613 M KOH in a coffee-cup calorimeter. Assume that the specific heat of all solutions is 4.18J/gC, that the density of all solutions is 1.00 g/mL, and that volumes are additive. (a) How many mL of KOH is required to neutralize H2SO4? (b) What is the final temperature of the solution?
In a coffee-cup calorimeter, 150.0 mL of 0.50 M HCI is added to 50.0 mL of 1.00 M NaOH to make 200.0 g solution at an initial temperature of 48.2C. If the enthalpy of neutralization for the reaction between a strong acid and a strong base is 56 kJ/mol, calculate the final temperature of the calorimeter contents. Assume the specific heat capacity of the solution is 4.184 J/g C and assume no heat Joss to the surroundings.
The enthalpy change for the following reaction is 393.5 kJ. C(s,graphite)+O2(g)CO2(g) (a) Is energy released from or absorbed by the system in this reaction? (b) What quantities of reactants and products are assumed? (c) Predict the enthalpy change observed when 3.00 g carbon burns in an excess of oxygen.