Consider the equilibrium system described by the chemical reaction below. Calculate the value of Qp for the initial set reaction conditions: 2.37 atm N2, 4.18 atm O2, 1.15 atm NO. N2(g) + O2(g) = 2 NO(g) 1. Based on the given data, set up the expression for Qp and then evaluate it. Do not combine or simplify terms.

Consider the equilibrium system described by the chemical reaction below. Calculate the value of Qp for the initial set reaction conditions: 2.37 atm N2, 4.18 atm O2, 1.15 atm NO. N2(g) + O2(g) = 2 NO(g) 1. Based on the given data, set up the expression for Qp and then evaluate it. Do not combine or simplify terms.

Chemistry: Principles and Practice

3rd Edition

ISBN:9780534420123

Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Publisher:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Chapter17: Chemcial Thermodynamics

Section: Chapter Questions

Problem 17.20QE: The equilibrium constant for a reaction decreases as temperature increases. Explain how this...

See similar textbooks

Similar questions

Indicate whether each statement below is true or false. If a statement is false, rewrite it to produce a closely related statement that is true. For a given reaction, the magnitude of the equilibrium constant is independent of temperature. If there is an increase in entropy and a decrease in enthalpy when reactants in their standard states are converted to products in their standard states, the equilibrium constant for the reaction must be negative. The equilibrium constant for the reverse of a reaction is the reciprocal of the equilibrium constant for the reaction itself. For the reaction H2O2(ℓ) ⇌ H2O(ℓ) + O2(g) the equilibrium constant is one half the magnitude of the equilibrium constant for the reaction 2H2O2(ℓ) ⇌ 2H2O(ℓ) + O2(g)
For each reaction, an equilibrium constant at 298 K is given. Calculate G for each reaction. (a) Br2()+ H2(g)2HBr(g) KP = 4.4 1018 (b) H2O()H2O(g) KP = 3.17 102 (c) N2(g) +3H2(g)2NH3(g) Kc = 3.5 108
Consider the following reaction at 298 K: 2SO2(g)+O2(g)2SO3(g) An equilibrium mixture contains O2(g) and SO3(g) at partial pressures of 0.50 atm and 2.0 atm, respectively. Using data from Appendix 4, determine the equilibrium partial pressure of SO2 in the mixture. Will this reaction be most favored at a high or a low temperature, assuming standard conditions?
If wet silver carbonate is dried in a stream of hot air. the air must have a certain concentration level of carbon dioxide to prevent silver carbonate from decomposing by the reaction Ag2CO3(s)Ag2O(s)+CO2(g) H for this reaction is 79.14 kJ/mol in the temperature range of 25 to 125C. Given that the partial pressure of carbon dioxide in equilibrium with pure solid silver carbonate is 6.23 103 torr at 25C, calculate the partial pressure of CO2 necessary to prevent decomposition ofAg2CO3 at 110C. (Hint: Manipulate the equation in Exercise 79.)
Predict the temperature at which the reaction in Exercise 17.67 comes to equilibrium. Consider the equation G = H TS. At some value of T, G equals zero and the reaction is at equilibrium. Set G = 0, substitute for H and S (assuming that they do not vary much with temperature) and solve for T. CH3CHO(l)+52O2(g)2CO2(g)+2H2O(l)
Use data given in Tables 6.2 and 18.1 to obtain the value of Kp at 1000C for the reaction C(graphite)+CO2(g)2CO(g) Carbon monoxide is known to form during combustion of carbon at high temperatures. Do the data agree with this? Explain.
Methanol can be synthesized by means of the equilibriumreaction CO(g)+2H2(g)CH3OH(g) for which the equilibrium constant at 225°C is 6.08103. Assume that the ratio of the pressures of CO(g) and H2(g) is 1:2. What values should they have if the partial pressureof methanol is to be 0.500 atm?
Hydrogen gas and iodine gas react to form hydrogen iodide. If 0.500 mol H2 and 1.00 mol I2 are placed in a closed 10.0-L vessel, what is the mole fraction of HI in the mixture when equilibrium is reached at 205C? Use data from Appendix C and any reasonable approximations to obtain K.
For the system 2SO3(g)2SO2(g)+O2(g) K=1.32 at 627. What is the equilibrium constant at 555C?
The equilibrium constant for a reaction decreases as temperature increases. Explain how this observation is used to determine the sign of either H or S.
Consider the reaction CO(g)+H2O(g)CO2(g)+H2(g) Use the appropriate tables to calculate (a) G at 552C (b) K at 552C