Consider the following two reactions and the corresponding enthalpy changes: CH4(g) +2 O₂(g)-CO₂(g) +2 H₂O(1),AH₁ 2 CH4(g) + O₂(g) 2 CH3OH(1), H₂ Given that H₁ = −890 kJ, how much heat is released or absorbed in combustion of 1 mole of methane? 74.80 kJ released 149.6 kJ released 74.80 kJ absorbed 890 kJ absorbed 890 kJ released

Consider the following two reactions and the corresponding enthalpy changes: CH4(g) +2 O₂(g)-CO₂(g) +2 H₂O(1),AH₁ 2 CH4(g) + O₂(g) 2 CH3OH(1), H₂ Given that H₁ = −890 kJ, how much heat is released or absorbed in combustion of 1 mole of methane? 74.80 kJ released 149.6 kJ released 74.80 kJ absorbed 890 kJ absorbed 890 kJ released

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter6: Thermochemistry

Section: Chapter Questions

Problem 76E: Combustion reactions involve reacting a substance with oxygen. When compounds containing carbon and...

See similar textbooks

Similar questions

In a constant-volume calorimeter, 35.0g of H2cools from 75.3C to25.0C. Calculate w, q, U, and H for the process.
Nitrogen gas (2.75 L) is confined in a cylinder under constant atmospheric pressure (1.01 105 pascals). The volume of gas decreases to 2.10 L when 485 J of energy is transferred as heat to the surroundings. What is the change in internal energy of the gas?
Another reaction that is used to propel rockets is N2O4(l)+2N2H4(l)3N2(g)+4H2O(g) This reaction has the advantage that neither product is toxic, so no dangerous pollution is released. When the reaction consumes 10.0 g liquid N2O4, it releases 124 kJ of heat. (a) Is the sign of the enthalpy change positive or negative? (b) What is the value of H for the chemical equation if it is understood to be written in molar quantities?
One of the components of jet engine fuel is n-dodecane, C12H26(), which has a standard enthalpy of combustion of 8080.1 kJ/mol. (a) Write the thermochemical equation for the combustion of n-dodecane. (b) Use the standard enthalpies of formation in Appendix G to calculate the standard enthalpy of formation of n-dodecane.
A 250-g sample of water at 20.0C is placed in a freezer that is held at a constant temperature of 20.0C. Considering the water as the system, answer the following questions: a What is the sign of qsys for the water after it is placed in the freezer? b After a few hours, what will be the state of the water? c How will the initial enthalpy for the water compare with the final enthalpy of the water after it has spent several hours in the freezer? d What will the temperature of the water be after several hours in the freezer?
The head of a strike anywhere match contains tetraphosphorus trisulfide, P4S3. In an experiment, a student burned this compound in an excess of oxygen and found that it evolved 3651 kJ of heat per mole of P4S3 at a constant pressure of 1 atm. She wrote the following thermochemical equation: P4S3(s)+8O2(g)P4O10(s)+3SO2(g);H=3651kJ Calculate the standard enthalpy of formation of P4S3, using this students result and the following standard enthalpies of formation: P4O10(s), 3009.9 kJ/mol; SO2(g), 296.8 kJ/mol. How does this value compare with the value given in Appendix C?
Combustion reactions involve reacting a substance with oxygen. When compounds containing carbon and hydrogen are combusted, carbon dioxide and water are the products. Using the enthalpies of combustion for C4H4 ( 2341 kJ/mol), C4H8 (2755 kJ/mol), and H2 (286 kJ/mol), calculate H for the reaction C4H4(g)+2H2(g)C4H8(g)
In a coffee-cup calorimeter, 100.0 mL of 1.0 M NaOH and 100.0 mL of 1.0 M HCI are mixed. Both solutions were originally at 24.6C. After the reaction, the final temperature is 31.3C. Assuming that all the solutions have a density of 1.0 g/cm3 and a specific heat capacity of 4.18 J/Cg, calculate the enthalpy change for the neutralization of HCl by NaOH. Assume that no heat is lost to the surroundings or to the calorimeter.
A 50-mL solution of a dilute AgNO3 solution is added to 100 mL of a base solution in a coffee-cup calorimeter. As Ag2O(s) precipitates, the temperature of the solution increases from 23.78 C to 25.19 C. Assuming that the mixture has the same specific heat as water and a mass of 150 g, calculate the heat q. Is the precipitation reaction exothermic or endothermic?
The combustion of ethane, C2H6, has an enthalpy change of 2857.3 kJ for the reaction as written below. Calculate H for the combustion of 15.0 g of C2H6. 2 C2H6(g) + 7 O2(g) 4 CO2(g) + 6 H2O(g) rH=2857.3kJ/mol-rxn
A piece of titanium metal with a mass of 20.8 g is heated in boiling water to 99.5 C and then dropped into a coffee-cup calorimeter containing 75.0 g of water at 21.7 C. When thermal equilibrium is reached, the final temperature is 24.3 C. Calculate the specific heat capacity of titanium.
Gasohol, a mixture of gasoline and ethanol, C2H5OH, is used as automobile fuel. The alcohol releases energy in a combustion reaction with O2. C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) If 0.115 g ethanol evolves 3.62 kJ when burned at constant pressure, calculate the combustion enthalpy for ethanol.