Consider these two entries from a fictional table of standard reduction potentials. X+ +3e X(s) E° = -1.94 V Y3+ +3e Y(s) E° = -0.31 V What is the standard potential of a galvanic (voltaic) cell where X is the anode and Y is the cathode? V %3D 'cell

Consider these two entries from a fictional table of standard reduction potentials. X+ +3e X(s) E° = -1.94 V Y3+ +3e Y(s) E° = -0.31 V What is the standard potential of a galvanic (voltaic) cell where X is the anode and Y is the cathode? V %3D 'cell

Chemistry: Principles and Practice

3rd Edition

ISBN:9780534420123

Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Publisher:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Chapter18: Electrochemistry

Section: Chapter Questions

Problem 18.108QE: At 298 K, the solubility product constant for solid Ba(IO3)2 is 1.5 109. Use the standard reduction...

See similar textbooks

Related questions

Q: Mg(s) + Fe2+(aq) – Mg2+(aq) + Fe(s) The galvanic cell described above has a standard cell potential…

A: Galvanic cell is electrochemical cell where, current is supplied to carry out some chemical…

Q: Consider these two entries from a fictional table of standard reduction potentials. X3+ + 3 e- →…

A: We have two half cell reaction: X3+ + 3e- ----> X(s) E°= -1.61 V Y3+ + 3e- ---->…

Q: A galvanic cell is constructed of two half cells Zn2+*(aq)/Zn(s) and H2(g)/H*(aq) separated by a…

A: Since we only answer up to 3 sub-parts, we’ll answer the first 3. Please resubmit the question and…

Q: Consider these two entries from a fictional table of standard reduction potentials. X3+ +3e- X(s) E°…

Q: The oxidation of hydrogen by oxygen is one of the most-used reactions in fuel-cell technology. The…

A: The relationship between the E0cell and ΔG0 is given by nFE0cell = -ΔG0 where n = number of…

Q: You prepare a galvanic cell with the following: Al(s) and 0.020 M Al³⁺(aq) Sn(s) and 0.86 M…

Q: XX (0.80 M) || Mn O4minus (1.96 MIMn (2.35 MH" (1.52 M) The reduction potential for X is 1.17 V. The…

Q: 7. A voltaic cell based on the reaction between aqueous Br2 and vanadium(III) ions has Ecel = 0.73 V…

Q: Consider these two entries from a fictional table of standard reduction potentials. X3+ + 3 e- »…

Q: You wish to construct a galvanic cell with the cathode consisting of a Ni electrode in a 1.0 M…

Q: Consider these two entries from a fictional table of standard reduction potentials. X+ + 3e X(s) E°…

Q: Consider these two entries from a fictional table of standard reduction potentials. X+ + 3e X(s) E =…

Q: If we are to construct a galvanic cell using Cu and Sn, what will be the cell potential? Cu2*(aq) +…

A: The given values are of reduction potentials of the half cells.

Q: A galvanic cell consists of one half-cell that contains Ag( s) and Ag *(aq), and one half-cell that…

A: Two half cell reactions are given and asked that which species obtain at cathode and anode.

Q: What is the standard electrode potential for a galvanic cell constructed in the appropriate way from…

A: Metal having high reduction potential acts as cathode. But metal having low reduction potential acts…

Q: A galvanic cell is set up using the redox reaction below at 298 K. If the cell has a standard cell…

A: In a galvanic cell, the Gibbs free energy is related to standard cell potential as,…

Q: Consider a galvanic cell with the following half-reactions: MnO4– + 8 H+ + 5e– → Mn2+ + 4 H2O…

A: Given half cell reactions are : MnO4– + 8H+ + 5e– → Mn2+ + 4H2O , E° = 1.51…

Q: Xglx3+ (1.93 M) || Mn O, 1 minus (1.20 M)|Mn²* (0.27 M)|H* (2.72 M) The reduction potential for X3+…

A: Given values : (I) concentrations of :1. X3+=1.93 M2. MnO4-=1.20 M3. Mn2+=0.27 M4.…

Q: Consider these two entries from a fictional table of standard reduction potentials. X3+ + 3 e- →…

A: Given potentials are reduction potentials. X E°= -1.65 V Y E° = 0.38 V Standard cell…

Q: Consider these two entries from a fictional table of standard reduction potentials. X3+ + 3 e → X(s)…

Q: Consider these two entries from a fictional table of standard reduction potentials. X+ + 3e X(s) E°…

Q: Mg²+(aq) + 2 e¯ → • Mg(s) E° = -2.38 V Zn2+ (aq) + 2 e- Zn(s) E° = -0.76 V Determine the standard…

A: First, identify Reaction occuring at cathode and anode to calculate E°Cell

Q: A galvanic cell consists of one half-cell that contains Ag(s) and Ag+(aq), and one half-cell that…

A: The galvanic cell consists of two half-cell ; at one half cell oxidation reaction occurs and at the…

Q: Consider these two entries from a fictional table of standard reduction potentials. X3+ + 3e X(s) E°…

A: Given, The equation of standard reduction potential; X3+ + 3e- → Xs ....(1) E0 = -1.75 V Y3+ +…

Q: Alkaline dry-cell batteries have a voltage of 1.50 V under standard conditions. Given this standard…

A: Chemically, a typical alkaline dry cell battery has a zinc anode and a manganese dioxide cathode.…

Q: 0.10 М MnOg 0.40 М Cr3+ 0.20 М Mn2* 0.30 М Cr,0,2- 0.010 МН" 0.010 МН'

A: Given data: Eocell for Mn = 1.52 V Eocell for Cr = 1.33 V Formula used: Q=[products][reactants]

Q: For cell schematic notation Zn(s) | ZnCl2 (1.0 M )| | CuSO4 ( 2.0 M ) | Cu(s)…

Q: Consider these two entries from a fictional table of standard reduction potentials. X3+ + 3 e → X(s)…

Q: Calculate the potential for each cell as written at 25 °C. Indicate whether the metal electrode in…

Q: Consider these two entries from a fictional table of standard reduction potentials. X3+ + 3 e- →…

A: Electrode reactions and electrode potentials of two electrodes that can be made into a galvanic…

Q: Consider these two entries from a fictional table of standard reduction potentials. X^ 3+ +3e^ -…

A: Electrochemical cell is a cell in which chemical energy is converted to electrical energy. The…

Q: Consider these two entries from a fictional table of standard reduction potentials. X³+ + 3e → X(s)…

Q: A galvanic cell is set up using the redox reaction below at 298 K. If the cell has a standard cell…

A: Since the value of ΔG0 is given by ΔG0 = -nFE where E = standard cell potential = 0.31 F =…

Q: where the half-cells are Ag|AgNO3(aq) and Ni|Ni(NO3)2(aq), and the electrode potentials are as…

A: Standard cell potential (Eo) is the EMF of the cell when the concentrations of electrolytes is 1M ,…

Q: Sketch the galvanic cell represented by the following line notation: Ag (s), AgCI(s) | KCI (aq, 0.1…

A: It is given that the cell is represented by the notation Ag (s), AgCl(s) | KCI (aq, 0.1 M)||FeCl2…

Q: Consider these two entries from a fictional table of standard reduction potentials. X3+ + 3e- X(s)…

A: The solution is as follows :

Q: Consider a voltaic cell where the anode half-reaction isZn(s)---->Zn2+(aq) + 2 e- and the cathode…

A: Given that: The anode half-reaction is :Zn(s) → Zn2+(aq) + 2e- E°reduction=-0.76 ....eq 1…

Q: Dariana Using the Nernst equation to calculate nonstandard cell voltage A galvanic cell at a…

A: Galvanic cell:

Q: galvanic cell is made using 0.25M ZnSO4 and an unknown amount of CuSO4. The cell potential is 105V…

Q: What is the effect on the electrode potential if the pH of the following redox system is increased?…

Q: 4. The cell diagram for an electrochemical cell is given below: Mn(s)| Mn (aq, 1.0 mol dm) || Ag"…

A: This is an electrochemical cell called Galvanic cell where oxidation reduction reaction takes place…

Q: A galvanic cell at a temperature of 25.0 °C is powered by the following redox reaction: 3Cu" (ag) +…

A: The value of given temperature in Kelvin is, T(K) = T( C) + 273 T(K) = 25 + 273 T(K) = 298 K.

Q: What is the calculated value of the cell potential at 298 K for an electrochemical cell with the…

A: Ecell = 2.15 V The cell reaction as written above is spontaneous for the concentration given.

Q: If we are to construct a galvanic cell using Cu and Sn, what will be the cell potential? Cu2*(aq)- +…

A: A galvanic cell is an electrochemical cell that converts chemical energy into electrical energy. A…

Q: Consider a cell constructed from standard Q2+/Q and D+/D electrodes. Q and D are symbols of…

Q: A voltaic cell is constructed with two silver–silver chloride electrodes, each of which is based on…

A: According to the Nernst equation, the relation between cell potential, standard cell potential, and…

Q: Alkaline dry-cell batteries have a voltage of 1.50 V under standard conditions. Given this standard…

A: Common flashlight batteries are called dry-cell batteries since they do not contain large amounts of…

Q: Use the standard reduction potentials given below to predict if a reaction will occur between Sn(s)…

Q: 3.) Consider that the following half reaction is assigned a half cell voltage of0.00 V Hg (aq) +2 e…

A: Standard Potential can be calculated as- Ecell∘=EReduction∘-EOxidation∘ or Ecell∘=ECathode∘-EAnode∘

Q: II. 1.Represent in the conventional manner, i.e., anode/cathode, the voltaic cell in which each of…

Question

Consider these two entries from a fictional table of standard reduction potentials.
X+ +3e X(s)
E° = -1.94 V
Y3+ +3e Y(s)
E° = -0.31 V
What is the standard potential of a galvanic (voltaic) cell where X is the anode and Y is the cathode?
V
%3D
'cell

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step 3

VIEW

Step by step

Solved in 3 steps with 1 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Consider a galvanic cell based on the following half-reactions: a. What is the expected cell potential with all components in their standard states? b. What is the oxidizing agent in the overall cell reaction? c. What substances make up the anode compartment? d. In the standard cell, in which direction do the electrons flow? e. How many electrons are transferred per unit of cell reaction? f. If this cell is set up at 25C with [Fe2+] = 2.00 104 M and [La3+] = 3.00 103 M, what is the expected cell potential?
An electrolysis experiment is performed to determine the value of the Faraday constant (number of coulombs per mole of electrons). In this experiment, 28.8 g of gold is plated out from a AuCN solution by running an electrolytic cell for two hours with a current of 2.00 A. What is the experimental value obtained for the Faraday Constant?
The standard potential for the reduction of AgSCN is 0.0895 V. AgSCN(s)+eAg(s)+SCN(aq) Find another electrode potential to use together with the above value and calculate Kspfor AgSCN.
At 298 K, the solubility product constant for PbC2O4 is 8.5 1010, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction PbC2O4(s)+2ePb(s)+C2O42(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/PbC2O4 electrode in a 0.025 M solution of Na2C2O4.
At 298 K, the solubility product constant for Pb(IO3)2 is 2.6 1013, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction Pb(IO3)2(s)+2ePb(s)+2IO3(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions, and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/Pb(IO3)2 electrode in a 3.5 103 M solution of NaIO3.
Consider only the species (at standard conditions) Na+, Cl, Ag+, Ag, Zn2+, Zn, Pb in answering the following questions. Give reasons for your answers. (Use data from Table 17-1.) a. Which is the strongest oxidizing agent? b. Which is the strongest reducing agent? c. Which species can be oxidized by SO42 (aq) in acid? d. Which species can be reduced by Al(s)?
For each reaction listed, determine its standard cell potential at 25 C and whether the reaction is spontaneous at standard conditions. (a) Mn(s)+Ni2+(aq)Mn2+(aq)+Ni(s) (b) 3Cu2+(aq)+2Al(s)2Al3+(aq)+3Cu(s) (c) Na(s)+LiNO3(aq)NaNO3(aq)+Li(s) (d) Ca(NO3)2(aq)+Ba(s)Ba(NO3)2(aq)+Ca(s)
It took 150. s for a current of 1.25 A to plate out 0.109 g of a metal from a solution containing its cations. Show that it is not possible for the cations to have a charge of 1+.
Consider a galvanic cell based on the following half-reactions: a. What is the standard potential for this cell? b. A nonstandard cell is set up at 25C with [Mg2+] = 1.00 105 M. The cell potential is observed to be 4.01 V. Calculate [Au3+] in this cell.
The half-cells Ag+(aq. 1.0 M)|Ag(s) and H+(aq, ? M)|H2(1.0 bar) are linked by a salt bridge to create a voltaic cell. With the silver electrode as the cathode, a value of 0.902 V is recorded tor kcell at 298 K. Determine the concentration of H+ and the pH of the solution.
At 298 K, the solubility product constant for solid Ba(IO3)2 is 1.5 109. Use the standard reduction potential of Ba2+(aq) to find the standard potential for the half-reaction Ba(IO3)2(s)+2eBa(s)+2IO3(aq)