Consider these two entries from a fictional table of standard reduction potentials. X3+ + 3 e- → X(s) E° = -1.76 V Y3+ + 3 e- → Y(s) E° : = -0.16 V What is the standard potential of a galvanic (voltaic) cell where X is the anode and Y is the cathode? Eo ´cell V

Consider these two entries from a fictional table of standard reduction potentials. X3+ + 3 e- → X(s) E° = -1.76 V Y3+ + 3 e- → Y(s) E° : = -0.16 V What is the standard potential of a galvanic (voltaic) cell where X is the anode and Y is the cathode? Eo ´cell V

Fundamentals Of Analytical Chemistry

9th Edition

ISBN:9781285640686

Author:Skoog

Publisher:Skoog

Chapter18: Introduction To Electrochemistry

Section: Chapter Questions

Problem 18.18QAP

See similar textbooks

Related questions

Q: Calculate the standard cell potential for the reaction below, and note whether the reaction is…

A: Given, Mg(s)+Ni2+(aq)⟶Mg2+(aq)+Ni(s) Ni2+(aq)+2e−⟶Ni(s) −0.257 Mg2+(aq)+2e−⟶Mg(s) −2.372

Q: Calculate the cell potential and determine if this is a spontaneous reaction as written. MnO4-…

A: The balanced reaction given is, => MnO4- (aq) + 8 H+ (aq) + 5 Co2+ (aq) → Mn2+ (aq) + 4 H2O (l) +…

Q: Consider these two entries from a fictional table of standard reduction potentials. X3+ + 3 e- →…

A: We have two half cell reaction: X3+ + 3e- ----> X(s) E°= -1.61 V Y3+ + 3e- ---->…

Q: A voltaic cell is constructed with two Zn2+ - Zn electrodes. The two half-cells have 3Zn2+4 = 1.8 M…

A: The electrode in which anode and cathode both are form by same metal, tat cell is known as…

Q: A voltaic cell is constructed with two Zn2+-Zn electrodes, where the half-reaction is Zn2+ + 2e- →…

Q: A common shorthand way to represent a voltaic cell is anode& anode solution& & cathode…

Q: A voltaic cell is based on the reaction Sn1s2 + I21s2 ¡ Sn2+1aq2 + 2 I -1aq2 Under standard…

A: The overall cell reaction given and the half reactions are

Q: Consider these two entries from a fictional table of standard reduction potentials. X3+ +3e- X(s) E°…

Q: [References] A particular voltaic cell operates on the reaction Zn(s) + Cl2 (g) → Zn²+ (ag) + 2CI…

A: The solution is as follows :

Q: 9. For the galvanic cell the standard potential is as follow: Cr3+ + 3e --> Cr(s) Br2 (aq) + 2e- ->…

Q: Consider these two entries from a fictional table of standard reduction potentials. X3+ + 3 e- »…

Q: Consider these two entries from a fictional table of standard reduction potentials. X+ + 3e X(s) E°…

Q: Fe(s) Fe²+ (aq) || MnO4 (aq), Mn²+ (aq)| Pt(s) | Write the half reactions: Oxidation: Reduction: Net…

A: Given in following question a cell reaction Fe(s)/Fe+2(aq)//Mno4-(aq),MN+2 /pt thus cell…

Q: Consider these two entries from a fictional table of standard reduction potentials. X+ + 3e X(s) E =…

Q: Pls help ASAP

Q: Use information from Table 17.1 (pp. 907-909 of your textbook) to answer this question. What is the…

A: In the given cell we can see that the oxidation of Al is taking place and reduction of Cr3+ Hence…

Q: If we are to construct a galvanic cell using Cu and Sn, what will be the cell potential? Cu2*(aq) +…

A: The given values are of reduction potentials of the half cells.

Q: Consider these two entries from a fictional table of standard reduction potentials.…

A: To calculate standard potential of a galvanic cell:

Q: Consider these two entries from a fictional table of standard reduction potentials. X3+ + 3 e- →…

A: Given potentials are reduction potentials. X E°= -1.65 V Y E° = 0.38 V Standard cell…

Q: Consider these two entries from a fictional table of standard reduction potentials. X3+ + 3 e → X(s)…

Q: Consider these two entries from a fictional table of standard reduction potentials. X+ + 3e X(s) E°…

Q: As the cell runs, anions will migrate from the Sn2+|Sn compartment to the other compartment. 2.…

A: The Sn+2 | Sn is the reduction reaction of tin Because this reaction is occurring at the cathode…

Q: Consider these two entries from a fictional table of standard reduction potentials. X3+ + 3e X(s) E°…

A: Given, The equation of standard reduction potential; X3+ + 3e- → Xs ....(1) E0 = -1.75 V Y3+ +…

Q: Using the provided standard reduction potentials, which of the following cells is an example of a…

A: For a galvanic cell to function reduction potential of cathode must be greater than anode to be…

Q: Consider these two entries from a fictional table of standard reduction potentials. X3+ + 3 e X(s)…

A: E° cell = E° cathode + E° anode At anode always oxidation occur At cathode always reduction occur…

Q: Which of the following statements is true concerning the electrochemical cell depicted below? Ba |…

A: Given, Ba | Ba2+(aq) || Zn2+(aq) | Zn Ba2+(aq) + 2e– --> Ba(s); E° = –2.91 V Zn2+(aq) + 2e–…

Q: 7. For each of the following reactions Write the oxidation and reduction half reactions Determine…

Q: Consider these two entries from a fictional table of standard reduction potentials. X3+ + 3 e → X(s)…

Q: Consider these two entries from a fictional table of standard reduction potentials. X³+ + 3e → X(s)…

Q: 4. Write the overall balanced equation for the spontaneous process occurring in the following cell.…

A: For cell Zn|Zn2+||Cu2+|Cu We know the standard potentials - E°Zn2+|Zn= -0.76 V => E°Zn|Zn2+…

Q: If you said it was possible to calculate the cell voltage, do so and enter your answer here. Round…

A: Redox reaction is that type of reaction where oxidation and reduction occurs simultaneously.…

Q: what is the standard cell potential (in Volts) for a a galvanic cell that can do 567 kJ of work. The…

A: The solution is as follows :

Q: Consider these two entries from a fictional table of standard reduction potentials. X3+ + 3e- X(s)…

A: The solution is as follows :

Q: You are given a galvanic electrochemical cell which comprises of 2 x 1.0 L half-cells. Your…

A: Introduction: In any electrochemical cell, a redox reaction proceeds .here an electron is…

Q: Consider these two entries from a fictional table of standard reduction potentials. X+ +3e X(s) E° =…

A: To calculate E°Cell identify cathode and anode.

Q: A certain half-reaction has a standard reduction potential E=+0.45 V. An engineer proposes using…

A: Here we have to determine E°red minimum or any E°red maximum at cathode of galvanic cell. Given…

Q: A certain half-reaction has a standard reduction potential E=+0.40 V. An engineer proposes using…

Q: A certain half-reaction has a standard reduction potential Ered +1.34 V. An engineer proposes using…

A: Answer: For any galvanic cell its standard cell potential is: E°cell=E°cathode-E°anode Given data:…

Q: A voltaic electrochemical cell is constructed using the following reaction. The half-cell components…

A: In electrochemical cell Oxidation, increase in oxidation number,occur at anode . Reduction,…

Q: Using the Table of Standard Electrode Potentials (Appendix L, page 1251), calculate the E°cell for…

A: We have to calculate the Ecell for each of the following given reactions and predict the whether…

Q: 9. For the galvanic cell the standard potential is as follow: Cr3+ + 3e --> Cr(s) Зе Br2 (aq) + 2e¯…

A: According to Q&A guidelines of Bartleby, we are supposed to answer only the first question out…

Q: The potential of a voltaic cell is 0.698 V in which the following reaction takes place: 2NO, (aq) +…

A: Given data, EMF = 0.698V [NO3-] = 0.0315M PNO = 0.922atm PH2 = 0.437atm

Q: 5)A galvanic cell is based on Ag+(aq)/Ag(s) and Fe3+(aq) /Fe2+(aq) half-cells. a)What is the…

A: We are given a cell with two half cell as- Ag+(aq)/Ag(s) and Fe3+(aq) /Fe2+(aq)

Q: If we are to construct a galvanic cell using Cu and Sn, what will be the cell potential? Cu2*(aq)- +…

A: A galvanic cell is an electrochemical cell that converts chemical energy into electrical energy. A…

Q: Cr3+(aq) → Cr(s) Zn2+(aq) → Zn(s) a. What will be the overall balanced reaction if you want to…

A: The two half reactions are as follows: The oxidation half reaction is, Zn(s)------>Zn2+(aq) +2 e-…

Q: (E°cell)

Q: Consider a cell constructed from standard Q2+/Q and D+/D electrodes. Q and D are symbols of…

Q: Alkaline dry-cell batteries have a voltage of 1.50 V under standard conditions. Given this standard…

A: Common flashlight batteries are called dry-cell batteries since they do not contain large amounts of…

Q: Use the standard reduction potentials given below to predict if a reaction will occur between Sn(s)…

Q: Tarnish on iron is the compound FeOFeO. A tarnished iron plate is placed in an aluminum pan of…

Question

100%

Consider these two entries from a fictional table of standard reduction potentials.
X3+ + 3 e-
X(s)
E°
-1.76 V
Y3+ + 3 e-
→ Y(s)
E°
-0.16 V
What is the standard potential of a galvanic (voltaic) cell where X is the anode and Y is the cathode?
E
V
'cell
II

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Given

VIEW

Solution

VIEW

Answer

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 3 steps

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

At 298 K, the solubility product constant for PbC2O4 is 8.5 1010, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction PbC2O4(s)+2ePb(s)+C2O42(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/PbC2O4 electrode in a 0.025 M solution of Na2C2O4.
At 298 K, the solubility product constant for Pb(IO3)2 is 2.6 1013, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction Pb(IO3)2(s)+2ePb(s)+2IO3(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions, and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/Pb(IO3)2 electrode in a 3.5 103 M solution of NaIO3.
Consider a galvanic cell based on the following half-reactions: a. What is the expected cell potential with all components in their standard states? b. What is the oxidizing agent in the overall cell reaction? c. What substances make up the anode compartment? d. In the standard cell, in which direction do the electrons flow? e. How many electrons are transferred per unit of cell reaction? f. If this cell is set up at 25C with [Fe2+] = 2.00 104 M and [La3+] = 3.00 103 M, what is the expected cell potential?
It took 150. s for a current of 1.25 A to plate out 0.109 g of a metal from a solution containing its cations. Show that it is not possible for the cations to have a charge of 1+.
An electrolysis experiment is performed to determine the value of the Faraday constant (number of coulombs per mole of electrons). In this experiment, 28.8 g of gold is plated out from a AuCN solution by running an electrolytic cell for two hours with a current of 2.00 A. What is the experimental value obtained for the Faraday Constant?
You want to set up a series of voltaic cells with specific cell potentials. A Zn2+(aq, 1.0 M)| Zn(s) half-cell is in one compartment. Identify several half-cells that you could use so that the cell potential will be close to (a) 1.1 V and (b) 0.50 V. Consider cells in which the zinc cell can be either the cathode or the anode.
Consider a galvanic cell based on the following half-reactions: a. What is the standard potential for this cell? b. A nonstandard cell is set up at 25C with [Mg2+] = 1.00 105 M. The cell potential is observed to be 4.01 V. Calculate [Au3+] in this cell.
The standard potential for the reduction of AgSCN is 0.0895 V. AgSCN(s)+eAg(s)+SCN(aq) Find another electrode potential to use together with the above value and calculate Kspfor AgSCN.
The standard potential of the cell reaction Ag+(aq)+Eu2+(aq)Ag(s)+Eu3+(aq) is E = +1.23 V. Use the tabulated standard potential of the silver half-reaction to find the standard reduction potential for the europium half-reaction.