Question

Distinguish both physically and chemically between a fat and an oil molecules 

Expert Answer

Want to see the step-by-step answer?

Check out a sample Q&A here.

Want to see this answer and more?

Experts are waiting 24/7 to provide step-by-step solutions in as fast as 30 minutes!*

*Response times may vary by subject and question complexity. Median response time is 34 minutes for paid subscribers and may be longer for promotional offers.
Tagged in
Science
Chemistry

General Chemistry

Related Chemistry Q&A

Find answers to questions asked by students like you.

Q: Draw the structure of DDE.

A: The complete name of DDE is "Dichlorodiphenyldichloroethylene". Dichlorodiphenyldichloroethylene (DD...

Q: Based on the peptide YDCM, which residues are determined via Sanger degradation? Y only M only D and...

A: Sanger degradation determines the N-terminal residue. In this method, peptide chain is treated with ...

Q: Van der Waals Constants Use the van der Waals equation of state to calculate the pressure P of 2.70 ...

A: The van der waals equation is  where P = pressure V = volume of vessel = 5 L  n = moles = 2.7  R = ...

Q: Show how the following compound can be prepared from the given starting material.

A: Pyridine reacts with bromine in presence of acetic acid and forms 2-bromopyridine. Then 2-bromopyrid...

Q: Three bottles A, B, and C have been found, each of which contains a liquid and is labeled \"amine C8...

A: Primary amines give diazonium ions with NaNO2/HCl; secondary amines give nitrosamines with NaNO2/HCl...

Q: If 1.85 g MgO is combined with enough 1.00 M HCl to make 100.0 mL of solution in a coffee-cup calori...

A: Given : mass of MgO reacting = 1.85 g Initial temperature of solution = 21.3 °C Final temperature of...

Q: The gas phase decomposition of sulfuryl chloride at 600 KSO2Cl2(g)SO2(g) + Cl2(g)is first order in S...

A: The reaction given is SO2Cl2 (g) ------> SO2 (g) + Cl2 (g)  Given : Initial concentration of SO2C...

Q: Balance the following equation (and show your work), in basic solution:           ClO4-(aq) + C6H14O...

A: 1. Write down the unbalanced equation as follows 2. Separate the redox reaction into half-reactions...

Q: Five-membered aromatic heterocycles with one heteroatom undergo electrophilic substitutions preferen...

A: Electrophilic substitution means electrophile will attack the position where electron density is mor...

Q: To a 88.8 mL aqueous solution of NaOH, we add an excess of Mn(NO3)2 and produce 0.073 g of Mn(OH)2(s...

A: Given: Volume of NaOH solution = 88.8 mL Mass of Mn(OH)2 produced in the reaction of NaOH and Mn(NO3...

Q: What is the composition of Radon?

A: Click to see the answer

Q: What are the spectator ions in the reaction between aqueous chloric acid, HClO3, and aqueous potassi...

A: The total ionic equation is used to represent the molecular equation, wherein all the reactants and ...

Q: If you know the molar value of a compound, how do you figure out how much is the percent of that com...

A: The process of calculating the percent of substance in water (% m/v) is as shown below. Given : conc...

Q: Complete the changes in concentrations for each of the following reactions:(a) 2SO2(g) + O2(g) ⇌ 2SO...

A: Click to see the answer

Q: Draw structural formulas for the major products of   reaction

A: Overall reaction:

Q: Using the standard enthalpies of formation, what is the standard enthalpy of reaction? CO(g) + H,O(g...

A: The reaction given is  Standard enthalpies of formation ΔHof of species are 1) ΔHof (CO(g)) = -110....

Q: Chemistry Question

A: a) Since NaOH is a strong base which dissociates completely as per the reaction, NaOH ----> Na+ +...

Q: 19.54 grams of a metal with density 4.88 g/mL is placed into a graduated cylinder originally with 20...

A: Given, mass of metal = 19.54 g            density of metal = 4.88 g/mL             initial volume of...

Q: Answer each question using the ball-and-stick model of compound A. Draw a constitutional isomer that...

A: SOLUTION: Step 1: Hello. Since the question has multiple sub-parts, the first three parts are solved...

Q: 2. Does a more negative heat of formation (a larger negative number) mean that a compound is more st...

A: Since you have asked multiple questions, we will solve the first question for you. If you want any s...

Q: When water vapour condenses at 100oC and 1.00 atm of pressure, is the change in entropy of the unive...

A: The given process is irreversible process, so the change in entropy of the universe can be found as ...

Q: In the process, H2O + CN- → HCN + OH- , ______ acts a Bronsted-Lowry base. A. H2OB. CN- C. HCND. H3O...

A: Click to see the answer

Q: Express a wavelength of 442 nm as (a) a frequency. (b) a wavenumber.

A: SOLUTION: Step 1: Wavelength = 442 nm = 442 × 10-9 m. (a). the frequency can be calculated as follow...

Q: This solution contains only HF(aq). Write the proton transfer equilibrium reaction. Include states o...

A: HF is a weak acid means it does not release proton easily so exists in equilibrium in aqueous soluti...

Q: Liquid sodium is being considered as an engine coolant. How many grams of liquid sodium (minimum) ar...

A: The heat absorbed by the liquid is given by  Q = nCp ΔT  where Q = heat absorbed in J = 8.1 X 106 J ...

Q: 5Thiamin, or vitamin B1, contains a positively charged five-memberednitrogen–sulfur heterocycle call...

A: The structure of Thiamine or vitamin B1 is To explain, thiazolium ring is aromatic: NOTE that the 5...

Q: If M2+ is Ca2+ and Z2- is CO32-, would you raise or lower the pH if you wanted to make a precipitate...

A: The reaction between the considered strong base and weak acid proceeds as, The solubility product o...

Q: For the reaction 2 A(aq) ⇋ B(aq) + C(aq), the value of ΔGo is 3.94 kJ at 25.0oC. If the initial conc...

A: Given that, for the reaction: The standard free energy change ∆G⁰= 3.94 kJ = 3940 J. Temperature T ...

Q: 1.Suppose you have a container filled with air at 212 oF. The volume of the container 1.00 L, the pr...

A: The expression for ideal gas equation is given below,                          PV = nRT Where, P is ...

Q: A 0.285−mol sample of HX is dissolved in enough H2O to form 605.0 mL of solution. If the pH of the s...

A: Dissociation extent for any species is clearly visible in its dissociation constant value. If this i...

Q: Write the balanced molecular equation for the neutralization reaction between HI and Ba(OH), in aque...

A: Molecular equation is a balanced chemical equation in which all the molecules and ions are expressed...

Q: i could use some help with this question?

A: 1 gram(g) = 1000 mg. So , 1 mg = 10-3 g. 3.39mg caffeine / 1oz or 3.39 x 10-3 g caffeine / 1oz      

Q: Write the Lewis structure for each molecule or ion.a. H3COH b. OH- c. BrO- d. O22 -

A: Lewis structure is the electron dot structure drawn for molecules/ions, keeping in mind the lone pai...

Q: A 77.0-mL sample of a 0.203 M potassium sulfate solution is mixed with 55.0 mL of a 0.226 M lead(II)...

A: The reaction given is K2SO4(aq) + Pb(NO3)2 (aq)    ⟶ 2 KNO3(aq) + PbSO4(s) Given : concentration of ...

Q: Determine the bond order of each member of the following groups, and determine which member of each ...

A: As per our policies, we are answering the first three sub-parts for you. For the answer to the remai...

Q: Why is vaporization endothermic? Why is condensation exothermic?

A: In vaporisation it requires to overcome the intermolecular forces that holds together the liquids, a...

Q: The 1H-NMR spectrum of 1-bromopropane shows three signals and the 1H-NMR spectrum of 2-bromopropane ...

A: Click to see the answer

Q: What is the packing efficiency?

A: Packing efficiency is the percentage of space that the particles in the lattice occupy, which are pa...

Q: Describe the electron motion in metals. {Explain in the simplest way you can please :) }

A: Metal are ductile, lustrous, malleable in nature. Metal have a tendency to lose electrons. Therefore...

Q: Consider the incomplete structure. Add formal charges as necessary to the structure. All unshared va...

A: Formal charge on any atom in Lewis structure is given by  formal charge = number of valence electron...

Q: 2NO(g) + O2(g) → 2NO2(g) You are provided with 4.12 molmol of nitrogen monoxide gas. Using the balan...

A: Mole is the amount of the substance that contains the same number of particles or atoms or molecules...

Q: When delta G is negative        A. initial G is high and final G is low B.initia...

A: A negative delta G means the reaction is spontaneous and does not require any energy (external) to c...

Q: Chemistry Question

A: Click to see the answer

Q: need d-f

A: Click to see the answer

Q: In the Cr6+ cation, what is the effective charge felt by a valence electron?

A: The effective nuclear charge is calculated from Slater's rules as: Where, Z = atomic number, S = Sl...

Q: In terms of their bulk properties, how do liquids and solids differ? How are they similar?

A: Solids and liquids are among the three state of matter they are different in terms of, the solids ha...

Q: concentrated phosphoric acid is 90% h 3 po 4 by mass and the remaining mass is water the molarity of...

A: Molarity specifies the solute moles per litre (L) solution. Its S.I unit is moles/litre (M). Molarit...

Q: For the gas phase decomposition of t-butyl propionate,C2H5COOC(CH3)3(CH3)2C=CH2 + C2H5COOHthe rate c...

A: The relationship between rate constant and activation energy is given by  where K = rate constant  ...

Q: Add lone pairs to these Lewis structures of interhalogen compounds. BrF3 BrF5

A: 1) BrF3 : Since the electronegativity of Br is less than F. Hence the central atom is Br. Since F ha...

Q: a sample of 0.2952 g iron ore is dissolved in acid, and the iron is converted to Fe2+. the sample is...

A: The ratio of mass of iron to the mass of sample multiply by 100 is known as percentage of iron.