EstersMany naturally occurring esters are responsible for the pleasant, characteristic smells of various fruits. As a result,synthetic esters are commonly made for use in perfumes and artificial flavours.To produce a synthetic ester with a specific smell, chemists research what ester will give them the specific smell they areinterested in and then they work "backwards" to design a chemical reaction pathway to produce the desired ester usingcommonly available chemicals.Esters are commonly produced by reacting a carboxylic acid with an alcohol, if the required carboxylic acid and alcoholare not commonly available, chemists have to use a multi-step chemical reaction pathway to first produce the carboxylicacid and/or alcohol, and then produce the desired ester.1. Show the condensation reactions between the following carboxylic acids and alcohols using the structural formulas ofthe reactants and products. Name the final ester product.*draw your structures so the functional groups "line up" and circle the water that is being removeda.namesC.structuralformulasb. names.structuralformulasnamesStructuralformulasd. namesStructuralformulasReactantsbutanoic acid + ethanol →butanoic acid + pentan-1-ol →ethanoic acid + propan-2-ol →ethanoic acid + octan-1-olProduct

Answered: Image /qna-images/answer/2ae3f772-ba15-4e6b-a1a4-b9e4c7b3b484.jpg

the reactants and products. Name the final ester product. *draw your structures so the functional groups "line up" and circle the water that is being removed a. names C. structural formulas b. names structural formulas names Structural formulas d. names Structural formulas Reactants butanoic acid + ethanol → butanoic acid + pentan-1-ol ethanoic acid + propan-2-ol ethanoic acid + octan-1-ol Product

the reactants and products. Name the final ester product. *draw your structures so the functional groups "line up" and circle the water that is being removed a. names C. structural formulas b. names structural formulas names Structural formulas d. names Structural formulas Reactants butanoic acid + ethanol → butanoic acid + pentan-1-ol ethanoic acid + propan-2-ol ethanoic acid + octan-1-ol Product

Introduction to General, Organic and Biochemistry

11th Edition

ISBN:9781285869759

Author:Frederick A. Bettelheim, William H. Brown, Mary K. Campbell, Shawn O. Farrell, Omar Torres

Publisher:Frederick A. Bettelheim, William H. Brown, Mary K. Campbell, Shawn O. Farrell, Omar Torres

Chapter18: Carboxylic Acids

Section: Chapter Questions

Problem 18.54P

See similar textbooks

Similar questions

Upon completion of a chemical reaction, you find you have a mixture of benzoic acid and ethyl benzoate. Propose a procedure to separate the ethyl benzoate from the mixture. You should look up the structures of benzoic acid and ethyl benzoate.
Ethyl butyrate, CH3CH2CH2CO2CH2CH3CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring. It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) Part A Given 7.30 gg of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100%% yield? Express your answer in grams to three significant figures. Part B A chemist ran the reaction and obtained 5.95 gg of ethyl butyrate. What was the percent yield? Express your answer as a percent to three significant figures. Part C The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0%% yield. How many grams would be produced from 7.30 gg of…
Ethyl butyrate, CH3CH2CH2CO2CH2CH3CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring. It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) Given 8.45 gg of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100%% yield? Express your answer in grams to three significant figures. A chemist ran the reaction and obtained 5.50 gg of ethyl butyrate. What was the percent yield? Express your answer as a percent to three significant figures. The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0%% yield. How many grams would be produced from 8.45 gg of butanoic acid and excess…
Ethyl butyrate, CH3CH2CH2CO2CH2CH3CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring. It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l)CH3CH2CH2CO2H(l)+CH2CH3OH(l)⟶H+CH3CH2CH2CO2CH2CH3(l)+H2O(l) A chemist ran the reaction and obtained 5.40 g of ethyl butyrate. What was the percent yield, The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0% yield. How many grams would be produced from 7.45g of butanoic acid and excess ethanol?
Following ester (methyl benzoate) was hydrolyzed in presence of an acid catalyst. This reaction produces --- and ---. Question 28 options: benzoic acid, ethanol benzoic acid, water acetic acid, benzene benzoic acid, methanol
True or False:1. When isopropyl alcohol reacts with HCl, the resulting product is 2-chloropropane2. Nucleophilic molecules are electron-rich molecules that can "attack" electron deficient molecules3. Based on the physical property, hydroquinone has a lower boiling point compared to catechol
A student is given a mixture of benzoic acid, 3-nitroaniline and naphthalene to separate. The student dissolves the mixture in an organic solvent and adds NaOH to the solution. Two layers form. Which component(s) of the mixture remain in the organic solvent? Group of answer choices Benzoic acid and Naphthalene 3-Nitroaniline and naphthalene 3-Nitroaniline Naphthalene
Q1) What colors are the various forms of polyphenols when they are protonated vs deprotonated? Q2) How does the equilibrium shift when HCl is added to the equilibrium reaction? Q3) Chemically speaking, what causes the color change when sodium hydroxide (NaOH) is added to the system?
Provide reagents
A chemist wants to make an ester from conversion of alcohol or phenol, what can he used? a. benzamide b. acetic anhydride c. maleic anhydrate d. none
Can an ester be synthesized from a carboxylic acid and alcohol in a 3 M sodium hydroxide solution? a. Yes, esters are synthesized in acid b. Yes, esters are synthesized in base c. No, esters are synthesized in base d. No, esters are synthesized in acid
TRUE OR FALSE. The hydrolysis of an ester can also be catalyzed by the presence of a strong base. The base-catalyzed hydrolysis of an ester is called saponification. TRUE OR FALSE. Hydrolysis is a reaction in which a bond is broken by the addition of a water molecule without the presence of heat. TRUE OR FALSE. Esterification is a condensation reaction.