Express your answer as a balanced chemical equation. Identify all of the phases in your answer.

Q: ZnO(s) Zn(1) + O2 (g) Express your answer as a chemical equation. Identify all of the phases in your…

A: Given :-  ZnO(s) + ∆ → Zn(l) + O2(g)  To balance :-  Given equation

Q: AI-Si Eutectic, Calculate the mass fraction of the B phase, silicon, given a sample with 61.8 wt%…

A:

Q: Pb(NO3)2(aq) + 2KCl(aq) Express your answer as a balanced chemical equation. Identify all of the…

A: Given,

Q: From the following compounds, which of the following has the highest Solubility in Water? From the…

A: Alcohols are the compound containing the OH group. Due to their polar nature, they are highly…

Q: The normal boiling point of water is Group of answer choices none of these 32°F 0°F 373 K 273 K

A:

Q: Pb(NO3)2(aq) + 2KC1(ag) Express your answer as a balanced chemical equation. Identify all of the…

A: In general chemical reaction are written in equation form In a chemical equation left side…

Q: When potassium sulfite dissolves in water, the sulfite ion SO2−3 acts as a base. Write a balanced…

A: The equation containing identical number of species reacting as well as species produced and their…

Q: What is the Simpliest form of substance

A: What is the Simpliest form of substance

Q: a) For Mn3+, write an equation that shows how the cation acts as an acid. Express your answer as a…

A: According to Arrhenius acid theory ‘acid is that chemical compound which increases the concentration…

Q: In which do we find only attractions between ions?   a) AsH3 b) CuCl2 c) Cl2 d) NO2 e) CaO f) NaNO3…

A:

Q: how would you account for the difference in the viscosity of different liquids 3. discuss the…

A: Introduction :  Viscosity can be defined as the property of a fluid by virtue of which it offers…

Q: Ca(OH)2 (aq) + HNO3 (aq) → H2O(1) + Ca(NO3)2 (aq) Express your answer as a chemical equation.…

A: In this question, we have to find out the correct answer of given problem by the help of the…

Q: HF(aq)HF(aq) and Ba(OH)2(aq)Ba(OH)2(aq) Express your answer as a balanced chemical equation.…

A: Given, HF(aq) and Ba(OH)2(aq)

Q: C5H6O(l)+O2(g)→CO2(g)+H2O(g)C5H6O(l)+O2(g)→CO2(g)+H2O(g) Express your answer as a balanced chemical…

A: Chemical equation is the representation of a chemical reaction, in which the reactants and products…

Q: How do you explain the statement: copper can contain up to 40% Zn and still be single phase?

A:

Q: H3PO4(aq)+Sr(OH)2(aq)→ Express your answer as a chemical equation. Identify all of the phases in…

A: We are given incomplete reactions we have to complete and balance the chemical reactions.

Q: HCI(ag) + Mg(s)¬MgCl2(aq) + H2(9) Express your answer as a chemical equation. Identify all of the…

A:

Q: Cite some possible applications of determining the melting point of a substance. Explain briefly

A: In addition to that, melting point is often used to predict the partition behavior of a chemical…

Q: Question attached

A: Acid react with a base to form salt and water.

Q: Briefly explain the difference between particle and crystal size

A: One of the four basic states of matter is solid. A solid's molecules are densely packed together and…

Q: Write the ions present in solution of Sn(NO2)4. Express your answers as chemical formulas separated…

A: Answer - According to the question - Given - the ions present in solution of  Sn(NO2)4.  Sn(NO2)4…

Q: How can we describe a single-phase material?

A: Single phase material is the material contains only one phase .

Q: An example of Eutectic mixture, the freezing point of water is depressed by addition of inorganic…

A: Freezing point is defined as the temperature at which a liquid becomes a solid at normal atmospheric…

Q: Define cohesion and adhesion, and how they can predict capillary action.

A: Adhesion can be defined as the sticking tendency of particles of different types of material.…

Q: Nitrogen is heated with oxygen to form dinitrogen trioxide gas. Express your answer as a chemical…

A: Chemical reactions are written in equation form in this equation reacants left side and products are…

Q: HCl(aq)+Ba(OH)2(aq)→  Express your answer as a chemical equation. Identify all of the phases in your…

A:

Q: the mean type of alumina phase uesd as biomaterials is O Alpha phase O Beta phase O Camma phase O…

A: Moumita is very much useful in biomedical purposes .

Q: CaCl2(aq)+Na3PO4(aq)→Ca3(PO4)2(s)+NaCl(aq)CaCl2(aq)+Na3PO4(aq)→Ca3(PO4)2(s)+NaCl(aq) Express your…

A: When an aqueous solution of calcium chloride and an aqueous solution of sodium phosphate are mixed,…

Q: H20 N Oven H&0,N2 90°C latm 130°C 9.6atn

A:

Q: NH4NO3(s)→N2O(g)+H2O(l)NH4NO3(s)→N2O(g)+H2O(l) Express your answer as a balanced chemical equation.…

A: Chemical equation is the representation of a chemical reaction, in which the reactants and products…

Q: After performing an experiment to know if the ice cubes will sink or float in two separate jars…

A: An experiment was performed to know wheather the ice cubes will sink or float in two separate jars…

Q: Is there a difference between the melting point and the freezing point of a pure substance in a…

A: Melting point is the temperature at which a solid substance gets converted into its liquid state at…

Q: K2O(s)+H2O(l)→KOH(aq)K2O(s)+H2O(l)→KOH(aq) Express your answer as a balanced chemical equation.…

A: The given unbalanced chemical equation is represented as follows:

Q: Al(s) + Cl2 (g)→AlCl3 (s) Express your answer as a chemical equation. Identify all of the phases in…

A: 2 Al(s) +3 Cl2 (g) -------> 2 AlCl3 (s)

Q: HClO4(aq)+NaOH(aq)→ Express your answer as a chemical equation. Identify all of the phases in your…

A: The acid react with base to form salt and water , called as neutralization reaction.

Q: Write a balanced equation for the complete combustion of solid palmitic acid. Use H2 O(1) in the…

A: A balanced chemical is equation has equal numbers of atoms for each element involved in the reaction…

Q: Organic molecules change phases above 300°C. O True O False

A: Organic molecule chnges phases

Q: Write the ions present in solution of Sn(NO2)4. Express your answers as chemical formulas separated…

A: Write the ions present in solution of Sn(NO2)4. Write the ions present in solution of NaHCO3. Write…

Q: A 1. Stoichiometry 2. Spikes 3. Ferromagnetism 4. Colloid 5. Hole 6. Nanoparticle 7. Empirical…

A: To match the following .,

Q: Fe(s)+S8(s)→Fe2S3(s) Express your answer as a chemical equation. Identify all of the phases in your…

A: The given unbalanced equation is : Fe(s) + S8(s) → Fe2S3(s)

Q: In a distillation process, a sudden formation of vapor might happen when heat is concentrated in one…

A: “Since you have asked multiple question, we will solve the first question for you. If you want any…

Q: Ca(s)+Br2(l)⟶CaBr2(s)  Express your answer as a chemical equation. Identify all of the phases in…

A: The equation is already balanced, so the answer is:Ca(s)+Br2(l)⟶CaBr2(s) As the number of atoms are…

Q: Human cells obtain energy from a reaction called cellular respiration. Balance the skeletal equation…

A: Given, Human cells obtain energy from a reaction called cellular respiration. The skeletal equation…

Q: Mg(s) + Br2 (1) → MgBr2 (s) Express your answer as a chemical equation. Identify all of the phases…

A: The given reaction is,

Q: Na(s)+H2O(l)→NaOH(aq)+H2(g)Na(s)+H2O(l)→NaOH(aq)+H2(g) Express your answer as a chemical equation.…

A:

Q: TiO2 (s) Tỉ" (aq) (acidic solution) Express your answer as a chemical equation. Identify all of the…

A: