Find the exact value of Sin 20 given that 28 and e is in quadrant I. CosO =- 53 Sin 20=

Q: Find the exact values of sin(2æ), cos(2æ) and tan(2æ) without solving for æ. 2 and æ is in quadrant…

A:

Q: Find sin(즐), cos(즐). () co) COS from the given information. cot(x) = 8, 180° < x < 270° %3D sin COS…

A:

Q: Use the given point on the terminal side of angle 0 to find indicated. 15) sin 0 (-V13, 6)

A:

Q: If sin(x) = (in Quadrant-I), find 6. sin(2æ) = %3D

A: Given equation is: sinx=56 ; (x lies in Quadrant-I) We will use the following identities: (1) cos x…

Q: Find the exact value of cosine alphacos α​, given that sine alpha equals sin α=5/12 and alphaα is in…

A: Given:

Q: If sin θ = 5/13 and θ, lies in quadrant II, find the exact value of cos 2θ.

A:

Q: Find the exact values of sin 20, cos 20, tan 20 and the quadrant in which 20 lies. tan 0=,0 is in…

A:

Q: If cos(0) : 2 and 0 is in the 2nd quadrant, find sin(0) 7 sin(8) =

A:

Q: Use the given information to find the exact value of the expression. cos θ = 15/17, θ lies in…

A: Answer(a)

Q: 8. and If sin a =- 17 cos ß = for a second-quadrant angle a and a third-quadrant angle ß, find the…

A: solution is given below..

Q: Given that sine 3/5 ande lies in quadrant II, find the following value. %3D tane 3/4 -3/4 -4/3

A:

Q: Determine the exact values of sin 0 and cos 0 given that the terminal side of angle 0 intersects the…

A:

Q: Find the quadrant in which θ lies: (a) sinθ0 (b) cosθ>0andcscθ>0

A: Part aIf sin(θ) &gt; 0 then θ may lies in the 1st quadrant or 2nd quadrant.If sin(θ) &lt; 0 then θ…

Q: What is the value of sin 30+ cos 30

A:

Q: Use the given information to find the exact value of the expression. (3 points) 5 3 3) tan a =- 12 ,…

A: Given thattanα=512, cosβ=-35we have to calcualte…

Q: If cos(0) = sin(0) = - 1 and is in quadrant III, find the exact value of sin(0). 9

A:

Q: Find the values of sin 0, cos 0, and tan 0 for the given right triangle. Give the exact values. sin…

A:

Q: If sin θ = 4 / 5 and θ is in quadrant II, then cos θ =

A: We know that in the second quadrant, sine is positive and cosine is negative. Also, sin2x+cos2x=1.

Q: If sin 8 = - and e terminates in Quadrant IV, what is the value of sec 8 tan 8? (a) –2v3 (b) - (1) -

A: We know

Q: If sin 0 ==, 0 in quadrant II, find the exact value of 51 a) cos 0 (b) sin 0+ - (c) cos 0 (d) tan -…

A:

Q: If cose =- and 0 is in Quadrant II, find the exact value of sin20 %3D 3.

A:

Q: 3. Use a calculator to find an approximate degree angle measure rounded to the nearest 100th. a) sin…

A: The values are given as sin-10.854=58.64o cos-123=48.18o

Q: Suppose that sin α = 4/5 for a quadrant II angle α and sin β = 1/2 for a quadrant I angle β. Find…

A: Given that,  sinβ=12 Since in quadrant I, sine and cosine are positive. And,…

Q: If tan β = 4/3 and β is in the third quadrant, find exact values for sin β and cos β

A:

Q: Find the exact value of tan 0, given that the sin 0 and angle 3 quadrant IV.

A: Given that, sinθ=-53 We have to find the value of θ and θ is in 4th quadrant.

Q: Given that sin find the exact expression for the indicated quantity. Зл sin 8

A: Given that : sinπ8=2-22 We need to find the exact value of sin3π8. sin3π8=sinπ2-π8…

Q: sin- cos 3

A:

Q: exact

A: Given sinA=(3)/(5) and cosB=(12)/(13)  both are lie  in quadrant 1 To find the exact value of…

Q: 2. If tan 0 =, 0 E Q II, find the other five trigonometric functions. %3D

A:

Q: Use the given information to find the exact value of the expression. sin θ = 15/17, θ lies in…

A:

Q: Find the exact value of sine α​, given that cosine alpha equals cos α=− 6/11 and α is in quadrant…

A: Given, value of cosine in quadrant II. The value of cosine is negative in quadrant II

Q: Find the signs of the six trigonometric function values for the given angle. 18° .... sin 18° is cos…

A:

Q: Use an appropriate compound angle formula to express as a single trig function. Then evaluate the…

A: We know that  Sin(A-B)=sinAcosB-cosAsinB  Sin(7π/5)cos(π/15)-cos(7π/5)sin(π/15)

Q: If tan 0 > 0 and cos 0 < 0, what Quadrant is Point (0) or P(0) located?

A: Given that tanθ&gt;0  and  cosθ&lt;0

Q: Use the definitions of the trigonometric ratios to find the value of sin45°, cos45°cos⁡45°, and…

A: Explanation of the solution is given below...

Q: Find the quadrant in which 0 lies from the information given. sin(0) < 0 and cos(0) < 0

A: By checking the values of trigonometric functions in quadrant we can conclude the following data.

Q: 14. If sin 0 :- and e is in quadrant III, find tan 5 2

A:

Q: Find the values of sin 8, cos 8, and tan e for the given right triangle. Give the exact values. sin…

A:

Q: Find the exact values of the six trigonometric functions of the angle. 1305° sin 1305° cos 1305° =…

A:

Q: if sin(0)=-7/25 with 0 quadrant IV, what is cos(0)?

A: Given

Q: Find tan (θ) given that sin (θ) = 1/3 and θ is in quadrant II.

A:

Q: The angle of elevation to the top of a mountain in Muscat is found to be 45° from the ground at a…

A:

Q: Find the values of sin 0, cos 8, and tan 0 for the given right triangle. Give the exact values sin e…

A: As we know that the trigonometric ratio;…

Q: A. llustrate then find the values of sin 8, cos 8, and tan 8 and write your answer in 2 decimal…

A:

Q: If cos(@) and 0 is in the 1st quadrant, find sin(0) %3D sin(@) = %3D

A: In first quadrant all the trigonometric ratios are positive. Therefore sine is also positive.

Q: If cos(@) 13 with 0 in Quadrant I, what is sin(8)? 18 %3D sin(0) = %3D

A: Given that cosθ=1318 and θlies in first quadrant.

Q: It is known that sin A =, where < A < n, and cos B = n< B < . Find the exact values of: where 13 3x…

A: Given that, sinA=35,π2&lt;A&lt;πcosA=-513,π&lt;B&lt;3π2

Q: If sin θ = 4/5 and θ lies in quadrant II, find the exact value of tan 2θ.

A: Given:sinθ=45tan 2θ=?

Q: Suppose that sin α = 12/13 for a quadrant II angle α and sin β = 3/5 for a quadrant I angle β. Find…

A: Since it is given that sin α=1213  for quadrant II angle α and sin (β)=35for a quadrant I angle…

Equations and Inequations

Equations and inequalities describe the relationship between two mathematical expressions.

Linear Functions

A linear function can just be a constant, or it can be the constant multiplied with the variable like x or y. If the variables are of the form, x2, x1/2 or y2 it is not linear. The exponent over the variables should always be 1.