For the following reaction, 12.9 grams of chlorine gas are allowed to react with 57.6 grams of sodium iodide chlorine(g) sodium iodide(s) sodium chloride(s)+ iodine(s) What is the maximum amount of sodium chloride that can be formed? grams What is the FORMULA for the limiting reagent? What amount of the excess reagent remains after the reaction is complete? grams

For the following reaction, 12.9 grams of chlorine gas are allowed to react with 57.6 grams of sodium iodide chlorine(g) sodium iodide(s) sodium chloride(s)+ iodine(s) What is the maximum amount of sodium chloride that can be formed? grams What is the FORMULA for the limiting reagent? What amount of the excess reagent remains after the reaction is complete? grams

Chemistry

9th Edition

ISBN:9781133611097

Author:Steven S. Zumdahl

Publisher:Steven S. Zumdahl

Chapter3: Stoichiometry

Section: Chapter Questions

Problem 145AE: A potential fuel for rockets is a combination of B5H9 and 0 2. The two react according to the...

See similar textbooks

Similar questions

You react nitrogen and hydrogen in a container to produce ammonia, NH3(g). The following figure depicts the contents of the container after the reaction is complete. a Write a balanced chemical equation for the reaction. b What is the limiting reactant? c How many molecules of the limiting reactant would you need to add to the container in order to have a complete reaction (convert all reactants to products)?
Consider the following unbalanced chemical equation for the combustion of pentane (C5H12): C5H12(l)+O2(g)CO2(g)+H2O(l) If 20.4 g of pentane are burned in excess oxygen, what mass of water can be produced, assuming 100% yield?
4.69 The pictures below show a molecular-scale view of a chemical reaction between H2 and CO to produce methanol, CH3OH. The box on the left represents the reactants at the instant of mixing, and the box on the right shows what is left once the reaction has gone to completion. Was there a limiting reactant in this reaction? If so, what was it? Write a balanced chemical equation for this reaction. As usual, your equation should use the smallest possible whole number coefficients for all substances.
Copper(II) sulfate has been used extensively as a fungicide (kills fungus) and herbicide (kills plants). Copper(II) sulfate can be prepared in the laboratory by reaction of copper(II) oxide with sulfuric acid. The unbalanced equation is :math>CuO(s)+H2SO4(aq)CuSO4(aq)+H2O(l) 2.49 g of copper(II) oxide is treated with 5.05 g of pure sulfuric acid, which reactant would limit the quantity of copper(II) sulfate that could be produced?
Urea is used as a fertilizer because it can react with water to release ammonia, which provides nitrogen to plants. (NH2)2CO(s) + H2O() 2 NH3(aq) + CO2(g) (a) When 300. g urea and 100. g water are combined, calculate the mass of ammonia and the mass of carbon dioxide that form. (b) Calculate the mass of the excess reactant that remains after reaction.
For the chemical reaction C3H8O2+4O23CO2+4H2O how many product molecules are formed when nine C3H8O2 molecules react?
3.105 Nitric acid is often sold and transported as a concentrated 16 M aqueous solution. How many gallons of such a solution would be needed to contain the roughly 2.1109 pounds of HNO3 produced annually in the United States?
Sulfur dioxide gas reacts with sodium hydroxide to form sodium sulfite and water. The unbalanced chemical equation for this reaction is given below: SO2(g)+NaOH(s)Na2SO3(s)+H2O(l) Assuming you react 38.3 g sulfur dioxide with 32.8 g sodium hydroxide and assuming that the reaction goes to completion, calculate the mass of each product formed.
3.75 The following pictures show a molecular-scale view of a chemical reaction between the compounds AB2 and B2. (A atoms are shown in blue and B atoms in white). The box on the left represents the reactants at the instant of mixing, and the box on the right shows what is left once the reac- tion has gone to completion. Write a balanced chemical equation for this reaction. As usual, your equation should use the smallest possible whole number coefficients for all substances.
A potential fuel for rockets is a combination of B5H9 and 0 2. The two react according to the following balanced equation: 2B5H9(l)+12O2(g)5B2O3(s)+9H2O(g) If one tank in a rocket holds 126 g B5H9 and another tank holds 192 g O2, what mass of water can be produced when the entire contents of each tank react together?