give any one saponification reaction.

Q: Give the IUPAC name for the major product of the following reaction.

A:

Q: Write IUPAC name of the major product formed as a result of the reaction indicated CH3 H* + H,0 ?

A:

Q: Identify reagents that can be used to

A:

Q: what alcohol will hexene form if it undergoes hydration

A: Let us assume that the hexene is 1-hexene , where the double bond is between 1st and 2nd carbons The…

Q: How do you convert Phenol to salicylaldehyde, Name the reaction and Explain with Complete step by…

A: When phenols are treated with CHCl3 i.e chloroform in presence of sodium hydroxide , it results in…

Q: Ethyl butyrate, CH3CH2CH2CO2CH2CH3CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in…

A: % Yield of the reaction is a measure of reaction efficiency in terms of the amount of product formed…

Q: Show how the reactant can be converted to the product in two steps.

A: The given conversion is an example of pericyclic reactions.  It is a [3,3] sigmatropic rearrangement…

Q: Bitter taste, slippery feel, and the ability to turm red litmus paper blue.     hydrochoric acid…

A: Bitter taste and turn red litmus into blue.is the base

Q: • Table of Reagents: Chemical's Molecular weight (g/mol) Chemical structure Physical stat name…

A:

Q: Write IUPAC name of the major product formed as a result of the reaction indicated CH3 H3C H* + H20

A:

Q: give an example of a reduction reaction with hexanal

A: Reduction means the addition of hydrogen or removal of oxygen. In terms of electrons, it may be…

Q: Draw the structure of ascorbic acid and dehydroxyascorbic acid. Identify (by circling) exactly the…

A: The answer is given in below image:

Q: Ethyl butyrate, CH3CH2CH2CO2CH2CH3CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in…

A: Given Chemical reaction: CH3CH2CH2CO2H(l)+CH2CH3OH(l)⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) Mass of butanoic…

Q: Question 45 Provide the reagents necessary to carry out the following conversion. CI

A:

Q: An intoruduction to carbonyl and ketones

A: Aldehydes and ketones as carbonyl compounds.

Q: Explain Addition of Alcohols—Acetal Formation ?

A: Acetals are derivatives of aldehydes or ketons  They have the common formula R2C(OR')2 . The…

Q: A A = B = C = D = 2 Li pentane 11 B Cul C + D Ether. Heptare

A: The above given reaction sequences are of Corey-House synthesis reaction of alkane. At first, an…

Q: Define Elimination Reactions ?

A: SOLUTION: Step 1: Elimination reaction, any of a class of organic chemical reactions in which a pair…

Q: Define the below statement ? Benzene's six π electrons make it electron rich, so it reacts…

A: Aromatic compounds are the organic compounds with delocalized pi-electrons. Benzene is the simplest…

Q: complete this reaction

A:

Q: Draw the structure of the product formed in the reaction.

A:

Q: To obtain the specified product, what reagents should be reacted with the reactant?

A: In the given reaction the acid bromide reacts with a specific reducing agent and is reduced into an…

Q: 3. Draw the structure and provide the name of the products from following saponification: Кон

A:

Q: What reagents could be used to reduce the nitro group ?

A: The given reaction is represented as follows:

Q: Acetic Acid.

A:

Q: give me some example of drug synthesis that are obtained from name reaction

A: Synthesis of drug:

Q: Give 2 different one-step methods to convert propanoic acid to methyl propanoate.

A: Here we are required to show two different method to synthesize methyl propanoate

Q: Determine in the missing reagents needed to complete each reaction:

A: Many organic reactions uses different regents to cause the desired transformation. Organic reagents…

Q: ОН Li

A: In this particular synthesis the step first will be the carbolithiation reaction, that is…

Q: Give the major product for the reaction. OH, Heat

A: In the given reaction, at first OH- will abstract a proton. Then the anionic end will attack at the…

Q: Rank the following in order of decreasing solubility in benzene.   gallic acid ethyl benzene…

A:

Q: A reaction of a particular B-dicarbonyl compound that gives substituted or disubstituted acetic…

A:

Q: What is the correct reagent?

A: In this question, we want to identify which Reagent will give final ketone Product. How we can…

Q: Give the structure corresponding to each name octyl butanoate

A: Given name,      Octyl butanoate

Q: Select and arrange the reagents to complete the following conversion.

A: Reaction involving organic compounds are called organic reactions.  Organic reactions are of…

Q: Label each reaction as an oxidation, reduction, elimination or substitution reaction.

A:

Q: Refer to reaction sequence below then answer the following question: oxidation CH,OH oxidtion The…

A: The oxidation of alcohol depends on the number of hydrogen atoms attached to the carbon atom that…

Q: Write IUPAC name of the major product formed as a result of the reaction indicated CH3 H3C Ni + H2

A: The reaction given is,

Q: Br, 2NH, (а)

A:

Q: Ethyl butyrate, CH3 CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food…

A: Theoretical yield :- The maximum amount of product that can be obtained when reactants undergo…

Q: stepwise mechanism for this process. The reaction involves a carbocation intermediate.

A: Given reaction:

Q: draw butylammonium bromide

A: Molecular Formula of butyl ammonium bromide is C4H12BrN Chemical Formula of a butyl ammonium bromide…

Q: could you synthesize isopropyl propyl ether, using isopropyl alcohol as the only carbon-containing…

A: The product is Isopropyl propyl ether.

Q: organic synthesis of Terephthalic acid

A: Synthesis of Terephthalic acid ?

Q: How much acetone is required for the reaction?

A: Given: Moles of cyclohexene = 6 mmol = 0.006 mol Molarity of cyclohexene = 1 M Volume of flask = 125…

Q: Explain nucleophilic substitution to form an aldehyde ?

A: Explain nucleophilic addition to the aldehyde to form an alcohol.

Q: When pentanal and ethanol are reacted in an acetal formation reaction in the presence of acid…

A:

Q: Give a clear explanation handwritten answer....Give the IUPAC name of given bleow structure....?

A: