Give the IUPAC name and a common name for the following ether  CH3-CH2-O-CH2-CH2-CH3 CH3-O-CH3

Q: Give both the IUPAC name and the common name for each alcohol. (CH3)2CHCH2CH2OH

A: Given, (CH3)2CHCH2CH2OH

Q: Provide the IUPAC and common name for the ether shown here:

A: The IUPAC name of the ether is given as alkoxyalkane where alkoxy group represents the oxygen atom…

Q: I. Give the IUPAC and common names of the following ethers. Common Name IUPAC Name 1. H3C CH3 CH3 to…

A: Given compounds are :

Q: 11. CH;CHCH3 CH2-CH2-OH What is the IUPAC name for the above? O 1-hydroxy-3-methylbutane O…

A: IUPAC nomenclature is used for naming the organic compounds as recommended by international union of…

Q: Give the IUPAC name for each compound. CH3 a. CH,CHCH-C CHO b. CH3 H CH2CH3

A: The IUPAC name of the compound has to be provided.

Q: Assign an IUPAC name to each of the following esters. a. CH3-CH2-CH2-C-0-CH2-CH3 b.…

A:

Q: Give the IUPAC name of each alcohol.

A:

Q: Name the IUPAC name or common name for the following ether: CH3-CH2-O-CH2-CH2-CH3

A: The compound given can be expanded as

Q: PAC name to each of the following ethers

A:

Q: Give the IUPAC and common names of an aldehyde, ketones, ethers that have 1. 3 Carbon atoms: 2. 2…

A: In this question, IUPAC name and common names of aldehyde, ketones, and ethers carrying 2 carbons…

Q: What is the common name of the following alkyl substituent? H. H3C. .CH3 A) butyl B) sec-butyl C)…

A:

Q: The IUPAC name of CH3-O-CH2-CH2-CH2-CH3 is ---.     Question 26 options:   butyl pentyl ether…

A: The IUPAC name of CH3-O-CH2-CH2-CH2-CH3 is

Q: Give the IUPAC name for each compound. CH3 CH2CH3 Br a. PHCH(CH3)2 b. С. d.

A: Since you have posted multiple sub-parts, the answer for first three sub-parts are given below.…

Q: What is the IUPAC name for the compound shown? CH3 -CH3 compound name:

A: Using IUPAC rules for nomenclature we can name given molecule.

Q: Draw the eight constitutional isomers with molecular formula C5H120 that contain an OH group. Give…

A: The eight constitutional isomers with molecular formula C5H12O contain the OH group and the IUPAC…

Q: Give a systematic (IUPAC) name for each diol.(a) CH3CH(OH)(CH2)4CH(OH)C(CH3)3

A: Given chemical formula, (a) CH3CH(OH)(CH2)4CH(OH)C(CH3)3

Q: Provide IUPAC names for each structure below H. CH3 H H.

A: The IUPAC (International Union of Pure and Applied Chemistry) nomenclature is used to names the…

Q: What is the IUPAC name for the following compound? cyclohexyl ethyl ether ethyl cyclohexyl ether…

A:

Q: What is the IUPAC name for the following compound? CH CH-CH=CH-CHCH-CH-CH

A:

Q: 4. Name each compound according to the IUPAC system. CH₂=CCH₂CH, I CH, a. b. C. CH₂CH=CHCH₂CHCH₂CH,…

A:

Q: Он CH3 -CH2-CH-CH2-CH-COOH

A: First, gives the numbering to the long carbon chain from the functional group. Write the functional…

Q: 2. Lycopene is a bright red carotenoid hydrocarbon found in tomatoes and other red fruits and…

A: Answer  Carotenoids are plant pigment responsible for bright red…

Q: Name the following alcohols utilizing the IUPAC nomenclature rules a. CH3 CH3-CH2-C–CH2–CH2-CH3 ОН…

A: Since you have posted a question with multiple sub-parts, we will solve the first three sub-parts…

Q: CH3 CH2 CH3 CH CH2 Provide the IUPAC name of the compound. Parent name: Substituents: Locants: IUPAC…

A:

Q: Write the IUPAC name for the below compound: (A) dicyclohexyl ether (B) cyclohexoxycyclohexane (C)…

A: In the naming of ether, when both the alkyl groups are same, we write the name of ether as dialkyl…

Q: Provide the IUPAC and common name for the ether shown:

A: (IUPAC)  - full form is The International Union of Pure and Applied Chemistry. it is a method of…

Q: What is the correct IUPAC name for the following structure: CHCH

A: The IUPAC name of the structure has to be given. The given structure is CHCH.

Q: Name the following alcohol either using IUPAC or common names:

A: Given,

Q: Write down the IUPAC name of the structure shown. NH2 CH3 CH3

A: Naming of a compound is done according to international rules set up by IUPAC

Q: Give the IUPAC name for each of the following compounds: 1. Br a) (CH3);C-COOH b) CH;-ĊH-CH,-COOH…

A: a) b)

Q: 3) What is the IUPAC name of the following alcohol? A) trans-4-methylcyclohexanol B)…

A: In the question , a diagram of an organic compound is given and it is asked in the question to give…

Q: Write the IUPAC name and any common name for each of the following ethers: a. CH;-CH,-CH2-0-CH,-CH3…

A: These compounds are ethers. They are named by the IUPAC or common systems. The IUPAC name is…

Q: 1. Give the IUPAC name for each compound a. CH,=CHCH,CH,CICH, CH, CH, (CH,CHC=CHCHCH CHCH, b…

A: The bond line structures of the above compounds can be written as: a. b. c.

Q: Give the IUPAC name for each of the following compounds: 1. Br a) (CH3);C-COOH b) CH,-СH-CH,-соОН…

A:

Q: 4. What is the IUPAC name of the following compound? CH3-CH-CEC-CH2-CH-CH3 CH3-CH2 CH2-CH3 (a)…

A: The given compound is an alkyne. The IUPAC name of alkynes end with a suffix "-yne".

Q: I: Assign an IUPAC name to each of the following compounds: 1. CH3-C-O- C-CH2-CH3 2.…

A:

Q: Give both the IUPAC name and the common name for each alcohol.(a) CH3CH2CH(OH)CH3

A: In IUPAC system, the naming of alcohol is done by adding the suffix -ol with the name of the parent…

Q: 1. Give the IUPAC name for each of the following: a. CH3-CH2-CH2-C-OH | b. CH3-CH2-C-0-CH2-CH3 c.…

A: give Numbering to the longest carbon chain then Write name.

Q: он он 8. a 9. 10. ÓCH,CH,CH, 11.

A:

Q: CH3-CH(CH3)-CH2-CH2-CHO

A: The standard nomenclature in organic chemistry is given by IUPAC which assigns chemical names to the…

Q: The correct IUPAC name for this compound is It may help to draw the complete Lewis Structure. он…

A: The given compound, belongs to the alcohol family due to the presence of (OH) group. On…

Q: CH-CH,-CI

A: In this given compound there are three carbon two carbon atoms and five hydrogen atoms attached on…

Q: What is the IUPAC name for the following compaund? CH3 CH;CH,OCOCH,CH3 ÓCH-CH3

A: In organic chemistry IUPAC nomenclature is a method of assigning names to the organic compounds…

Q: Write IUPAC and common names for   ethers.

A: Ethers are compounds containing an oxygen atom bonded to two carbon atoms via single covalent bonds.…

Q: What is the IUPAC name of CH3CH(CI)CH,CH,CH(OH)CH3? A 5-Chloropentan-2-ol B 5-Chlorohexan-2-ol C…

A:

Q: CH3 CH;CH2-Ċ-CH,CH,CH; CH:

A: Introduction :  IUPAC nomenclature of organic compounds refers to the systematic approach taken for…

Q: Write the IUPAC names for these alcohols. a. но но ČH3 b. OH ČH3 C. H3C. HO Br d. H. Br HO

A: Given compounds are : Write the IUPAC names of the given compounds = ?

Q: 7. JOjea 8. 10 11.1 12 13 I 14 16 1 17 18 II. B- Assign IUPAC name to each of the following…

A: For naming of alcohol select the longest possible chain of carbon and for alcohol suffix 'ol' is…

Q: Be sure to answer all parts. Draw the structure corresponding to each IUPAC name. a.…

A: The structure of an organic compound is written in the following steps: Determine the number of…

Q: CH;C=CCHCH3 CH,CH,CH3

A: Introduction: IUPAC nomenclature: IUPAC stands for International Union of Pure and Applied…