Give the systematic name for the followingcoordination compound or complex ion:NCNH3 Give the systematic name for the followingcoordination compound or complex ion:CIFСоFCI

The naming of ligands in c-ordination compounds We know:- negative ligands end with o F- fluorido…

Answered: Give the systematic name for the…

Science

Chemistry

Give the systematic name for the following coordination compound or complex ion: HgN, NC NH3

Chemistry: Principles and Reactions

8th Edition

ISBN:9781305079373

Author:William L. Masterton, Cecile N. Hurley

Publisher:William L. Masterton, Cecile N. Hurley

Chapter19: Complex Ions

Section: Chapter Questions

Problem 10QAP

See similar textbooks

Related questions

Q: Consider the following three complexes:(Complex 1) [Co(NH3)4Br2]Cl(Complex 2)…

Q: Given the coordination compound: [MoCO3(H2O)2][Zn(CN)3OH(en)2]. what is the ligands of the…

Q: Give the systematic name for the following coordination compound: K₂[CrCO(CN)₅]

A: In the given coordination compound the cation is K+ and the anion is complex [CrCO(CN)₅]2-. The…

Q: Give the systematic name for the following coordination compound: [NiCl₄]²⁻

A: [NiCl₄]²⁻ The above coordination compound systematic name is, Tetrachloronickelate (II) ion A…

Q: Assign a systematic name to the following coordination compounds: (a) [Zn(H2O);OH]Br (b) Na[CuFal

A: In coordination compounds, after the naming of ligands, naming of central metal atom is to be done.…

Q: Give the systematic name for the following coordination compound or complex ion: [Co(NH,),Br]SO,

Q: Give the systematic name for the following coordination compou complex ion: CI \NH3 H3N NH3 CI +

Q: Name the following coordination compound below K2[NbF,] H[Mo(CO),Br;] i. ii. iii.…

A: Coordination compound have a metal ion that is bonded to ligands by coordination bonds.…

Q: Give the systematic name for the following coordination compound or complex ion: + C/ Co. H3N NH3…

A: The above isomer is cis with respect to both ligands i.e NH3 and Cl- because both ligands are at cis…

Q: Give the systematic name for the following coordination compound or complex ion: O2NI.. NH3 Pd NH3…

A: 1) Nomenclature of coordination complex It is neutral square planar coordination complex . Two…

Q: Give the systematic names for the following coordination compounds: 7. Pt(NH3)2CI4 8.…

A: Solution : A coordination complex is formed when a metal atom or ion accepts an electron from…

Q: Name the following coordination compounds A. [FeBr(NH3)2(H2O)][Cu(CN)4] B.…

A: Name: 1. diammineaquabromoiron(II) tetracyanocuprate(IV) 2.aquabromochlorothiocyanatoplatinum(III)…

Q: .a)Sketch structure, find oxidation state of Co and write name of coordination compound…

A: a) The structure of [Co(NH3)4(NO2)2]Cl The oxidation state of Co is found as follows, Therefore,…

Q: There are two isomerism in coordination complexes which are structural isomerism and…

Q: Give the systematic name for the following coordination compound: Na[Ag(CN)₂

Q: Name the following coordination compound: K3[CrF6].

A: Coordination compounds: These are complexes that have a metal centre attached to groups of atoms.…

Q: The following coordination compounds have a metal center with a +2 oxidation state EXCEPT O…

Q: Write names for the following coordination compounds: |(a) [Cd(en)Cl] |(b) KĄ[Mn(CN)6] (c)…

A: Part a: The given complex is a neutral complex. The ligands are named in alphabetical order firstly.…

Q: Write the formulas and names for the coordination isomers of[Fe(H2O)6]Cl2?

A: Coordination isomers occur when a coordinated ligand exchanges places with the uncoordinated counter…

Q: Give the systematic name for the following coordination compound or complex ion: [Co(NH₃)₅Br]SO₄

A: The given coordination compound is, [Co(NH₃)₅Br]SO₄.

Q: The compound 1,1,1-trifluoroacetylacetone (tfa) is a bidentate ligand. It forms a tetragedral…

A: 1,1,1-trifluoroacetylacetone undergoes Tautmerization from keto to enol. and this enol form reacts…

Q: Give the systematic name for the following coordination compound: NH3 C\! pt NH3 CI

A: Iupac nomenclature are excepted across world, in cis form same group is on same plane and in trans…

Q: Provide a name for the following complex ion:[Fe(NH3)6]^3+

A: Naming an inorganic complex ion.Rules to follow,Name the ligands in alphabetical order prior to…

Q: Give the systematic name for the following coordination compound or complex ion:…

A: Naming of coordination compound 1. In coordination compound always write the name of cation before…

Q: Provide formulas for the following Coordination Species. 7) chlorodinitrotriaminoplatinum (IV) ion…

A: [7.] chlorodinitrotriaminoplatinum (IV) ion The formula for the following coordination species is…

Q: Name the following coordination compounds. a. [Ni(H2O)6]SO4 b. [Cr(en)2(CN)2]Cl c. K[Pt[NH3)Cl3]…

A: Since you are posted with multiple sub-parts. As per the rule, I am answering the first three…

Q: Give the name of the following coordination compound. [Cu(NH)][PICI] Give the formula of the…

A: "To get remaining sub-parts solved please repost the complete question and mention the sub-parts to…

Q: *Each of the following coordination compounds can take on cis- or trans- configurations. For each…

A: Complex (a) has octahedral geometry, in octahedral geometry same type of ligand having 90° angle…

Q: The formula of the coordination compound is given as: [(NH (NH3)4F€ 0-Q OH Fe(NH3)4](NO3)3 Provide…

A: The name of the above compound is given below

Q: What is the coordination number for the transition metal in the following complexes? a)…

A: Coordination number : it is the total number of atoms are attached to the central atom.

Q: Give the systematic name for the following coordination compound: [Pt(NH₃)₅Cl]Br₃

A: Pentaamminechloroplatinum (IV) bromide

Q: Name the following coordination compounds and draw their structures: (i) [CoCl2(en)2]Cl . (ii)…

A: For (i) [CoCl2(en)2]Cl Dichlorobis(etane-1,2-diamine)cobalt(III)chlorine

Q: There are two isomerism in coordination complexes which are structural isomerism and…

A: Isomerism: same chemical composition but different structures called isomers and process is called…

Q: Using IUPAC norms write the formulae for the following coordination compounds: (i)…

A: The formulae for given coordination compounds has to be given.

Q: Give the systematic name for the following coordination compound or complex ion: PdNH NO2 O2NI.. H3N

Q: Correlate the atom, ion, or molecule to its role in the coordination compound [Ti(OH2)a]Brg

A: Given, [Ti(OH2)6]Br3

Q: Which is the ligand in the coordination compound, [Co(NH3)6]C13? Co*3 O NH3 Co(NH3)6 cr

A: In [ML6]X2 type complex, metal is M and ligand is L. Ligand and metal are present inside the [ ]…

Q: [Cr(H₂O)₆]³⁺

A: Given :- formula = [Cr(H₂O)₆]³⁺ To determine :- systematic name

Q: Determine the oxidation state of the metal in each ofthe following coordination complexes:…

A: The oxidation state of metal ion complexes can be calculated as the sum of oxidation state of all…

Q: In the below coordination compound, the sodium ions are A._______the hydroxide ions are counterions…

Q: the coordination compound K3Fe(CN)6. Identify the complex ion. What is the counter ion in the…

Q: Give the systematic name for the following coordination compound or complex ion: Cs,[CUCI,]

A: We have to give the name for given compound.

Q: Assign a systematic name to the following coordination compound. Compound [Cu(NH3)2Cl2] Name

A: we have to name the given coordination complex

Q: What is the coordination number for the transition metal in the following complexes? a)…

A: To calculate coordination numbers of complexes , we have to look about ligands surrounding the…

Q: Identify each of the following coordination complexes as either diamagnetic or paramagnetic: (a)…

Q: Question attached

A: The given Coordination compound is Cr(bpy)2(CO)2 To find: The oxidation state and d-configuration…

Q: How many ligands are found on the coordination compound: [Co(NH3)5CI]Cl2 ? O A. 8 B. 6 O C.4 O D.5

A: How many ligand found in the given complex ?

Q: Give the systematic name for the following coordination compound or complex ion: + CI Co…C/ NH3 H3N/…

Concept explainers

Coordination Chemistry

It is a part of chemistry, in which the study of compounds that have central atoms surrounded by molecules or ions, known as ligand, is known as coordination chemistry.

Question

Give the systematic name for the following
coordination compound or complex ion:
NC
NH3

Give the systematic name for the following
coordination compound or complex ion:
CI
F
Со
F
CI

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step 3

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 3 steps

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Five-coordinate coordination complexes are known, including [CuCl5]3 and [Ni(CN)5]3. Write the structuralformulas and identify a plausible geometry for thesecomplexes.
Which of the following statement(s) is( are) true? a. The coordination number of a metal ion in an octahedral complex ion is 8. b. All tetrahedral complex ions are low-spin. c. The formula for triaquatrianuninechromiwn(III) sulfate is [Cr(H2O)3(NH3)](SO4)3. d. The electron configuration of Hf2+ is [Xe]4f126s2. e. Hemoglobin contains Fe3+.
Ethylenediaminetetraacetate (EDTA4 ) is used as a complexing agent in chemical analysis with the structure shown in Fig. 21.7. Solutions of EDTA4 are used to treat heavy metal poisoning by removing the heavy metal in the form of a soluble complex ion. The complex ion virtually prevents the heavy metal ions from reacting with biochemical systems. The reaction of EDTA4 with Pb2+ is Pb2+(aq) + EDTA4(aq) iPbEDTA2(aq) K = 1.1 1018 Consider a solution with 0.010 mol of Pb(NO3)? added to 1.0 L of an aqueous solution buffered at pH = 13.00 and containing 0.050 M Na1EDTA. Does Pb(OH)2 precipitate from this solution? [Ksp for Pb(OH)2 = 1.2 1015.
a. In the absorption spectrum of the complex ion Cr(NCS)63, there is a band corresponding to the absorption of a photon of light with an energy of 1.75 104 cm-1. Given 1 cm1 = 1.986 1023 J, what is the wavelength of this photon? b. The CrNC bond angle in Cr(NCS)63 is predicted to be 180. What is the hybridization of the N atom in the Ncs- ligand when a Lewis acid-base reaction occurs between Cr3+ and NCs- that would give a 180 CrNC bond angle? Cr(NCS)63 undergoes substitution by ethylenediamine (en) according to the equation Cr(NCS)63+2enCr(NCS)2(en)2++4NCS Does Cr(NCS)2(en)2+ exhibit geometric isomerism? Does Cr(NCS)2(en)2+ exhibit optical isomerism?
A 3.03-g petroleum specimen was decomposed by wet ashing and subsequently diluted to 500 mL in a volumetric flask. Cobalt was determined by treating 25.00-mL aliquots of this diluted solution as follows: Assume that the Co(II)-ligand chelate obeys Beer’s law, and calculate the percentage of cobalt in the original sample.
Provide a name for the following complex ion:[AuF4]^-
For the aqueous [PbC1]2- complex K=2.5 × 10^15 at 25 °CSuppose equal volumes of 0.0014 M Pb(NO), solution and 0.20 M KCI solution are mixed. Calculate the equilibrium molarity of aqueous Pb2+Round vour answer to 2 sianificant digits
Write out structure representations for all isomers of the following complexes: (c) Pd(en)(SCN)2 (include linkage isomers)
Write out structure representations for all isomers of the following complexes: (b) [WBr4(NH3)(OH)]5-
Zinc on forms a 1:1 complex with a ligand called triethylenetetraamine. The formation constant for this complex is 1012. Calculate the [Zn2+] in a 0.01 M solution of the complex.
Explain why the complex [Fe(H2O)6]3+ has Do = 14,000 cm-1, while [Fe(H2O)6]2+ has Do = 9,350 cm-1.
For the aqueous [Ag(CN)2]^- complex Kf =3.0x10^20 at 25°C.Suppose equal volumes of 0.0068M AgNO3 solution and 0.32M KCN solution are mixed. Calculate the equilibrium molarity of aqueous Ag^+ ion.Round your answer to 2 significant digits.