Answered: Given that AH H(g)] = 218.0 kJ mol1 AH…

Given that AH H(g)] = 218.0 kJ mol1 AH C(g)]= 716.7 kJ-mol1 AH CH (g)= -74.6 kJ-mol 1 calculate the average molar bond enthalpy of the carbon-hydrogen bond in a CH, molecule. 1 kJ.mol ДНС-н —

Physical Chemistry

2nd Edition

ISBN:9781133958437

Author:Ball, David W. (david Warren), BAER, Tomas

Publisher:Ball, David W. (david Warren), BAER, Tomas

Chapter2: The First Law Of Thermodynamics

Section: Chapter Questions

Problem 2.44E: Starting with equation 2.27 andthe original definitionof enthalpy, derive the fact that Cp-=Cv-+R

See similar textbooks

Related questions

Q: Consider the following reaction at 235°C and 1.00 atm: CH3 CI(g) + H2 (9) → CH4 (g) + HC1(g) For…

Q: Using the equations Sro (s) + CO, (g) → SrCO, (s) AH° = -234 kJ/mol 2 Sr(s) + O, (g) → 2 SrO (š) AH°…

Q: Using the equations H2 (g) + F2 (g) --> 2HF (g) Delta H = -79.2 kJ/mol C (s) + 2F2 (g) --> CF4…

A: We have to do manipulation in the given equations to reach desired equation ,and whatever…

Q: Given that Δ?∘f[H(g)]=218.0 kJ⋅mol−1ΔHf∘[H(g)]=218.0 kJ⋅mol−1 Δ?∘f[C(g)]=716.7…

A: Average enthalpy can be calculated as follows:

Q: A 0.836 g of CH14 are burned in a constant volume calorimeter, the calorimeter temperature rises…

Q: Using the equations N2 (g) + O2 (g)→ 2 NO (g) AH° = 180.6 kJ/mol N2 (g) + 3 H2 (g) → 2 NH3 (g) AH° =…

A: Determine the enthalpy of the given reaction by, Multiply the first equation by 2…

Q: Using the equations H, (g) + F, (g) → 2 HF (g) AH° = -79.2 kJ/mol C (s) + 2 F, (g) → CF, (g) AH° =…

Q: The molar heat capacity at constant pressure for CO(g) is 6.97 cal mol-1 K-1. How much heat in cal…

A: The molar heat capacity is defined as the heat (Q) required to raise the temperature of 1 mole the…

Q: Does the law of conservation of energy relate to energy exchanges between a thermodynamic system and…

A: For an isolated system, its total energy remains constant. The energy of system will change if it…

Q: calculate the change in enthalpy for Reaction 2. Reaction 1:…

A: Given Reaction 1: C3H8(g) + 5O2(g)→3CO2(g) + 4H2O(g) ∆H1 = -2043 kJ mol-1 Reaction 2: 6C3H8(g) +…

Q: Given that: ΔHof [NO2(g)] = +34.0 kJ mol−1 ΔHof [NO(g)] = +90.0 kJ mol−1 What is the standard…

Q: The molar heat capacity at constant pressure for CO(g) is 6.97 cal mol-1 K-1. How much heat in cal…

A: Here Molar mass of CO 12.011g/mol + 15.999g/mol = 28.01g/mol Given mass of CO = 0.59 g Now…

Q: A0.565 g of CgH18 are burned in a constant volume calorimeter, the calorimeter temperature rises…

A: Given mass of C8H18 = 0.565 g Initial temperature = Ti = 25.00 0C Final temperature = Tf = 26.13…

Q: Unfortunately I don't get the answer for this one....I've calculated several times already

Q: (d) Calculate the average bond enthalpy for the N-H bond using the following data: NH₂(g) → NH₂(g) +…

Q: 2 H₂ (g) + O₂ (g) → 2 H₂O (l) ∆H° = -572 kJ/mol Ca (s) + ½ O₂ (g) → CaO (s) ∆H° = -635 kJ/mol CaO…

A: The following reaction with their enthalpy of reaction is given as- 2 H₂ (g) + O₂ (g) → 2 H₂O (l)…

Q: Using the equations H2 (g) + F2 (g) → 2 HE (g) AH° = -79.2 kJ/mol C (s) + 2 F2 (g) → CF, (g) AH° =…

A: H2 (g) + F2 (g) -----> 2HF (g) ∆H1° = -79.2 kJ/mol .................(1) C (s) + 2F2…

Q: Using the equations H2 (g) + F2 (g) → 2 HF (g) AH° = -79.2 kJ/mol C (s) + 2 F2 (g)→ CF4 (g) AH° =…

A: The quantity of energy released/absorbed in a chemical reaction is furnished by the enthalpy change…

Q: Using the equations H, (g) + F, (g) → 2 HF (g) AH° = -79.2 kJ/mol C'(s) + 2 F, (g) → CF, (g) AH° =…

A: Given, Equation1: H2(g) + F2(g) 2HF(g) ∆H = -79.2 KJ/mol Equation2: C(s)…

Q: Under constant-volume conditions, the heat of combustionof glucose (C6H12O6) is 15.57 kJ/g. A…

A: (a) Here given as, the heat of combustion of glucose (C6H12O6), q= 15.57 kJ/g. Mass of glucose that…

Q: Using the provided table of Enthalpies of Formation, determine the enthalpy for the following…

A: The heat of combustion of substance is defined as the heat evolved when 1 mole of that compound is…

Q: Using the equations N2 (g) + O2 (g) → 2 NO (g) AH° = 180.6 kJ/mol N2 (g) + 3 H2 (g) → 2 NH3 (g) AH°…

A: The reactions given are, 1) N2 (g) + O2 (g) ------> 2 NO (g) ΔHo = 180.6…

Q: Suppose that the reaction of 0.224 moles consumes 23.58 kJ of heat. What is the molar enthalpy of…

A: Molar enthalpy of the reaction can be defined as the formation of one mole of compound. Consider the…

Q: 4 C3H9N(1) + 21 O2(g) → 12 CO2(g) + 18 H2O(1) + 2 N2(1) AH = -9,191 kJ Use this information and the…

A: Standard enthalpy of formation can be calculated as, ∆Horeaction=∆Hproduct-∆Hreactant

Q: Using the equations N, (g) + O, (g)→ 2 NO (g) AH° = 180.6 kJ/mol N, (g) + 3 H, (g) → 2 NH, (g) AH° =…

A: Given equations and their enthalpies are, 1)N2(g)+O2(g)-->2NO(g), ∆Ho1=180.6 KJ/mol…

Q: Using the equations N2 (g) + O2 (g) → 2 NO (g) AH° = 180.6 kJ/mol N2 (g) + 3 H2 (g) →2 NH3 (g) AH° =…

A: Given,

Q: Using the equations H, (g) + F, (g) → 2 HF (g) AH° = -79.2 kJ/mol C (s) + 2 F, (g) → CF, (g) AH° =…

A: Since you have posted multiple questions we will solve the first question for you. To get the…

Q: ΔrU for C6H12O6 was measured to be -2805 kJ mol-1 in a bomb calorimeter. A 1.752 g sample of this…

A: Given, ∆U for C6H12O6 is -2805 kJ/mol Sample burned is 1.752 g Molar mass of C6H12O6 is 180 g/mol…

Q: Using the equations 2 H2 (g) + O2 (g) → 2 H2O (I) AH° = -572 kJ/mol Ca (s) + ½ O2 (g) → CaO (s) AH°…

Q: Using the equations Sro (s) + CO, (g) → SrCO, (s) AH° = -234 kJ/mol 2 Sr(s) + O, (g) → 2 Sro (s) AH°…

A: Given SrO(s) + CO2(g) → SrCO3(s) ∆H° = -234 KJ/mol…

Q: Substance ΔΗ AgCl AGCN HCl -129.888 kJ/mol 141.8 kJ/mol -171.728 kJ/mol HCN 108.5 kJ/mol HCl + AGCN…

A: Given, ∆Hof of AgCl = -129.888 KJ/mol ∆Hof of AgCN = 141.8 KJ/mol ∆Hof of HCl = -171.728 KJ/mol ∆Hof…

Q: The following data was collected during calorimetry experiments. 2 CH3CHO(g) + 5 O2(g) H2O(e) → 4…

Q: The enthalpy changes of the following reactions can be measured: C₂H6 (g) + 7/2 O2 (g) → 2 CO₂ (g) +…

A: In this question we have to calculate the enthalpy change of the reaction.

Q: In the calorimeter experiment, you mixed 50 mL of 1.0 M NaOH with 50 mL of approximately 1.0 M HCI.…

A: A positive ΔHº value represents an addition of energy from the reaction (and from the surroundings),…

Q: The hydrocarbon propane has the structure CH3-CH2-CH3 Use the average bond enthalpies from the table…

A: The ΔH0 of any reaction can be given as ΔH0 = sum of bond enthalpies of each bond in reactants -…

Q: forven C5 H8 + Cl₂ C5H8 Clz are both C5 H8 and CsH8 Cl₂ rings. C5HB has one double double bond. Give…

A: Given C5H8 compound is cyclic and also contain double bond, then it must be cyclopentene. Now, Cl2…

Q: The molar heat capacity at constant pressure for CO(g) is 6.97 cal mol-1 K-1. How much heat in cal…

A: heat capacity(C) is defined as the amount of heat required to raise the temperature of substance by…

Q: For a particular isomer of C,H8, the combustion reaction produces 5113.3 kJ of heat per mole of…

A: Given C8H18 (g) + 25/2 O2 (g) -> 8 CO2 (g) + 9H2O (g) Enthalpy of reaction = -5113.3 KJ mol-1 To…

Q: Determine the change in enthalpy for the following reaction: SnO2(s) + 2 H2(g) → Sn(s) + 2 H2O(l)…

A: Given data: ∆Hac,SnO2(s) = -1381.1 kJ/mol ∆Hac,Sn(s) = -302.1 kJ/mol ∆Hac,H2(g) = -435.3 kJ/mol…

Q: Using the equations H₂ (g) + F₂ (g) → 2 HF (g) ∆H° = -79.2 kJ/mol C (s) + 2 F₂ (g) → CF₄ (g) ∆H° =…

A: It is given that the enthalpy for the reactions, H2(g) + F2(g) → 2 HF(g) ∆H° = -79.2 kJ/mol C(s) +…

Q: H₂ (g) + F₂ (g) → 2 HF (g) ∆H° = -79.2 kJ/mol C (s) + 2 F₂ (g) → CF₄ (g) ∆H° = 141.3 kJ/mol 2 C(s) +…

Q: From the following data, calculate the average bond enthalpy for the N-H bond: NH3(g)NH2(g)+ H(g) AH…

A: The average bond enthalpies of N-H bond are calculated by adding all the equations,

Q: Hydrogenation of double and triple bonds is an important industrial process. Calculate (in kJ) the…

A: Introduction- To determine the standard enthalpy change ΔH° ( in KJ ) for the hydrogenation of…

Q: From the following data, calculate the average bond enthalpy for the N-H bond. NH3(g) NH2(g) + H(g)…

Q: For a particular isomer of C,H18, the combustion reaction produces 5099.5 kJ of heat per mole of…

Q: Determine the enthalpy for the following reaction, given A (NH3(g)) = -46.1 kJ/mol, AH (NO(g = +90.3…

Q: Use the molar bond enthalpy data in the table to estimate the Average molar bond enthalpies. (Hpond)…

Q: The molar heat capacity at constant pressure for CO(g) is 6.97 cal mol-1 K-1. How much heat in cal…

A: Using the heat capacity formula we can find the heat required to raise the temperature of a…

Q: At constant volume, the heat of combustion of a particular compou (molar mass = 162.47 g/mol) was…

Q: Calculate the enthalpy of the following chemical reaction: CS2(1) + 302(g) ---> CO2(g) + 2SO2(g)…

A: We have the enthalpy of three given reactions , we have to use them for finding the enthalpy of our…

Question

Given that
AH H(g)] =
218.0 kJ mol1
AH C(g)]= 716.7 kJ-mol1
AH CH (g)= -74.6 kJ-mol 1
calculate the average molar bond enthalpy of the carbon-hydrogen bond in a CH, molecule.
1
kJ.mol
ДНС-н —

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps with 2 images

SEE SOLUTION Check out a sample Q&A here

Similar questions

Would the amount of heat absorbed by the dissolution in Example 5.6 appear greater, lesser, or remain the same if the heat capacity of the calorimeter were taken into account? Explain your answer.
9.42 Why is enthalpy generally more useful than internal energy in the thermodynamics of real world systems?
The enthalpy of combustion of solid carbon to form carbon dioxide is 393.7 KJ/mol carbon, and the enthalpy of combustion of carbon monoxide to form carbon dioxide is 283.3 KJ/mol CO. Use these data to calculate H for the reaction 2C(s)+O2(g)2CO(g)
Combustion reactions involve reacting a substance with oxygen. When compounds containing carbon and hydrogen are combusted, carbon dioxide and water are the products. Using the enthalpies of combustion for C4H4 ( 2341 kJ/mol), C4H8 (2755 kJ/mol), and H2 (286 kJ/mol), calculate H for the reaction C4H4(g)+2H2(g)C4H8(g)
The reaction SO3(g)+H2O(l)H2SO4(aq) is the last step in the commercial production of sulfuric acid. The enthalpy change for this reaction is 227 kJ. In designing a sulfuric acid plant, is it necessary to provide for heating or cooling of the reaction mixture? Explain.
At 298 K, the standard enthalpies of formation for C2H2(g) and C6H6(l) are 227 kJ/mol and 49 kJ/mol, respectively. a. Calculate H for C6H6(l)3C2H2(g) b. Both acetylene (C2H2) and benzene (C6H6) can be used as fuels. Which compound would liberate more energy per gram when combusted in air?
Explain why absolute enthalpies and energies cannot be measured, and only changes can be determined.
When 1.000 g of ethylene glycol, C2H6O2, is burned at 25C and 1.00 atmosphere pressure, H2O(l) and CO2(g) are formed with the evolution of 19.18 kJ of heat. a Calculate the molar enthalpy of formation of ethylene glycol. (It will be necessary to use data from Appendix C.) b Gf of ethylene glycol is 322.5 kJ/mol. What is G for the combustion of 1 mol ethylene glycol? c What is S for the combustion of 1 mol ethylene glycol?
Starting with equation 2.27 andthe original definitionof enthalpy, derive the fact that Cp-=Cv-+R
n Section 10.7, two characteristics of enthalpy changes for reactions are listed. What are these characteristics? Explain why these characteristics are true.
A sample of ethanol, C2H5OH, weighing 2.84 g was burned in an excess of oxygen in a bomb calorimeter. The temperature of the calorimeter rose from 25.00C to 33.73C. If the heat capacity of the calorimeter and contents was 9.63 kJ/C, what is the value of q for burning 1.00 mol of ethanol at constant volume and 25.00C? The reaction is C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) Is q equal to U or H?
When 1.000 g of gaseous butane, C4H10, is burned at 25C and 1.00 atm pressure, H2O(l) and CO2(g) are formed with the evolution of 49.50 kJ of heat. a Calculate the molar enthalpy of formation of butane. (Use enthalpy of formation data for H2O and CO2.) b Gf of butane is 17.2 kJ/mol. What is G for the combustion of 1 mol butane? c From a and b, calculate S for the combustion of 1 mol butane.