Answered: If a sample of HNO3 is found to contain…

If a sample of HNO3 is found to contain 6.46 · 103 mol of H atoms how many moles of HNO3 molecules are present? Express your answer in scientific notation. х 10

Chemistry: Principles and Practice

3rd Edition

ISBN:9780534420123

Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Publisher:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Chapter3: Equation, The Mole, And Chemical Formulas

Section: Chapter Questions

Problem 3.56QE

See similar textbooks

Related questions

Q: How many moles are there in 6.55 x 1025 molecules of H2O?

A: Given: The number of molecules of water=6.55 x 1025 1 mol of water = 6.022 x 1023 molecules…

Q: If 0. 274 moles of a substance weighs 62.5 g, what is the molar mass of the substance, in units of…

A: Given- Moles of substance =0.274 moles Weight of substance= 62.5 g

Q: How many moles of SiBr4 are formed?

A: Number of moles = mass/molar mass Molar mass of Br2 = 159.808 g/mol

Q: Give the following generic chemical reaction, determine the moles of B2 needed to react with 1.25 x…

Q: how do i do this

A: First, determine the moles of aluminium.The molar mass of aluminium is 26.982 g/mol.

Q: Mercury can be obtained by reacting mercury(II) sulfide, HgS, with calcium oxide, CaO. How many…

A: Given: The reaction is as follows: 4CaO+4HgS→4Hg+3CaS+CaSO4 The mass of Hg produced=84.7 g. The…

Q: 1. Sphalerite is a zinc sulfide (ZnS) mineral and an important commercial source of zinc metal. The…

Q: In the decomposition of hydrogen peroxide, the percentage yield of oxygen is 93.0%. What is the…

Q: P+6NO P,0 + 3N, How many moles of N, can be produced if 2.24 x 1023 molecules of NO reacts with…

A: The reaction given in the question is as follows: P4 + 6NO → P4O6 + 3N2 Number of molecules of NO…

Q: How many grams are in 1.18 x 1021 HF molecules? H = 1.008 g/mole and F =19.00 g/mole

A: Number of mols = Weight in gMolecular weight in g/mol Then Weight of the substance = Number of mole…

Q: The percent yield of this reaction is 62.0%. 2Al(s) + 3 F₂ (g) -> 2AIF 3 (s) Determine the mass, in…

A: The percentage yield is defined as the actual yield upon theoretical yield multiplied by 100.

Q: Use the molar mass of Ca3(PO3)2 to calculate the moles of oxygen in 6.66 x 106 g of CP. Give your…

A: given mass of Ca3(PO3)2 = 6.66 x 106 g Molar mass of Ca = 40.078 g/mol Molar mass of P = 30.974…

Q: How many molecules are contained in a glass that holds 490 g of water? How many moles does that…

A: The mass of one mole of molecules is known as molar mass. We know that the molar mass of water is…

Q: If 3.68 x 1021 formula units of sodium bromide are reacted with excess chlorine gas, how many…

Q: Convert 6.92 x 1024 molecules of CO2 to grams CO2.

A: Avogadro's number gives the number of atoms, molecules or ions in one mole of the substance and it…

Q: How many moles are in 5.78 x 1023 molecules CO,?

A: Given :- number of molecules of CO2 = 5.78 × 1023 molecules To calculate : number of moles of CO2…

Q: Determine the quantity of molecules of Cr203 that form when 1.34x10^3 g of oxygen completely reacts…

A: Given : 4Cr(s)+3O2(g)→2Cr2O3(s) Mass of O2 = 1.34 × 103 g To calculate : Number of Cr2O3…

Q: 2 NH3(e) + N2e) + 3H2e) ne reaction for the decomposition of ammonia (NH3) can be written as shown.…

A: Given that,mass of NH3 = 21.7 g Molar mass of NH3 = 17.031 g/mol Molar mass of H2 = 2.016 g/mol mol…

Q: 2. In order to react 109 grams of bromine gas completely, how many moles of aluminum are required?…

A: Aluminum reacts with bromine gas to form aluminum bromide. Write the complete reaction.…

Q: How many moles of Al(OH)3 will be produced when 0.600 mol of CH4 is formed?

A: The reaction of Aluminium carbide with water to give Aluminium hydroxide and methane is given by the…

Q: The percent yield of this reaction is 65.0%. 2A1(s) +3 F2 (g) – 2AIF3 (s) Determine the mass, in…

A: We have to predict the actual yield.

Q: The percent by mass of carbon in CO2 is equal to which of the following expressions? O A 12 44 x 100…

A: Percent by mass of an atom in given molecule is the mass of that element present in 100 grams of…

Q: Enter your answer in the provided box. The reaction between nitric oxide (NO) and oxygen to form…

Q: __________ to ____________ 2CO + O2 → 2CO2 Given Units…

A: using the mole concept

Q: A 58.5 g sample of an unknown compound that contains only carbon, hydrogen and oxygen was analyzed…

A: Given: The mass of the unknown compound is 58.5 g The mass of CO2 (carbon dioxide) is 105.6 g The…

Q: In measuring the sample that is placed into a SCUBA diver's tank it has the following gases: 52.00 g…

A: A numerical problem based on percentage concentration, which is to be accomplished.

Q: What does a theoretical yield of 1.38g mean ?

A: Given, Theoretical yield = 1.38 g Required, What is the meaning of…

Q: 12, How many grams of O2 gas are there in 6.30 x 1026 molecules? 13. What is the mass in grams of…

A: Mole can be defined as a standard unit for measuring large quantities of very small entities such as…

Q: 2 NH3 + 3 CuO g 3 Cu + N₂ + 3 H₂O In the above equation how many grams of N₂ can be made when 150…

A: The given balanced chemical equation is: 2NH3 + 3CuO → 3Cu + N2 + 3H2O The required mole ratio is: 1…

Q: For the reaction 2HNO3 + Mg(OH)2 → Mg(NO3)2 + 2H₂O, how many grams of magnesium nitrate are produced…

A: 5.9 g of Magnesium nitrate, Mg(NO3)2 are produced from 5 g of Nitric Acid HNO3

Q: Elemental phosphorus occurs as tetratomic molecules, P4. What mass of chlorine gas is needed to…

A: Introduction: We have to calculate weight of Cl2 . Given : weight of phosphorus = 223g

Q: The chemical formula for octane is: CH; (CH,),CH; 9. Calculate the molar mass of octane. Round your…

A: Octane is saturated hydrocarbon compound which is a component of gasoline i.e pertrol. It is…

Q: Assuming constant conditions, how many milliliters of chlorine gas react to yield 1.15 LL of…

A: We are given the following reaction: Cl2(g)+O2(g)--------->Cl2O3(g). The volume of Cl2O3(g)…

Q: What is the stoichiometric coefficient for oxygen when the following equation is balanced using the…

A: Ans; 3

Q: True or False? One mole of molecular O2 = 6.02 x 1023 O2 molecules. Mass of O2 in 100g of CO2 =…

Q: An

Q: In an industrial process, hydrogen chloride, HCl, is prepared by burning hydrogen gas, H2, in an…

A: Mass of a substance can be determined by multiplying number of moles present with its molar mass.…

Q: 2 NH3 + 3 CuO → 3 Cu + N₂ + 3 H₂O In the above equation, how many grams of N₂ can be made when 18.4…

Q: 2. A chemist analyzed a sample of a compound that was known to contain potassium, manganese, and…

A: Percentage composition of a given compound is depicted as ratio of the amount of each element to…

Q: Using the initial mass 1.510 g and the molecular formula of the hydrate CuCl2⋅2H2O). Predict the…

A: Mass of compound = 1.510 g Mass of water produced on heating the compound = ?

Q: Determine the number of molecules of Cr:Os that form when 1.34 x 10° g of oxygen completely reacts…

A: Given the reaction is 4Cr(s) + 3O2(g) -------> 2 Cr2O3 Weight of oxygen = 1.34*103 g = 1340 g

Q: 2 NH3 + 3 CuO → 3 Cu + N₂ + 3 H₂O In the above equation, how many grams of N₂ can be made when 10.9…

Q: Calculate the molar mass of Cd3(PO4)2. How many moles of hydrogen (H2) gas are in a 4.00 g sample?…

Q: How many moles of Mg(OH)2 are present after the reaction is complete? Express your answer in moles…

A: Given 7.55 g of Mg(OH)2 reacted with 25mL of 0.195M HNO3 We have to tell the number of moles of…

Q: How many moles are in 8.9 x 10^26 molecules of C6H12O6? Express in decimal

A: 1 mole of any atom / molecule consists avogadro number. Avogadra number NA = 6.022× 10 23

Q: help

A: Determine number of moles of aluminum:

Q: C3H8 + 5O2 --> 3CO2 + 4H2O How many…

A: To calculate grams of oxygen required, we would use dimensional analysis method . For this we would…

Q: How many molecules are present in 45g of fluorine gas, F₂? 2.71 x 1025 1.03 x 1027 7.13 x 1023 1.97…

Q: Determine the mass of sodium nitrate produced when o.85 g of nickel II nitrate reacts with sodium…

A: Given, mass of nickel(II) nitrate = 0.85 g we know, molar mass of nickel(II) nitrate ( Ni(NO3)2 ) =…

Concept explainers

Mole Concept

Mole concept is a method to determine the amount of any substance that consists of some elemental particles using a grouping unit called ‘mole’. The mole concept enables one to handle the large amount of small elementary particles. The mole concept can be used in many calculations related to mole calculation, molar amount, mole ratio, and so on, which are significant in chemistry.

Question

MOLES/GRAMS/MOLECULES T06/S06
If a sample of HNO3 is found to contain 6.46 · 10-3 mol of H atoms how many moles of HNO3 molecules are present? Express your answer in scientific notation.
Molar Mass (g/mol)
HNO3
63.013
14.007
1.0080
15.999
N atom
x 10
H atom
O atom
Avogadro's No. (mol*1)
6.022x1023

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step 3

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 3 steps

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

itamin B12 , cyancobalamin, is essential for human nutrition. Its molecular formula is C63H88CoN14O14P . A lack of this vita min in the diet can lead to anemia. Cyanocohalamin is the form of the vitamin found in vitamin supplements. l type='a'> What is the molar mass of cyanocobalamin to two decimal places? How many moles of cyanocohalamin molecules are present in 250 mg of cyanocobalamin? What is the mass of 0.60 mole of cyanocobalamin? How many atoms of hydrogen are in 1 .0 mole of cyanocobalamin? What is the mass of 1.0107 molecules of cyanocobalamin? What is the mass (in grams) of one molecule of cyanocobalamin?
The following pictures show a molecular-scale view of a chemical reaction between the compounds AB2 and B2. (A at-oms are shown in blue and B atoms in white). The box on the left represents the box on the right shows what is left once the reaction has gone to completion. Write a balanced chemical equation for this reaction. As usual, your equation should use the smallest possible whole number coefficients for all substances.
Sulfurous acid is unstable in aqueous solution and gradually decomposes to water and sulfur dioxide gas (which explains the choking with associated with sulfurous acid solutions). :math>H2SO3(aq)H2O(l)+SO2(s) 4.25 g of sulfurous acid undergoes this reaction, what mass of sulfur dioxide is released?
Phosphine gas reacts with oxygen according to the following equation: 4PH3(g)+8O2(g)P4O10(s)+6H2O(g) Calculate (a) the mass of tetraphosphorus decaoxide produced from 12.43 mol of phosphine. (b) the mass of PH3 required to form 0.739 mol of steam. (c) the mass of oxygen gas that yields 1.000 g of steam. (d) the mass of oxygen required to react with 20.50 g of hosphine.
How are the molecular mass and the molar mass of a compound similar and how are they different?
3.59 The composition of materials such as alloys can be described in terms of mole percentage (mol%), atom percentage (at%), or weight percentage (wt%). Carry out the following conversions among these units. (a) 60 Cu and 40 Al to at%, (b) 25 mol% NiO and 75 mol % MgO to wt%, (C) 40 wt% MgO and 60 wt% Feo to mol %
alculate the number of moles of the indicated substance present in each of the following samples. l type='a'> 1.28 g of iron(II) sulfate 5.14 mg of mercury(II) iodide 9.21 µg of tin(IV) oxide 1.26 lb of cobalt(ll) chloride 4.25 g of copper(II) nitrate
Consider the following diagram, where atom X is represented by a square and atom Y is represented by a circle. (a) Write the equation for the reaction represented by the diagram. (b) If each circle stands for a mole of Y and each square a mole of X, how many moles of X did one start with? How many moles of Y? (c) Using the same representation described in part (b), how many moles of product are formed? How many moles of X and Y are left unreacted?
DDT, an insecticide harmful to fish, birds, and humans, is produced by the following reaction: In a government lab, 1142 g of chlorobenzene is reacted with 485 g of chloral. a. What mass of DDT is formed, assuming 100% yield? b. Which reactant is limiting? Which is in excess? c. What mass of the excess reactant is left over? d. If the actual yield of DDT is 200.0 g, what is the percent yield?
Which of the following has the largest number of molecules? a 1 g of benzene, C6H6 b l g of formaldehyde, CH2O c l g of TNT, C7H3N3O6 d l g of naphthalene, C10H8 e l g of glucose, C6H12O6
or each of the following reactions, give the balanced chemical equation for the reaction and state the meaning of the equation in terms of individual molecules and in terms of moles of molecules. msp;MnO2(s)+Al(s)Mn(s)+Al2O3(s) msp;B2O3(s)+CaF2(s)BF3(g)+CaO(s) msp;NO2(g)+H2O(l)HNO3(aq)+NO(g) msp;C6H2(g)+H2C6(g)H12(g)
Calculate the number of moles of the indicated substance present in each of the following samples. l type='a'> 1.95103 g of lithium carbonate 4.23 kg of calcium chloride 1.23 mg of strontium chloride 4.75 g of calcium sulfate 96.2 mg of nitrogen(IV) oxide 12.7 g of mercury(I) chloride