il occur. 6. The data below refer to the following reaction: 2N0(g) + Br2(g) R 之2NOBr(g) Initial Change uilibri 1.5 5.0 1.0 Equlbrium20 Calculate Ke. 7. Consider the reaction N2(g) + 02(g)-그 2N0(g), for which K. = 0.10 at 2,000°C. Starting with initial concentrations of 0.040 M of N2 and 0.040 M of O2, which of the following would be the correct way to determine the equilibrium concentrations? 2 =0.10 2x2 D) 2

il occur. 6. The data below refer to the following reaction: 2N0(g) + Br2(g) R 之2NOBr(g) Initial Change uilibri 1.5 5.0 1.0 Equlbrium20 Calculate Ke. 7. Consider the reaction N2(g) + 02(g)-그 2N0(g), for which K. = 0.10 at 2,000°C. Starting with initial concentrations of 0.040 M of N2 and 0.040 M of O2, which of the following would be the correct way to determine the equilibrium concentrations? 2 =0.10 2x2 D) 2

Chemistry by OpenStax (2015-05-04)

1st Edition

ISBN:9781938168390

Author:Klaus Theopold, Richard H Langley, Paul Flowers, William R. Robinson, Mark Blaser

Publisher:Klaus Theopold, Richard H Langley, Paul Flowers, William R. Robinson, Mark Blaser

Chapter13: Fundamental Equilibrium Concepts

Section: Chapter Questions

Problem 19E: The following reaction has KP=4.50105 at 720 K. N2(g)+3H2(g)2NH3 If a reaction vessel is filled with...

See similar textbooks

Similar questions

What are homogeneous equilibria? Heterogeneous equilibria? What is the difference in writing K expressions for homogeneous versus heterogeneous reactions? Summarize which species are included in the K expression and which species are not included.
Consider the system A(g)+2B(g)+C(g)2D(g)at 25C. At zero time, only A, B, and C are present. The reaction reaches equilibrium 10 min after the reaction is initiated. Partial pressures of A, B, and D are written as PA, PB, and PD. Answer the questions below, using LT (for is less than), GT (for is greater than), EQ (for is equal to), or MI (for more information required). (a) PD at 11 min PD at 12 min. (b) PA at 5 min PA at 7 min. (c) K for the forward reaction K for the reverse reaction. (d) At equilibrium, K Q. (e) After the system is at equilibrium, more of gas B is added. After the system returns to equilibrium, K before the addition of B K after the addition of B. (f) The same reaction is initiated, this time with a catalyst K for the system without a catalyst the system with a catalyst. (g) K for the formation of one mole of D K for the formation of two moles of D. (h) The temperature of the system is increased to 35C. PB at equilibrium at 25C PB at equilibrium at 35C. (i) Ten more grams of C are added to the system. PB before the addition of C PB after the addition of C.
For the given chemical equilibrium, these data are determined experimentally: T K 350K 3.76102 450K 1.86101 Determine H for this reaction.
The equilibrium constant for the butane iso-butane equilibrium at 25 C is 2.50. Calculate rG at this temperature in units of kJ/mol.
The following reaction has KP=4.50105 at 720 K. N2(g)+3H2(g)2NH3 If a reaction vessel is filled with each gas to the partial pressures listed, in which direction will it shift to reach equilibrium? P(NH3)=93atm,P(N2)=48atm, and P(H2)=52
Many sugars undergo a process called mutarotation, in which the sugar molecules interconvert between two isomeric forms, finally reaching an equilibrium between them. This is true for the simple sugar glucose, C6H12O6, which exists in solution in isomeric forms called alpha-glucose and beta-glucose. If a solution of glucose at a certain temperature is analyzed, and it is found that the concentration of alpha-glucose is twice the concentration of beta-glucose, what is the value of K for the interconversion reaction?
Consider the decomposition of ammonium hydrogen sulfide: NH4HS(s)NH3(g)+H2S(g) In a sealed flask at 25C are 10.0 g of NH4HS, ammonia with a partial pressure of 0.692 atm, and H2S with a partial pressure of 0.0532 atm. When equilibrium is established, it is found that the partial pressure of ammonia has increased by 12.4%. Calculate K for the decomposition of NH4HS at 25C.
12.42 The following reaction is in equilibrium in lake water: HCO,_(aq) + H+(aq)«=*H,CO,(aq) Predict the change in the reaction quotient, Q, for each disturbance below and use that prediction to explain how the equilibrium is shifted by the stress. NaHCOj is added to the lake. H,CO}is added. NaOH is added.
Methanol can be synthesized by means of the equilibriumreaction CO(g)+2H2(g)CH3OH(g) for which the equilibrium constant at 225°C is 6.08103. Assume that the ratio of the pressures of CO(g) and H2(g) is 1:2. What values should they have if the partial pressureof methanol is to be 0.500 atm?
A common type of reaction we will study is that having a very small K value (K 1). Solving for equilibrium concentrations in an equilibrium problem usually requires many mathematical operations to be perfomed. However, the math involved when solving equilibrium problems for reactions having small K values (K 1) is simplified. What assumption is made when solving the equilibrium concentrations for reactions with small K values? Whenever assumptions are made, they must be checked for validity. In general, the 5% rule is used to check the validity of assuming x (or 2 x, 3x, and so on) is very small compared to some number. When x (or 2 x. 3x. and so on) is less than 5% of the number the assumption was made against, then the assumption is said to be valid. If the 5% rule fails, what do you do to solve for the equilibrium concentrations?
Predict the temperature at which the reaction in Exercise 17.67 comes to equilibrium. Consider the equation G = H TS. At some value of T, G equals zero and the reaction is at equilibrium. Set G = 0, substitute for H and S (assuming that they do not vary much with temperature) and solve for T. CH3CHO(l)+52O2(g)2CO2(g)+2H2O(l)
The following data are for the system A(g)2B(g) (a) How long does it take the system to reach equilibrium? (b) How does the rate of the forward reaction compare with the rate of the reverse reaction after 45 s? After 90 s?