In the following experiment, a coffee-cup calorimeter containing 100 mL of H2 O is used. Theinitial temperature of the calorimeter is 23.0 °C. If 5.50 g of CaCl2 is added to the calorimeter,what will be the final temperature of the solution in the calorimeter? The heat of solution qsoln ofCaCl, is -82.8 kJ mol 1.Express your answer with the appropriate units.

The number of moles of CaCl2 in the given system is calculated using equation (1), n = mMn = 5.50…

In the following experiment, a coffee-cup calorimeter containing 100 mL of H2O is used. The initial temperature of the calorimeter is 23.0 °C. If 5.50 g of CaCl, is added to the calorimeter, what will be the final temperature of the solution in the calorimeter? The heat of solution quoln of CaCl2 is –82.8 kJ mol1. Express your answer with the appropriate units.

In the following experiment, a coffee-cup calorimeter containing 100 mL of H2O is used. The initial temperature of the calorimeter is 23.0 °C. If 5.50 g of CaCl, is added to the calorimeter, what will be the final temperature of the solution in the calorimeter? The heat of solution quoln of CaCl2 is –82.8 kJ mol1. Express your answer with the appropriate units.

Chemistry

9th Edition

ISBN:9781133611097

Author:Steven S. Zumdahl

Publisher:Steven S. Zumdahl

Chapter6: Thermochemistry

Section: Chapter Questions

Problem 104AE

See similar textbooks

Similar questions

A 50-mL solution of a dilute AgNO3 solution is added to 100 mL of a base solution in a coffee-cup calorimeter. As Ag2O(s) precipitates, the temperature of the solution increases from 23.78 C to 25.19 C. Assuming that the mixture has the same specific heat as water and a mass of 150 g, calculate the heat q. Is the precipitation reaction exothermic or endothermic?
In a coffee-cup calorimeter, 100.0 mL of 1.0 M NaOH and 100.0 mL of 1.0 M HCI are mixed. Both solutions were originally at 24.6C. After the reaction, the final temperature is 31.3C. Assuming that all the solutions have a density of 1.0 g/cm3 and a specific heat capacity of 4.18 J/Cg, calculate the enthalpy change for the neutralization of HCl by NaOH. Assume that no heat is lost to the surroundings or to the calorimeter.
When one mol of KOH is neutralized by sulfuric acid, q=56 kJ. (This is called the heat of neutralization.) At 23.7C, 25.0 mL of 0.475 M H2SO4 is neutralized by 0.613 M KOH in a coffee-cup calorimeter. Assume that the specific heat of all solutions is 4.18J/gC, that the density of all solutions is 1.00 g/mL, and that volumes are additive. (a) How many mL of KOH is required to neutralize H2SO4? (b) What is the final temperature of the solution?
One of the components of jet engine fuel is n-dodecane, C12H26(), which has a standard enthalpy of combustion of 8080.1 kJ/mol. (a) Write the thermochemical equation for the combustion of n-dodecane. (b) Use the standard enthalpies of formation in Appendix G to calculate the standard enthalpy of formation of n-dodecane.
Nitrogen gas (2.75 L) is confined in a cylinder under constant atmospheric pressure (1.01 105 pascals). The volume of gas decreases to 2.10 L when 485 J of energy is transferred as heat to the surroundings. What is the change in internal energy of the gas?
Peanuts and peanut oil are organic materials and bum in air. How many burning peanuts does it take to provide the energy to boil a cup of water (250 mL of water)? To solve this problem, we assume each peanut, with an average mass of 0.73 g, is 49% peanut oil and 21% starch; the remainder is noncombustible We further assume peanut oil is palmitic acid, C16H32O2, with an enthalpy of formation of 848.4 kJ/mol. Starch is a long chain of C6H10O5 units, each unit having an enthalpy of formation of 960 kJ.
The head of a strike anywhere match contains tetraphosphorus trisulfide, P4S3. In an experiment, a student burned this compound in an excess of oxygen and found that it evolved 3651 kJ of heat per mole of P4S3 at a constant pressure of 1 atm. She wrote the following thermochemical equation: P4S3(s)+8O2(g)P4O10(s)+3SO2(g);H=3651kJ Calculate the standard enthalpy of formation of P4S3, using this students result and the following standard enthalpies of formation: P4O10(s), 3009.9 kJ/mol; SO2(g), 296.8 kJ/mol. How does this value compare with the value given in Appendix C?
How much heat is produced when loo mL of 0.250 M HCl (density, 1.00 g/mL) and 200 mL of 0.150 M NaOH (density, 1.00 g/mL) are mixed? HCl(aq)+NaO(aq)NaCl(aq)+H2O(l)H298=58kJ If both solutions are at the same temperature and the heat capacity of the products is 4.19 J/g C, how much will the temperature increase? What assumption did you make in your calculation?
Consider the reaction 2HCl(aq)+Ba(OH)2(aq)BaCl2(aq)+2H2O(l)H=118KJ Calculate the heat when 100.0 rnL of 0.500 M HCl is mixed with 300.0 mL of 0.100 M Ba(OH)2 Assuming that the temperature of both solutions was initially 25.0C and that the final mixture has a mass of 400.0 g and a specific heat capacity of 4.18 J/C g, calculate the final temperature of the mixture.
When 50.0 g of 0.200 M NaCl(aq) at 24.1 C is added to 100.0 g of 0.100 M AgNO3(aq) at 24.1 C in a calorimeter, the temperature increases to 25.2 C as AgCl(s) forms. Assuming the specific heat of the solution and products is 4.20 J/g C, calculate the approximate amount of heat in joules produced.
The enthalpy of combustion of diamond is -395.4 kJ/mol. C s, dia O2 g CO2 g Determine the fH of C s, dia.
Microwave ovens convert radiation to energy. A microwave oven uses radiation with a wavelength of 12.5 cm. Assuming that all the energy from the radiation is converted to heat without loss, how many moles of photons are required to raise the temperature of a cup of water (350.0 g, specific heat =4.18J/gC) from 23.0C to 99.0C?