ОН C(CH3)3 На butaclamol

Q: The molecule shown below is a naturally occurring organic molecule that has antibiotic activity. How…

A: A chirality center is a carbon attached to four different atoms/groups.

Q: A CH3 HB Ha Ill UI H3C CH3 H H3C B HO Cholestanol differs from cholesterol only in the absence of a…

A: first of all before solving this question please look at equatorial and axial positions in…

Q: Mevacor is used clinically to lower serum cholesterol levels. How many asymmetric centers does…

A: The compound which is attached with four different group in carbon atom that carbon center is known…

Q: 7. Circle the chiral centers in the molecule. OH 8. Classify the molecules as chiral, achiral or…

A: Since you have asked multiple questions, we will solve the first question for you. If you want any…

Q: 2 Br CI looking down the C2-C3 axis b. CI looking down the C3-C4 axis .יווו

A:

Q: Taxol, an anticancer drug, is shown here without dash-wedge notation. How many chiral centers does…

A:

Q: What is the total number of stereoisomers possible for the following compound? В -ОМе а) 2 b) 3 c) 4…

A: The given compound has 2 chiral centres. Now we know that for a given compound, the number of…

Q: The following compound has only one asymmetric center. Why then does it have four stereoisomers?

A:

Q: Which of the following molecules has an inversion center? CH4 SF6…

A: Center of inversion (i) is one of the symmetry elements. It depends upon the structure of the…

Q: Which does not have a center of inversion? XeF4 SeF4 13 CO2

A: Center of inversion is posses by the molecule if a line is drawn from the point and the equal…

Q: [PtCl4]? has a center of symmetry, but [NiCl4]? does not. Suggest a correct shape for each of them…

A:

Q: H. CH3 HO.

A: Given structure is : Identify the chiral center and determine if it is the R- or S- stereoisomer =…

Q: Fill in the blanks: (a) to (i): Determine whether each stereocenter marked by letters in red is R or…

A: Stereochemistry is branch of chemistry in which we deal with three dimensional  arrangement of atoms…

Q: CH3 H,CH2C, H HYCH, ČH3 Н. Draw the line-angle structure incorporating the stereocenters first: Now…

A: The Newman projection represents the dihedral angles of different conformations of a molecule. In…

Q: How many asymmetric centers does 2,4,6 tnmethy iheptane have

A: Asymmetric centres

Q: Propanal, an aldehyde with the formula CH3CH2CHO, and n-propylamine have identical molecular weights…

A: Propanal,  CH3CH2CHO is more polar than n-propylamine.  The polarity in propanal is due to the -C=O…

Q: Tamiflu is used for the prevention and treatment of flu. What is the configuration of each of its…

A:

Q: The compound below is the active ingredient in Crestor, a widely-prescribed anti-cholesterol drug.…

A: Chiral centre of a molecule is defined as the centre or carbon due to which the molecule gives non…

Q: In the Fischer projection below, what are the configurations of the two asymmetric centers? H2CH HO…

A: Rules for assigning R and S notation to fischer projection.  • Assign priorities to the atoms/groups…

Q: 39. Which of the following compounds has a plane of symmetry? g. 8. 8 & „CI "CI II II IV A) I and II…

A: "Since you have asked multiple question, we will solve the first question for you. If youwant any…

Q: Chloramphenicol, a powerful antibiotic isolated in 1947 from the Streptomyces venezuelae bacterium,…

A: Chloramphenicol is a powerful antibiotic which was isolated in 1947 from the bacterium named…

Q: Q5/ Assign Ror S configuration to the chirality centers in the following molecules: (a) H OH Ib) H…

A: The configuration of the chiral molecule is given by projecting the wedge projection into Fischer…

Q: How many asymmetric centers does the following compound have? How many stereocenters does it have?

A: The asymmetric center is a stereocenter which arises to a compound if any atom is bonded to four…

Q: Which of the following ions or molecules has a center of symmetry?

A: A center of symmetry: A point at the center of the molecule. (x,y,z) --->(-x,-y,-z). It is not…

Q: 10 Label the stereocenters present in the molecules below as either Ror S. (а) Cl (b) CI (c) Cl (d)…

A: Rules for assigning R and S notation  •  Arrange the groups/atoms attached to the stereo centre…

Q: Draw the stereoisomers for the compound CICH2CH2CHBrCH2C(OH)=CHC(CH3)3. Label the chiral centre with…

A: Given:-     We know that total stereoisomers is given as  = 2n  where n = number of stereocenter.…

Q: Keppra (shown below) is a pharmaceutical used to treat seizures (epilepsy). How many asymmetric…

A: The asymmetric center is that carbon in the molecule or compound which is attached to 4 different…

Q: 5. a) How many stereocenters does this compound have? CH¸Br b). How many stereoisomers are possible…

A:

Q: How many asymmetric centers does the following compound have? CH(CH32 H3Cmm H3C H. Select one: О а.1…

A: Asymmetric center:  An asymmetric center has all the four different substitutents.  To find out…

Q: What is the maximum number of stereoisomers possible for each compound?

A: The maximum number of stereoisomers that a molecule can have is 2n  where n is the number of…

Q: How many chiral centers are there in the following molecule (the naturally occurring stereoisomer is…

A:

Q: 8. For each pair of structures shown, indicate whether the two species are constitutional isomers,…

A: Constitutional isomers are those which have the same molecular formula but different connectivity.…

Q: 5.44 Indicate a plane of symmetry for each molecule that contains one. A molecule may require…

A: Symmetry in the molecules is described by using some geometrical entity like plane, point, axis etc.…

Q: Allegra (shown below) is a pharmaceutical used for allergy relief. How many asymmetric centers are…

A: Since you have posted multiple questions, we are entitled to answer the first only.

Q: Which of the following compounds has an asymmetric center? a. CH3CH2CHCH3-Cl  b. CH3CH2CHCH3-CH3  c.…

A:

Q: How many stereoisomers (count only carbon sp3 chiral centers) are there in cabergoline, a drug used…

A: we need to calculate the number of stereoisomers

Q: Chloramphenicol is a broad-spectrum antibiotic that is particularly useful against typhoid fever.…

A:

Q: Ephedrine (2‑methylamino‑1‑phenylpropanol) is a drug that is used as a decongestant and…

A: Chirality centre is the carbon in any molecule which is having 4 different groups attached to the…

Q: The general formula for alkanes is CnH2n+2. What is the value of n in 3,7-dimethyldecane? How many…

A: The structure of 3,7-dimethyldecane is drawn with chiral centers are indicated.

Q: 4. Draw the compound, 2-pentanol, shown on the PubChem website. Label any stereocenter(s) as to…

A: The chemical formula of 2-pentanol: CH3-CH(OH)-CH2-CH2-CH3. The compound 2-pentanol is having a…

Q: 6. How many asymmetric centers does the compound shown below have? CH3 CI

A: Asymmetric centers  are atoms having spatial arrangements of atoms that are non-superimposable…

Q: 9) drug shown below: Select the correct number of chirality centers in heroin, the illicit A) 4 B) 5…

A:

Q: 5) Which of the following compounds have an asymmetric center? A) CH3 B) CI -CI CH-CH; C) D) E) ÇI…

A: The chiral center or asymmetric center:If the molecule contains a carbon atom attached with four…

Q: Will the following compound show any optical activity if there is restricted rotation along the…

A: Biphenyls are those compounds in which two benzene rings are joined to each other by a carbon carbon…

Q: 1) How many asymmetric centers does the following compound have? CH(CH3)2 H3Cmm H. I

A: Asymmetric carbon :-  A carbon which is bonded to four different atoms or groups is called…

Q: Which compound does not have a plane of symmetry?

A: Plane of symmetry is the plane which will pass through the molecule in such a way that the molecule…

Q: Mevacor is used clinically to lower serum cholesterol levels. How many asymmetric centers does…

A: Mevacor is used clinically to lower serum cholesterol levels. The number of asymmetric centers that…

Q: HO, N.

A: In the above compound if the following conditions are available or not is presented below. Whether…

Q: How many asymmetric/chiral centers are found Butaclamol? This drug is a potent antipsychotic and has…

A:

Q: 11) Label each carbon center as a "R" or "S" center in the following molecules H Br Br XX Ph CN O ON…

A: Since you have asked multiple type questions, we will solve only first  questions for you. If you…