PCl3(l)+H2O(l)→H3PO3(aq)+HCl(aq) Express your answer as a chemical equation. Identify all of the phases in your answer

Q: ZnO(s) Zn(1) + O2 (g) Express your answer as a chemical equation. Identify all of the phases in your…

A: Given :-  ZnO(s) + ∆ → Zn(l) + O2(g)  To balance :-  Given equation

Q: Pb(NO3)2(aq) + 2KCl(aq) Express your answer as a balanced chemical equation. Identify all of the…

A: Given,

Q: How many phases are present in the following systems? Also define each of the erminologies…

A: Phases They are the homogeneous and distinct of a system without the visible boundary. Phase diagram…

Q: Pb(NO3)2(aq) + 2KC1(ag) Express your answer as a balanced chemical equation. Identify all of the…

A: In general chemical reaction are written in equation form In a chemical equation left side…

Q: АСTIVITY 2 - а3 Interpreting a Phase Diagram Refer to the following phase diagram of a certain…

A: We are authorized to answer the first three subparts of a question at a time. Since you have not…

Q: When potassium sulfite dissolves in water, the sulfite ion SO2−3 acts as a base. Write a balanced…

A: The equation containing identical number of species reacting as well as species produced and their…

Q: F. 150 135 120 105 90 75 C 60 45 30YA 15 Heat (kJ) Created by E. Lee for Virtual Virginia (2021)…

A: This curve is the example of heating curve. This is because in y direction temperature is increasing…

Q: 4(a) For each of the following substances describe the importance of dipole-dipole interactions and…

A: Intermolecular forces like London dispersion force (LDF), dipole-dipole interactions and hydrogen…

Q: a) For Mn3+, write an equation that shows how the cation acts as an acid. Express your answer as a…

A: According to Arrhenius acid theory ‘acid is that chemical compound which increases the concentration…

Q: Qs2. You are given two similar looking white, organic crystalline solids and determine their melting…

A: Given information:The two organic compounds are similar in nature and melting points of first and…

Q: A certain liquid X has a normal boiling point of 146.10°C and a boiling point elevation constant…

A: Normal boiling point of the liquid, Tb° = 146.10 oC Elevated boiling point of the liquid,  Tb =…

Q: The surface tension and viscosity values for diethyl ether, acetone, ethanol, and ethylene glycol…

A: Intermolecular forces are the attraction forces present between the molecules, which is responsible…

Q: HF(aq)HF(aq) and Ba(OH)2(aq)Ba(OH)2(aq) Express your answer as a balanced chemical equation.…

A: Given, HF(aq) and Ba(OH)2(aq)

Q: C5H6O(l)+O2(g)→CO2(g)+H2O(g)C5H6O(l)+O2(g)→CO2(g)+H2O(g) Express your answer as a balanced chemical…

A: Chemical equation is the representation of a chemical reaction, in which the reactants and products…

Q: H3PO4(aq)+Sr(OH)2(aq)→ Express your answer as a chemical equation. Identify all of the phases in…

A: We are given incomplete reactions we have to complete and balance the chemical reactions.

Q: HCI(ag) + Mg(s)¬MgCl2(aq) + H2(9) Express your answer as a chemical equation. Identify all of the…

A:

Q: A phase is a physical property of which describes the distance of molecules of matter. Phase also…

A: The given statements are :  Statement. 1 :- A phase is a physical property of which describes the…

Q: Question attached

A: Acid react with a base to form salt and water.

Q: Given the following data, what is the boiling point of CCI4 in °C? Round to the nearest integer (no…

A: The thermodynamic data given is,

Q: 5. In the Dumas method for determining the molar mass of an unknown volatile liquid, a sample of a…

A: We have find out the molar mass of the unknown and   temperature be when the pressure is 1.20 atm…

Q: 2. During a phase change, what properties change? Mass Volume Temperature Heat

A: There are three phases of matter. The phase of matter can be interchanged by changing the…

Q: A 145.3145.3 mL sample of carbon dioxide was heated to 301301 K. If the volume of the carbon dioxide…

A:

Q: HCl(aq)+Ba(OH)2(aq)→  Express your answer as a chemical equation. Identify all of the phases in your…

A:

Q: How long (in seconds) would it take a 50.0 watt (1 watt = 1 J/s) heater to melt 10.02 g of Au(s)…

A: Given : Mass of gold = 10.02 g Initial temperature of gold = melting point temperature = 1064 oC…

Q: The liquid phase is represented by which of the following letters A) T B) x C) w D) y

A: x is the area that represent liquid phase.

Q: Determination of the Surface Tension of a Liquid by the Capillary Rise Method: A group of students…

A: Surface tension of benzene = 28.39 dyne /cm surface tension of chloroform = 19.17 dyne/cm surface…

Q: Which answer best describes the redistribution of matter or energy when melting takes place? more…

A: The question can be answered by considering one of the important thermodynamic concept such as…

Q: The following defined relationships describe an antiquated set of British liquid units: 1 hogshead =…

A: Given : value in hogshead = 144  The relationships given are  1) 1 hogshead = 7 firkin 2) 1 firkin =…

Q: Q2/ For a 97.5 wt% Fe-2.5 wt% C at a temperature 700 oC, determine the following: a) The Number and…

A:

Q: NH4NO3(s)→N2O(g)+H2O(l)NH4NO3(s)→N2O(g)+H2O(l) Express your answer as a balanced chemical equation.…

A: Chemical equation is the representation of a chemical reaction, in which the reactants and products…

Q: After performing an experiment to know if the ice cubes will sink or float in two separate jars…

A: An experiment was performed to know wheather the ice cubes will sink or float in two separate jars…

Q: H,SO, (ag) and KOH(og) Express your answer as a chemical equation. Identify all of the phases in…

A: H2SO4 is acid while KOH is base so this is a type of neutralisation reaction . Generally these all…

Q: K2O(s)+H2O(l)→KOH(aq)K2O(s)+H2O(l)→KOH(aq) Express your answer as a balanced chemical equation.…

A: The given unbalanced chemical equation is represented as follows:

Q: Write a balanced equation for the complete combustion of table sugar (sucrose, C12 H22O11). Use…

A:

Q: prepare 2.200 g FeTiO3, assuming the reaction goes to completion. a)Write a balanced chemical…

A:

Q: help

A: Moon phases or Lunar phases changes over a period of time in approximately one month. The shape of…

Q: Al(s) + Cl2 (g)→AlCl3 (s) Express your answer as a chemical equation. Identify all of the phases in…

A: 2 Al(s) +3 Cl2 (g) -------> 2 AlCl3 (s)

Q: HClO4(aq)+NaOH(aq)→ Express your answer as a chemical equation. Identify all of the phases in your…

A: The acid react with base to form salt and water , called as neutralization reaction.

Q: Describe the relative densities of the phases for most substances. density of gas phase density of…

A: The relative densities of solid, liquid and gas can be explained on the basis of packing of…

Q: Organic molecules change phases above 300°C. O True O False

A: Organic molecule chnges phases

Q: Fe(s)+S8(s)→Fe2S3(s) Express your answer as a chemical equation. Identify all of the phases in your…

A: The given unbalanced equation is : Fe(s) + S8(s) → Fe2S3(s)

Q: Express your answer as a balanced chemical equation. Identify all of the phases in your answer.

A:

Q: Ca(s)+Br2(l)⟶CaBr2(s)  Express your answer as a chemical equation. Identify all of the phases in…

A: The equation is already balanced, so the answer is:Ca(s)+Br2(l)⟶CaBr2(s) As the number of atoms are…

Q: |DX| Pressure (not to scale) Temperature (not to scale) a. identify the states present at points a,…

A: INTRODUCTION: The P–T phase diagram of a sample of which is shown in the diagram displays stability…

Q: C3H6(g)+O2(g)→CO2(g)+H2O(g)C3H6(g)+O2(g)→CO2(g)+H2O(g) Express your answer as a balanced chemical…

A: A combustion reaction is a reaction in which a substance reacts with oxygen to give carbon dioxide…

Q: Human cells obtain energy from a reaction called cellular respiration. Balance the skeletal equation…

A: Given, Human cells obtain energy from a reaction called cellular respiration. The skeletal equation…

Q: Mg(s) + Br2 (1) → MgBr2 (s) Express your answer as a chemical equation. Identify all of the phases…

A: The given reaction is,

Q: Na(s)+H2O(l)→NaOH(aq)+H2(g)Na(s)+H2O(l)→NaOH(aq)+H2(g) Express your answer as a chemical equation.…

A: