Phosgene (COCI,) is an important intermediate in the manufacture of certain plastics. It is produced by the reaction CO(g) + Cl(g) 2 COC,(g) (a) Use the law of mass action to write the equilibrium expression for this reaction. (b) At 600°C, the equilibrium constant for this reaction is 0.20. Calculate the partial pressure of phosgene in equilibrium with a mixture of CO (at 0.0020 atm) and Cl, (at 0.00030 atm).

Phosgene (COCI,) is an important intermediate in the manufacture of certain plastics. It is produced by the reaction CO(g) + Cl(g) 2 COC,(g) (a) Use the law of mass action to write the equilibrium expression for this reaction. (b) At 600°C, the equilibrium constant for this reaction is 0.20. Calculate the partial pressure of phosgene in equilibrium with a mixture of CO (at 0.0020 atm) and Cl, (at 0.00030 atm).

Principles of Modern Chemistry

8th Edition

ISBN:9781305079113

Author:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Publisher:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Chapter14: Chemical Equilibrium

Section: Chapter Questions

Problem 76AP: Methanol can be synthesized by means of the equilibriumreaction CO(g)+2H2(g)CH3OH(g) for which the...

See similar textbooks

Similar questions

Methanol can be synthesized by means of the equilibriumreaction CO(g)+2H2(g)CH3OH(g) for which the equilibrium constant at 225°C is 6.08103. Assume that the ratio of the pressures of CO(g) and H2(g) is 1:2. What values should they have if the partial pressureof methanol is to be 0.500 atm?
Show that the complete chemical equation, the total ionic equation, and the net ionic equation for the reaction represented by the equation KI(aq)+I2(aq)KI3(aq) give the same expression for the reaction quotient. KI3 is composed of the ions K+ and I3-.
For the system SO3(g)SO2(g)+12 O2(g)at 1000 K, K=0.45. Sulfur trioxide, originally at 1.00 atm pressure, partially dissociates to SO2 and O2 at 1000 K. What is its partial pressure at equilibrium?
A sample of gaseous nitrosyl bromide (NOBr) was placed in a container tiued with a frictionless, massless piston, where it decomposed at 25C according to the following equation: 2NOBr(g)2NO(g)+Br2(g) The initial density of the system was recorded as 4.495 g/L. After equilibrium was reached, the density was noted to be 4.086 g/L. a. Determine the value of the equilibrium constant K for the reaction. b. If Ar(g) is added to the system at equilibrium at constant temperature, what will happen to the equilibrium position? What happens to the value of K? Explain each answer
The following data were collected for a system at equilibrium at 140°C. Calculate the equilibrium constant for the reaction, 3 H2(g) + N2(g) 5=^ 2 NHt(g) at this temperature. [H2] = 0.10 mol L_1, [NJ = 1.1 mol L"1, [NHJ = 3.6 X 10"-mol L'1
Describe a nonchemical system that is in equilibrium, and explain how the principles of equilibrium apply to the system.
The following equilibrium was studied by analyzing the equilibrium mixture for the amount of H2S produced. Sb2S3(s)+3H2(g)2Sb(s)+3H2S(g) A vessel whose volume was 2.50 L was filled with 0.0100 mol of antimony(III) sulfide, Sb2S3, and 0.0100 mol H2. After the mixture came to equilibrium in the closed vessel at 440C, the gaseous mixture was removed, and the hydrogen sulfide was dissolved in water. Sufficient lead(II) ion was added to react completely with the H2S to precipitate lead(II) sulfide, PbS. If 1.029 g PbS was obtained, what is the value of Kc at 440C?
Write the equilibrium constant expression for each reaction in terms of activities, simplifying where appropriate. a C(s)+O2(g)CO2(g) b P4(s)+5O2(g)P4O10(s) c 2HNO2(g)+3Cl2(g)2NCl3(g)+H2(g)+2O2(g)
The equilibrium constant for the butane iso-butane equilibrium at 25 C is 2.50. Calculate rG at this temperature in units of kJ/mol.
A student studies the equilibrium I2(g)2I(g)at a high temperature. She finds that the total pressure at equilibrium is 40% greater than it was originally, when only I2 was present. What is K for this reaction at that temperature?