Predict the reactants of this chemical reaction. That is, fill in the left side of the chemical equation. Be sure the equation you submit is balanced. (You can edit both sides of the equation to balance it, if you need to.) Note: you are writing the molecular, and not the net ionic equation. KI (aq) + H,O(1) O-0

Predict the reactants of this chemical reaction. That is, fill in the left side of the chemical equation. Be sure the equation you submit is balanced. (You can edit both sides of the equation to balance it, if you need to.) Note: you are writing the molecular, and not the net ionic equation. KI (aq) + H,O(1) O-0

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter3: Chemical Reactions

Section3.4: Acid-base Reactions

Problem 3.10PSP: Write a balanced equation for the reaction of hydroiodic acid, HI, with calcium hydroxide, Ca(OH)2....

See similar textbooks

Similar questions

Thioridazine, C21H26N2S2, is a pharmaceutical agent used to regulate dopamine (Dopamine, a neurotransmitter, affects brain processes that control movement emotional response, and ability to experience pleasure and pain.) A chemist can analyze a sample of the pharmaceutical for the thioridazine content by decomposing it to convert the sulfur in the compound to sulfate ion. This is then trapped as water-insoluble barium sulfate (see Figure 4.4). SO42(aq, from thioridazine) + BaCl2(aq) BaSO4(s) + 2 Cl(aq) Suppose a 12-tablet sample of the drug yielded 0.301 g of BaSO4. What is the thioridazine content, in milligrams, of each tablet?
One of the ways to remove nitrogen monoxide gas, a serious source of air pollution, from smokestack emissions is by reaction with ammonia gas, NH3. The products of the reaction, N2 and H2O, are not toxic. Write the balanced equation for this reaction. Assign an oxidation number to each element in the reactants and products, and indicate which element is oxidized and which is reduced.
Phosphoric acid, H3PO4, can be prepared by the reaction of phosphorus(V) oxide, P4O10, with water. 14P4O10(s)+32H2O(l)H3PO4(aq);H=96.2kJ What is H for the reaction involving 1 mol of P4O10? P4O10(s)+6H2O(l)4H3PO4(aq)
Balance each of the following equations, and then write the net ionic equation. Show states for all reactants and products (s, . g, aq). (a) the reaction of sodium hydroxide and iron(II) chloride to give iron(II) hydroxide and sodium chloride (b) the reaction of barium chloride with sodium carbonate to give barium carbonate and sodium chloride (c) the reaction of ammonia with phosphoric acid
You take 1.00 g of an aspirin tablet (a compound consisting solely of carbon, hydrogen, and oxygen), burn it in air, and collect 2.20 g CO2 and 0.400 g H2O. You know that the molar mass of aspirin is between 170 and 190 g/mol. Reacting 1 mole of salicylic acid with I mole of acetic anhydride (C4H6O3) gives you 1 mole of aspirin and 1 mole of acetic acid (C2H4O2). Use this information to determine the molecular formula of salicylic acid.
Write balanced equations for the reaction of sulfur with the following metals to form solids that you can take to be ionic when the anion is S2-. (a) potassium (b) magnesium (c) aluminum (d) calcium (e) iron (forming Fe2+ ions)
What is the mass of fish, in kilograms, that one would have to consume to obtain a fatal dose of mercury, if the fish contains 30 parts per million of mercury by weight? (Assume that all the mercury from the fish ends up as mercury (II) chloride in the body and that a fatal dose is 0.20 g of HgCl2.) How many pounds of fish is this?
Vitamin C is ascorbic acid, HC6H7O6, which can be titrated with a strong base. HC6H7O6(aq) + NaOH(aq) NaC6H7O6(aq) + H2O() A student dissolved a 500.0-mg vitamin C tablet in 200.0 mL water and then titrated it with 0.1250-M NaOH. It required 21.30 mL of the base to reach the equivalence point. Calculate the mass percentage of the tablet that is impurity.
4.22 Generally, an excess of O2 is needed for the reaction Sn+O2SnO2 . What is the minimum number of moles of oxygen required to oxidize 7.3 moles of tin?
Write a balanced equation for (a) the combustion (reaction with oxygen gas) of glucose, C6H12O6, to give carbon dioxide and water. (b) the reaction between xenon tetrafluoride gas and water to give xenon, oxygen, and hydrogen fluoride gases. (c) the reaction between aluminum and iron(III) oxide to give aluminum oxide and iron. (d) the formation of ammonia gas from its elements. (e) the reaction between sodium chloride, sulfur dioxide gas, steam, and oxygen to give sodium sulfate and hydrogen chloride gas.