Question - Balance the following chemical equations: C8H18 + O2 ---> CO2 + H2O When you complete and balance the specific equation, give the following information: • Give the balanced chemical equation. • List the amount of each element you have when the equation is balanced. • The order of the elements that you balanced the equation with. • Explain how you know which coefficient to use for the specific compound.

Question - Balance the following chemical equations: C8H18 + O2 ---> CO2 + H2O When you complete and balance the specific equation, give the following information: • Give the balanced chemical equation. • List the amount of each element you have when the equation is balanced. • The order of the elements that you balanced the equation with. • Explain how you know which coefficient to use for the specific compound.

Introductory Chemistry: A Foundation

9th Edition

ISBN:9781337399425

Author:Steven S. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Donald J. DeCoste

Chapter9: Chemical Quantities

Section: Chapter Questions

Problem 4QAP: hich of the following statements is true for the reaction of nitrogen gas with hydrogen gas to...

See similar textbooks

Similar questions

You have a chemical in a sealed glass container filled with air. The setup is sitting on a balance as shown below. The chemical is ignited by means of a magnifying glass focusing sunlight on the reactant. After the chemical has completely burned, which of the following is true? Explain your answer. a. The balance will read less than 250.0 g. b. The balance will read 250.0 g. c. The balance will read greater than 250.0 g. d. Cannot be determined without knowing the identity of the chemical.
Solid calcium carbide (CaC2)reacts with liquid water to produce acetylene gas (C2H2)and aqueous calcium hydroxide. l type='a'> Write the balanced equation for the reaction that is (occurring. including all phases. If a 100.0-g sample of calcium carbide (CaC2)is initially reacted with 50.0 g of water, which reactant is limiting? Prove that mass is conserved for the reactant amounts used in pan b.
Fig. 5-5 illustrates a schematic diagram of a combustion device used to analyze organic compounds. Given that a certain amount of a compound containing carbon, hydrogen, and oxygen is combusted in this device, explain how the data relating to the mass of CO2 produced and the mass of H2O produced can be manipulated to determine the empirical formula.
Bacterial digestion is an economical method of sewage treatment. The reaction is an intermediate step in the conversion of the nitrogen in organic compounds into nitrate ions. What mass of bacterial tissue is produced in a treatment plant for every 1.0 104 kg of wastewater containing 3.0% NH4+ ions by mass? Assume that 95% of the ammonium ions are consumed by the bacteria.
Balance the following equations: (a) PCl5(s)+H2O(l)POCl3(l)+HCl(aq) (b) Cu(s)+HNO3(aq)Cu( NO3)2(aq)+H2O(l)+NO(g) (c) H2(g)+I2(s)HI(s) (d) Fe(s)+O2(g)Fe2O3(s) (e) Na(s)+H2O(l)NaOH(aq)+H2(g) (f) ( NH4)2Cr2O7(s)Cr2O3(s)+N2(g)+H2O(g) (g) P4(s)+Cl2(g)PCl3(l) (h) PtCl4(s)Pt(s)+Cl2(g)
A common method for analyzing for the nickel content of a sample is to use a precipitation reaction. Adding the organic compound dimethylgly-oxime to a solution containing Ni2+ ions precipitates a red solid. Derive the empirical formula for the red solid based on the following composition: Ni, 20.315%; C, 33.258%; H, 4.884%; 0, 22.151%; and N, 19.392%.
hat happens to the weight of an iron bar when it rusts? l type='a'> There is no change because mass is always conserved. i>The weight increases. i>The weight increases, hut it the rust is scraped off, the bar has the original weight. i>The weight decreases. stify your choice and, for choices you did not pick, explain what is wrong with them. Explain what it means for something to rust.
The following pictures show a molecular-scale view of a chemical reaction between the compounds AB2 and B2. (A at-oms are shown in blue and B atoms in white). The box on the left represents the box on the right shows what is left once the reaction has gone to completion. Write a balanced chemical equation for this reaction. As usual, your equation should use the smallest possible whole number coefficients for all substances.
The pictures below show a molecular-scale view of a chemical reaction between H2 and CO to produce methanol, CH3OH The box on the left represents the reactants at the instant of mixing, and the box on the right shows what is left once the reaction has gone to completion. D Was there a limiting reactant in this reaction? If so, what was it? Write a balanced chemical equation for this reaction. As usual, your equation should use the smallest possible whole number coefficients for all substances.
The active ingredient in some antiperspirants is aluminum chlorohydrate, Al2(OH)5Cl. Analysis of a 2.000-g sample of antiperspirant yields 0.334 g of aluminum. What percent (by mass) of aluminum chlorohydrate is present in the antiperspirant? (Assume that there are no other compounds containing aluminum in the antiperspirant.)
Lead(ll) oxide is obtained by roasting galena, lead(ll) sulfide, in air. The unbalanced equation is: PbS(s)+O2(g)PbO(s)+SO2(g) ) a. Balance the equation, and determine the theoretical yield of PbO if 200.0 g of PbS is heated. b. What is the percent yield if 170.0 g of PbO is obtained?
hich of the following statements is true for the reaction of nitrogen gas with hydrogen gas to produce ammonia (NH3)? Choose the best answer. l type='a'> Subscripts can be changed to balance this equation, just as they can he changed to balance the charges when writing the formula for an ionic compound. i>The nitrogen and hydrogen will not react until you have added the correct mole ratios. i>The mole ratio of nitrogen to hydrogen in the balanced equation is 1:2. i>Ammonia will not form unless 1 mole of nitrogen and 3 moles of hydrogen have been added. i>The balanced equation allows you to predict how much ammonia you will make based on the amount of nitrogen and hydrogen present.