Solid ammonium chloride, NH Cl, is formed by the reaction of gaseous ammonia, NH,, and hydrogen chloride, HCl.NH, (g) + HCl(g)→ NH,C(s)A 4.64 g sample of NH, gas and a 4.64 g sample of HCl gas are mixed in a 0.50 L flask at 25 °C.Identify the limiting reagent.NH,CINH3HCIHow many grams of NH Cl will be formed by this reaction?mass:What is the pressure in atmospheres of the gas remaining in the flask? Ignore the volume of solid NH, Cl produced bythe reaction.atmP =

Given: When ammonia gas reacts with hydrogen chloride, solid ammonium chloride is formed. The…

Solid ammonium chloride, NH CI, is formed by the reaction of gaseous ammonia, NH,, and hydrogen chloride, HCI. NH, (g) + HCI(g) → NH,Cl(s) A 4.64 g sample of NH, gas and a 4.64 g sample of HCl gas are mixed in a 0.50 L flask at 25 °C. Identify the limiting reagent. NH CI NH, HCI How many grams of NH Cl will be formed by this reaction? mass: What is the pressure in atmospheres of the gas remaining in the flask? Ignore the volume of solid NH,Cl produced by the reaction. P =

Solid ammonium chloride, NH CI, is formed by the reaction of gaseous ammonia, NH,, and hydrogen chloride, HCI. NH, (g) + HCI(g) → NH,Cl(s) A 4.64 g sample of NH, gas and a 4.64 g sample of HCl gas are mixed in a 0.50 L flask at 25 °C. Identify the limiting reagent. NH CI NH, HCI How many grams of NH Cl will be formed by this reaction? mass: What is the pressure in atmospheres of the gas remaining in the flask? Ignore the volume of solid NH,Cl produced by the reaction. P =

Introductory Chemistry: A Foundation

9th Edition

ISBN:9781337399425

Author:Steven S. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Donald J. DeCoste

Chapter13: Gases

Section: Chapter Questions

Problem 157CP

See similar textbooks

Similar questions

You have a gas, one of the three known phosphorus-fluorine compounds (PF3, PF3, and P2F4). To find out which, you have decided to measure its molar mass. (a) First, yon determine that the density of the gas is 5.60 g/L at a pressure of 0.971 atm and a temperature of 18.2 C. Calculate the molar mass and identify the compound. (b) To check the results from part (a), you decide to measure the molar mass based on the relative rales of effusion of the unknown gas and CO2. You find that CO2 effuses at a rate of 0.050 mol/min, whereas the unknown phosphorus fluoride effuses at a rate of 0.028 mol/min. Calculate the molar mass of the unknown gas based on these results.
A student prepares phosphorous acid, H3PO3, by reacting solid phosphorus triiodide with water. PI3(s)+3H2O(l)H3PO3(s)+3HI(g) The student needs to obtain 0.250 L of H3PO3(d=1.651g/cm3). The procedure calls for a 45.0% excess of water and a yield of 75.0%. How much phosphorus triiodide should be weighed out? What volume of water (d=1.651g/cm3) should be used?
What volume (in liters) of O2, measured at standard temperature and pressure, is required to oxidize 0.400 mol of phosphorus (P4)? P4(s) + 5 O2(g) P4O10(s)
A mixture contained zinc sulfide, ZnS, and lead sulfide, PbS. A sample of the mixture weighing 6.12 g was reacted with an excess of hydrochloric acid. The reactions are ZnS(s)+2HCL(aq)ZnCl2(aq)+H2S(g)PbS(s)+2HCL(aq)PbCl2(aq)+H2S(g) If the sample reacted completely and produced 1.049 L of hydrogen sulfide, H2S, at 23C and 762 mmHg, what were the percentages of ZnS and PbS in the mixture?
Pyruvic acid, HC3H3O3, is involved in cell metabolism. It can be assayed for (that is, the amount of it determined) by using a yeast enzyme. The enzyme makes the following reaction go to completion: HC3H3O3(aq)C2H4O(aq)+CO2(g) If a sample containing pyruvic acid gives 21.2 mL of carbon dioxide gas, CO2, at 349 mmHg and 30C, how many grams of pyruvic acid are there in the sample?
Consider the general chemical equation 2A+3B→5C+D. Part A. How many moles of C are produced from 2 mol of A? Express your answer as an integer and include the appropriate units. Part B. How many liters of gas B must react to give 1 L of gas D at the same temperature and pressure? Express your answer as an integer and include the appropriate units.
Carbon monoxide gas reacts with hydrogen gas to form methanol:CO(g) + 2 H2(g) -------> CH3OH(g)A 1.50-L reaction vessel, initially at 305 K, contains carbon monoxide gas at partial pressure of 232 mmHg and hydrogen gas at a partial pressure of 397 mmHg. Identify the limiting reactant and determine the theoretical yield of methanol in grams.