Suppose that sin α = 12/13 for a quadrant II angle α and sin β = 3/5 for a quadrant I angle β. Find the exact value of cos α.

Q: If  alpha is a Quadrant IV angle with cos(alpha)=sqrt(5)/5 and sin(beta)=sqrt(10)/10, where…

A:

Q: What is cos 0 if 0 is an angle in the second quadrant and sin 0 = V3 7 A

A:

Q: Use the given conditions tan u = −5/12, 3π/2 < u < 2π to (a) determine the quadrant in which…

A: Given tanu =-5/12 , 3pi/2<u<2pi.   To determine sin(u/2) , cos(u/2) and tan(u/2)

Q: If sin(x) = (in Quadrant-I), find 6. sin(2æ) = %3D

A: Given equation is: sinx=56 ; (x lies in Quadrant-I) We will use the following identities: (1) cos x…

Q: If sin e= and 0<es, find the exact value of tan 20. %3D 4 24 24 4

A: Given,        sinθ=35 and 0≤θ≤π2

Q: 8. and If sin a =- 17 cos ß = for a second-quadrant angle a and a third-quadrant angle ß, find the…

A: solution is given below..

Q: Suppose cos 2 A , and 2A is an angle in the Second Quadrant. Then cos A Give the EXACT value.

A:

Q: Given an acute angle Cosx=2/7, find the exact value of cos(x/2). (Use a half-angle formula)

A: As we know from the half angle formula; cosx2=±1+cosx2   Given; cosx=27

Q: Find sin 8, cos 0, and tan 0 for the angle = -135°.

A:

Q: 119 Suppose that is an angle in quadrant 4 and that cos B 2 Compute the exact value of 169 %3D (2).…

A:

Q: Use a calculator to find the value of the acute angle θ to the nearest degree, sin u = 0.2974

A: According to the question, we have to find the value of sin u=0.2974 to the nearest degree using…

Q: For an acute angle 0 , the equation sin (0) = cos (6) is true. What is the value of 0 ?

A: If both the angles x and y are acute then    sin x=cos y⇒sin x =sin 90°-y⇒x=90°-y⇒x+y=90°For an…

Q: What are the values of cos a and tan a, if a is the measure of an acute angle in triangle and sin a…

A: See the details solution in below

Q: Use the given conditions to find the exact values of sin(2u), cos(2u), and tan(2u) using the…

A:

Q: Find the smallest positive angle such that sin 2a = cos 3a %3|

A: As per our guidelines we can solve only one question. Rest question can be reposted.  Here in…

Q: Suppose, for a given angle 0, we know that tan(0) = -5/3 and cos(0) > O. Find the exact value of…

A:

Q: For an acute angle 0, the equation sin(8)=cos(6) is true. What is the value of 0?

A: solution  given below..

Q: 2. Demonstrate that the double angle formula for sin2x is derived from the compound angle formula…

A: Double angle formula for sin2x is sin2x=2sinxcosx. and compound angle formula for sin(a+b) is…

Q: Given that sin e = 3/5 and tan 0 < 0. Find sin 20.

A: Consider: sin θ=35 and tan θ&lt;0. Find sin 2θ. Since sin θ=35&gt;0 and tan θ&lt;0 implies θ lies in…

Q: Find cos (2 θ) , if sin θ=15/17 and θ lies in quadrant I

A: sin² (x) + cos² (x) = 1 cos(2x) = cos² (x) - (1 - cos²(x)) = 2cos²(x) - 1

Q: If sin x = r in quadrant III, then sin 2x = Cos 2x tan 2x %3D

A:

Q: If sin 0 + cose =p and sec 0 + cosece = q,show that q (,? – 1) = 2p

A:

Q: If tan 0 = and cot ß = - for 0 in Quadrant Il and B in Quadrant II, find cos(0 – B). %3D 24 4

A: Given that

Q: Find the exact values of the remaining trig functions if sin a =4/5  and a is an acute angle.

A: Given sina=45 where, 'a' is an acute angle

Q: Suppose that a and ß are in the first quadrant, sin(a) = , and sin(B) = . What is sin(a + B)?

A: cos2α=1-sin2α sinα+β=sinαcosβ+cosαsinβ

Q: If x is a positive acute angle and sin x = 1/2 , what is sin2x

A: We have to find what is sin2x. We know that

Q: For positive acute angles A and B, it is known that tan A = and 5 cos B=3. Find the value of sin(A -…

A: Sol:- tan(A)=pb=409 ; h = 402+92=41Therefore , sin(A)=ph=4041cos(B)=bh=513 ; p = 132-52=12Therefore…

Q: Given that A is obtuse and B is reflex angles and sin A=12/13 and cosB=3/5 without using…

A: Trigonometry

Q: Calculate Sin(15°) in two ways: a)Using half-angle formulae. b)Using angle difference formulae.

A:

Q: Find the exact value of Sin 20 given that 28 and e is in quadrant I. CosO =- 53 Sin 20=

A:

Q: If cos 0 0, what Quadrant is P(0) located?

A:

Q: Use the given information to find the exact value of the expression. sin θ = 15/17, θ lies in…

A:

Q: Question in image.

A: We have to find the value of cos(α + β) when sinα and tanβ are known.

Q: For positive acute angles A and B, it is known that sin A = 1 and 15 17 cos B Find the value of…

A:

Q: Suppose that a and B are in the first quadrant, sin(a) = and sin(B) = What is sin(a + B)?

A: The solution is :

Q: Given that tan A= and sin(A B) = 2 cos(A– B), the exact values of %3D sin 2A = and tan B = %3D

A: To find Sin2A and tanB Given that tana=1/3 Sin(A+B)=2cos(A-B)

Q: If sin A = 15/17, sin B = 5/13, cosA = 8/17, andcosB = 12/13, what is the exact value of sin(A – B)…

A: Here we find the value of Sin(A-B)

Q: suppose α is an angle in the first quadrant and β = π + α. Evaluate sin−1(sin(β)). Show all work.

A: Given that α is an angle in the first quadrant. So, β = π + α is in the third quadrant.  So, sin(π +…

Q: For positive acute angles A and B, it is known that sin A = Find the value of sin(A - B) in simplest…

A: Use the Trigonometric identities to solve the question.

Q: 3VTO Given that sin(0) and 0 is in Quadrant II 10 what is sin(20)?

A:

Q: For what angles 0 between 0° and 360° is cos 0 = sin 0 true?

A:

Q: If csc(alpha)=3, where 0<alpha<pi/2, and  beta is a Quadrant II angle with tan(beta)=-7, find…

A: Given that, cscα=3, 0&lt;α&lt;π2, tanβ=-7. Calculate the value of tanα-β.   Here we use the…

Q: If sin a = 17 and cos B =- for a second-quadrant angle a and a third-quadrant angle B, find the 13…

A: Given :  sinα=817 cosβ=-513 We have to find out the value of sinα+β.  We know that…

Q: b) If sin e = 0.625 and cose = 0.500, determine, without using trigonotric tables or calculators,…

A:

Q: Use the given conditions to find the exact values of sin(2u), cos(2u), and tan(2u) using the…

A:

Q: Use the given conditions to find the exact values of sin(2u), cos(2u), and tan(2u) using the…

A: Given , sinu=-45,3π2&lt;u&lt;2πIn 3π2&lt;u&lt;2π , cosu is positivethen by pythagores theorem ,…

Q: If cos(θ)=1/3 and θ is in the 4th quadrant, find the exact value for sin(θ).

A:

Q: For an acute angle 0, given the equation sin(0) = cos( 38 ) What is the value of 0?

A: sin(90-θ) = cosθ

Q: Suppose that sin α = 12/13 for a quadrant II angle α and sin β = 3/5 for a quadrant I angle β. Find…

A: Since it is given that sin α=1213  for quadrant II angle α and sin (β)=35for a quadrant I angle…

Angles

In mathematics, angles constitute a very important part. Just like the concept of lines, an angle is a necessary figure that is used for measurement. How do you define its formation? It is formed when two or more lines meet at a point. The point at which two or more lines meet is known as the vertex. When the lines get inclined at this point, they do form various angles. Angles are measured from the vertex in terms of degrees.