The equilibrium constant, K, for the following reaction is 0.102 at 326 K. NH,HS(s) 2 NH3(g) + H2S(g) An equilibrium mixture in a 16.2 L container at 326 K contains 0.202 mol NH,HS(s), 0.434 M NH3 and 0.235 M H,S. What will be the concentrations of the two gases once equilibrium has been reestablished, if the equilibrium mixture is compressed at constant temperature to a volume of 6.82 L? [NH3] = %3D [H,S] = %3D The equilibrium constant, K, for the following reaction is 10.5 at 350 K. 2CH;Cl½(g) CH4(g) + CCl4(g) An equilibrium mixture of the three gases in a 1.00 L flask at 350 K contains 5.09x10-² M CH,Cl, 0.165 M CH4 and 0.165 M CCI4. What will be the concentrations of the three gases once equilibrium has been reestablished, if 9.95×10² mol of CH,(g) is added to the flask? [CH,Cl½] = M %3D [CH4] M [CCI4] M

The equilibrium constant, K, for the following reaction is 0.102 at 326 K. NH,HS(s) 2 NH3(g) + H2S(g) An equilibrium mixture in a 16.2 L container at 326 K contains 0.202 mol NH,HS(s), 0.434 M NH3 and 0.235 M H,S. What will be the concentrations of the two gases once equilibrium has been reestablished, if the equilibrium mixture is compressed at constant temperature to a volume of 6.82 L? [NH3] = %3D [H,S] = %3D The equilibrium constant, K, for the following reaction is 10.5 at 350 K. 2CH;Cl½(g) CH4(g) + CCl4(g) An equilibrium mixture of the three gases in a 1.00 L flask at 350 K contains 5.09x10-² M CH,Cl, 0.165 M CH4 and 0.165 M CCI4. What will be the concentrations of the three gases once equilibrium has been reestablished, if 9.95×10² mol of CH,(g) is added to the flask? [CH,Cl½] = M %3D [CH4] M [CCI4] M

Chemistry & Chemical Reactivity

10th Edition

ISBN:9781337399074

Author:John C. Kotz, Paul M. Treichel, John Townsend, David Treichel

Publisher:John C. Kotz, Paul M. Treichel, John Townsend, David Treichel

Chapter15: Principles Of Chemical Reactivity: Equilibria

Section: Chapter Questions

Problem 6PS: The equilibrium constant Kc, for the reaction 2 NOCI(g) 2 NO(g) + Cl2(g) is 3.9 103 at 300 C. A...

See similar textbooks

Similar questions

At 2300 K the equilibrium constant for the formation of NO(g) is 1.7 103. N2(g) + O2(g) 2 NO(g) (a) Analysis shows that the concentrations of N2 and O2 are both 0.25 M, and that of NO is 0.0042 M under certain conditions. Is the system at equilibrium? (b) If the system is not at equilibrium, in which direction does the reaction proceed? (c) When the system is at equilibrium, what are the equilibrium concentrations?
The following equilibrium was studied by analyzing the equilibrium mixture for the amount of H2S produced. Sb2S3(s)+3H2(g)2Sb(s)+3H2S(g) A vessel whose volume was 2.50 L was filled with 0.0100 mol of antimony(III) sulfide, Sb2S3, and 0.0100 mol H2. After the mixture came to equilibrium in the closed vessel at 440C, the gaseous mixture was removed, and the hydrogen sulfide was dissolved in water. Sufficient lead(II) ion was added to react completely with the H2S to precipitate lead(II) sulfide, PbS. If 1.029 g PbS was obtained, what is the value of Kc at 440C?
At room temperature, the equilibrium constant Kc for the reaction 2 NO(g) ⇌ N2(g) + O2(g) is 1.4 × 1030. Is this reaction product-favored or reactant-favored? Explain your answer. In the atmosphere at room temperature the concentration of N2 is 0.33 mol/L, and the concentration of O2 is about 25% of that value. Calculate the equilibrium concentration of NO in the atmosphere produced by the reaction of N2 and O2. How does this affect your answer to Question 11?
A solution is prepared by dissolving 0.050 mol of diiodocyclohexane, C5H10I2, in the solvent CCl4.The total solution volume is 1.00 L When the reaction C6H10I2 C6H10 + I2 has come to equilibrium at 35 C, the concentration of I2 is 0.035 mol/L. (a) What are the concentrations of C6H10I2 and C6H10 at equilibrium? (b) Calculate Kc, the equilibrium constant.
Kc for the decomposition of ammonium hydrogen sulfide is 1.8 104 at 25 C. NH4HS(s) NH3(g) + H2S(g) (a) When the pure salt decomposes in a flask, what are the equilibrium concentrations of NH3 and H2S? (b) If NH4HS is placed in a flask already containing 0.020 mol/L of NH3 and then the system is allowed to come to equilibrium, what are the equilibrium concentrations of NH3 and H2S?
The equilibrium constant Kc, for the reaction 2 NOCI(g) 2 NO(g) + Cl2(g) is 3.9 103 at 300 C. A mixture contains the gases at the following concentrations: [NOCl] = 5.0 103 mol/L, [NO] = 2.5 103 mol/L, and [Cl2] = 2.0 103 mol/L. Is the reaction at equilibrium at 300 C? If not, in which direction does the reaction proceed to come to equilibrium?
Nitrosyl chloride, NOC1, decomposes to NO and Cl2 at high temperatures. 2 NOCl(g) ⇌ 2 NO(g) + Cl2(g) Suppose you place 2.00 mol NOC1 in a 1.00–L flask, seal it, and raise the temperature to 462 °C. When equilibrium has been established, 0.66 mol NO is present. Calculate the equilibrium constant Kc for the decomposition reaction from these data.
Two molecules of A react to form one molecule of B, as in the reaction 2 A(g) B(g) Three experiments are done at different temperatures and equilibrium concentrations are measured. For each experiment, calculate the equilibrium constant, Kc. (a) [A] = 0.74 mol/L, [B] = 0.74 mol/L (b) [A] = 2.0 mol/L, [B] = 2.0 mol/L (c) [A] = 0.01 mol/L, [B] = 0.01 mol/L What can you conclude about this statement: If the concentrations of reactants and products are equal, then the equilibrium constant is always 1.0.
Because calcium carbonate is a sink for CO32- in a lake, the student in Exercise 12.39 decides to go a step further and examine the equilibrium between carbonate ion and CaCOj. The reaction is Ca2+(aq) + COj2_(aq) ** CaCO,(s) The equilibrium constant for this reaction is 2.1 X 10*. If the initial calcium ion concentration is 0.02 AI and the carbonate concentration is 0.03 AI, what are the equilibrium concentrations of the ions? A student is simulating the carbonic acid—hydrogen carbonate equilibrium in a lake: H2COj(aq) H+(aq) + HCO}‘(aq) K = 4.4 X 10"7 She starts with 0.1000 AI carbonic acid. What are the concentrations of all species at equilibrium?
Methanol, a common laboratory solvent, poses a threat of blindness or death if consumed in sufficient amounts. Once in the body, the substance is oxidized to produce formaldehyde (embalming fluid) and eventually formic acid. Both of these substances are also toxic in varying levels. The equilibrium between methanol and formaldehyde can be described as follows: CH3OH(aq)H2CO(aq)+H2(aq) Assuming the value of K for this reaction is 3.7 1010, what are the equilibrium concentrations of each species if you start with a 1.24 M solution of methanol? What will happen to the concentration of methanol as the formaldehyde is further converted to formic acid?
The experiment in Exercise 12.33 was redesigned so that the reaction started with 0.15 mol each of N2 and O2 being injected into a 1.0-L container at 2500 K. The equilibrium constant at 2500 K is 3.6 X 10“’. What was the composition of the reaction mixture after equilibrium was attained? The following reaction establishes equilibrium at 2000 K: N2(g) + O2(g) *2 2 NO K = 4.1 X IO-4 If the reaction began with 0.100 mol L-1 of N2 and 0.100 mol L-’ ofO2, what were the equilibrium concentrations of all species?
Consider 0.200 mol phosphorus pentachloride sealed in a 2.0-L container at 620 K. The equilibrium constant, Kc, is 0.60 for PCl5(g) PCl3(g) + Cl2(g) Calculate the concentrations of all species after equilibrium has been reached.