What is the formula of the complexcation? *+NH3WH3Cl CoCIH3NNH3O trans-[Co(NH,),Ci,]cis-[CoCl,(NH,)I*O cis-[Co(NH,),CI,]*O trans-[CoCl,(NH,),IWhich among the following is a Tt-acceptor ligand? *соO s-

Which of the given option is correct--

What is the formula of the complex cation? + NH3 H3N 'CI NH3 trans-[Co(NH,),CI,] cis-[CoCI,(NH,),I cis-[Co(NH,),CI]* O trans-[CoCl,(NH,), Which among the following is an- acceptor ligand? * CI H,0 co S2-

What is the formula of the complex cation? + NH3 H3N 'CI NH3 trans-[Co(NH,),CI,] cis-[CoCI,(NH,),I cis-[Co(NH,),CI]* O trans-[CoCl,(NH,), Which among the following is an- acceptor ligand? * CI H,0 co S2-

Chemistry by OpenStax (2015-05-04)

1st Edition

ISBN:9781938168390

Author:Klaus Theopold, Richard H Langley, Paul Flowers, William R. Robinson, Mark Blaser

Publisher:Klaus Theopold, Richard H Langley, Paul Flowers, William R. Robinson, Mark Blaser

Chapter19: Transition Metals And Coordination Chemistry

Section: Chapter Questions

Problem 40E: Is it possible for a complex of a metal in the transition series to have six unpaired electrons?...

See similar textbooks

Related questions

Q: 7) If you were to use a ligand L that was a stronger field ligand than NH3, what color would you…

A: Step : 1 The required answer is follows as :

Q: So I am working with an octahedral complex that has two weak field ligands (Cl) and 4 strong field…

Q: Which ordering correctly describes the tendency of a ligand to direct ligand substitution in a…

A: Trans effect can be defined as the effect of a ligand towards substitution on other ligands which is…

Q: 13. A complex ion has been observed which starts with a violet color with six aqua ligands attached.…

Q: If given the choice of a complexometric titrant among the choices below, which would be the best…

Q: (19) Which of the following statements is FALSE with respect to ligands? (A) (8) (C) (D) (E) A…

A: Transition metal complex is defined as complex in which ligand is bonded metal ion.

Q: What energy levels are occupied in a complex such ashexacarbonylchromium(0)? Are any electrons…

A: According to the molecular orbital theory, the atomic orbitals combine to form new molecular…

Q: Choose the more stable complex from each pair of the complexes? Show STEP BY STEP. Explain the…

A: Given that,

Q: EDTA is a hexadentate ligand containing four carboxylic acid groups and two amines. TRUE or FALSE:…

A: The question is based on the concept of complexometric titrations. we have to explain the properties…

Q: NH NH, NH, Terpyridyl (terpy) Bisethylenetriamine (tris) How do you expect these molecules to…

A: Denticity refers to the number of donor groups in a single ligand that bind to a central atom in a…

Q: . Consider the following compounds. For each formula, sketch each complex ion clearly showing the…

Q: Complex [Co(en):] [Co(CN)} [CoF6] [Co(NH;)6]* [Co(H2O),]*" Ao (cm ) 23,160 33,700 13,100 23,000…

A: 3. a. We have to tell among the given complexes, which two would be best explained by the σ-only…

Q: The compound 1,1,1-trifluoroacetylacetone (tfa- is a bidentate ligand: CF,CC H2CCH3 2+ It forms a…

Q: How many stereoisomers of a hypothetical six-coordinate complex [M(AA);bc] (where AA is a bidentate…

A: Stereoisomers include Geometrical isomers and Optical isomers. There are two Geometrical isomers…

Q: Describe the types of NO bonds by demonstrating the electrons involved. This is an acid (pi) ligand…

A: The metal uses t2g orbital to form pi bonds with ligands. Pi star orbital of metal is high energy…

Q: F3B-NH3

A: Electron deficient molecule tries to gain stability by accepting electrons from bonded or…

Q: Among the following ligands, which one can behave as ambidentate ligand? Select one: a. SCN- O b.…

A: Abmidient ligand: The ambidentate ligand has two or more donor atoms, but when a complex is formed,…

Q: If the ligands are either Cl", ethylenediamine or H₂O, which of the following is TRUE? O a. The…

Q: 4. In transition metal complexes, ligands largely interact with metal center via lone pairs:…

A: Ethylenediamine intract metal with two lone pairs. Cl- Co and CN are monodentate ligand.

Q: 3. The coordination geometries around the nickel atom in the nominally six-coordinate complexes…

Q: a. Compounds 1 and 2 are complex ions of cobalt. 2+ 2+ NH2 H2 PME2 Me2 H,N. H,N NH, H2 Me,P. Me,P…

Q: The CrF6^4- ion is known to have four unpaired electrons. State and explain whether the fluoride…

Q: Write the hybridization and shape of the following complexes: (i) [FeF6]3 (ii) [Ni(CO)4] (b) Out of…

A: Hybridization: It is a process in which atomic orbitals of same energy level (degenerate orbital)…

Q: The acetylacetone ion forms very stable complexes with many metallic ions. It acts as a bidentate…

A: Concept introduction: Ligands that can bind central metal ion from two sites are called bidentate…

Q: Shown below is an abbreviated spectrochemical series arranged according to decreasing ligand field…

A: According to the crystal field theory, in the presence of the ligand field, the five d-orbitals of…

Q: Write the hybridization and shape of the following complexes: (i) [CoF6]3- (ii) [Ni(CN)4]2- (Atomic…

A: The hybridisation and shape of the given compounds are

Q: 13. A complex ion has been observed which starts with a violet color with six aqua ligands attached.…

Q: Which of the following is correct regarding the ligand (NO₂): It can act as only monodentate ligand…

A: Which of the following is correct regarding the ligand NO2-

Q: 9b. Name the complex ion Cr(CN)(NO₂)(H₂O)(NH3] and note that it can exhibit chiral properties. There…

Q: 23.58: d,e

A: The central metal ion in the complex [Cr(NH3)4Br2]ClO4 is Cr. The ClO4 atoms are written out of the…

Q: Write the formula and the name of each complex ion- a complexion with Co3+ as the central ion and…

A: (1) a complexion with Co3+ as the central ion and three NH3 molecules and three CN-ions as ligands…

Q: 2. Two octahedral complex are shown as below. OCH3 H3CO, OCH3 MeO2C CO,Me Al H3CO OCH3 MeO2C cO,Me…

A: We need to find the oxidation state of the central metal atom. Then we can be able to find the spin…

Q: H2C2O4.2H2O + K2Cr2O7 → K[Cr(C2O4)2(H2O)2].2H2O What is the role of oxalate ion in this reaction…

A: Given reaction; H2C2O4.2H2O + K2Cr2O7 → K[Cr(C2O4)2(H2O)2].2H2O On balancing the equation;…

Q: Is the amine ligand less labile in the complex hexaamminenickel(II) tetrafluoroborate or in the…

A: Amine ligand is less or more labile is depends on the complex.

Q: If a solution known to be made up of an octahedral cobalt complex ion [Co(NH3)6]3+ appears orange to…

A: [Co(NH3)6]3+ is an octahedral complex with six ammonia ligands. Cobalt has the atomic number 27,…

Q: nich is the crystal field energy level diagram for a square pyramidal ML5 complex that contains a…

Q: Depict and explain the Crystal field stabilization theory based on the color the below complexes.…

Q: B. Čomplexes of the Copper(II) Ion Ligand ©Color Formula of Complex OEffect of OH- NH3…

A: As Cu2+ system is d9 system. It undergo J-T distortion in octahedral chemistry When there is OH -…

Q: TiCl(Cp)2(CN)] and [TiCl(Cp)2(NH3)]Cl [IrMe(PMe3)4] and [Ir(C≡C-Ph)(PMe3)4] - Include the…

A: There are some coordination complexes .... 1) [TiCl(Cp)2(CN)] and [TiCl(Cp)2(NH3)]Cl 2)…

Q: Write the hybridization and shape of the following complexes: (i) [CO(NH3)6]3+ (ii) [NiCl4]2-…

A: Hybridization involves the mixing up of of atomic orbitals into new hybrid orbitals with different…

Q: 3. Considering an octahedral complex for the d system,what are the effect of T-donor and t- acceptor…

A: Pi donar Ligands produce lesser splitting energy so high spin will be favored. Pi accepting lingands…

Q: When a certain strong-field ligand forms an octahedral complex with Mn* cation, the energies of the…

A: Electronic configuration of Mn = [Ar] 3d5 4s2 Electronic configuration of Mn3+ = [Ar] 3d4 Under…

Q: Part A How many unpaired electrons are in the d orbitals of an octahedral complex of Ru3+ assuming…

A: In strong field, electrons enter the eg orbitals only when t2g orbitals are completely filled.

Q: Name the following complex ions. formula [Fe(H₂O)]* [Cu(NH,), + [T₁(H₂O)]* name X ?

A: The given metal complexes are exclusively cationic in nature with variable positive charges.

Q: The complex (Fe(H,O)]* is paramagnetic. Is the H,0 ligand inducing a strong or weak field?

A: The coordination complex is the compound that does not lose its identity in the solution. The…

Q: The type of isomerization in the following complex is 3+ 3- 3+ 3- NH3 NH3 CN NC CN Cr. NC CN CN NH3…

A: Solution : Coordination compounds consist of central metal atom or ion surrounded by ions…

Q: Three complex ions of cobalt(III), [Co(CN),]?-, [Co(NH;),]*, and (CoF, absorb light at wavelengths…

A: The given complex ions are [Co(CN)6]3-, [Co(NH)6]3+ and [CoF6]3- The given wavelengths are 290 nm,…

Question

What is the formula of the complex
cation? *
+
NH3
WH3
Cl Co
CI
H3N
NH3
O trans-[Co(NH,),Ci,]
cis-[CoCl,(NH,)I*
O cis-[Co(NH,),CI,]*
O trans-[CoCl,(NH,),I
Which among the following is a Tt-
acceptor ligand? *
со
O s-

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step 3

VIEW

Step by step

Solved in 3 steps with 2 images

SEE SOLUTION Check out a sample Q&A here

Similar questions

a. In the absorption spectrum of the complex ion Cr(NCS)63, there is a band corresponding to the absorption of a photon of light with an energy of 1.75 104 cm-1. Given 1 cm1 = 1.986 1023 J, what is the wavelength of this photon? b. The CrNC bond angle in Cr(NCS)63 is predicted to be 180. What is the hybridization of the N atom in the Ncs- ligand when a Lewis acid-base reaction occurs between Cr3+ and NCs- that would give a 180 CrNC bond angle? Cr(NCS)63 undergoes substitution by ethylenediamine (en) according to the equation Cr(NCS)63+2enCr(NCS)2(en)2++4NCS Does Cr(NCS)2(en)2+ exhibit geometric isomerism? Does Cr(NCS)2(en)2+ exhibit optical isomerism?
Is it possible for a complex of a metal in the transition series to have six unpaired electrons? Explain.
Which of the following is most likely to bond to Ni2+ as a ligand? Explain. CH3-CH2-CH3 CH3-SiH2-CH3 CH3-O-CH3 |
Draw a Lewis structure for the cyclopentadienyl ligand (C5H5)- and explain why it is more likely to bind it’s aromatic protons to a transition metal center compared to the similar benzene molecule (C6H6).
The factor determining the mechanism observed in the substitution reactions of square plane complexes is that these complexes are not saturated with coordination. Right?False?
Compounds with lone pair of electrons are able to form complexes via the donation of electrons intothe empty d orbital of transition metals. Which of these two: NF3and NH3has greater tendency to do so?and give reason for your choice.
The complex was synthesized with the formula [Co(CO)2(CN)2Br2] The spectreinfrared shows two bands that are attributed to C-O stretching, and only one for theC-N stretching Are bromides cis- or trans-? explain.
Sketch the orientation of the orbitals relative to the ligandsin an octahedral complex to explain the splitting and the relativeenergies of the dxyand dx2-y2 the orbitals.
What is the expected number of Fe-Febondsper Fe atom in the complex ?
Classify each ligand (OH, NH2, and NH3) as either an L-, X-, or Z-type ligand. Bridging ligands need to be classified according to their interactions with each metal center.
About the chelating agents (ligands) classification (all are correct except Select one: 1- succimer mainly behave as a divalent chelating agent when chelation occurs through its two neighboring SH group however, in case of techitium complex it behaves as a trivalent chelating agent 2- the divalent chelating agents/ligands have two electron donating groups like oxalte two carboxyl groups 3- the pentavalent chelating agents/ligands have five electron donating groups like diethelentriamine pentacetic acid 4- the trivalent chelating agents/ligands have three electron donating groups like EDTA
1. Give the molecular orbital diagram for the diatomic fluorine 2- ion, including labels for all occupied molecular orbitals. You should only show the outer shell electrons 2. Give a diagram and explain briefly how the d orbital degeneracy is removed in an octahedral complex in which a transition metal atom is surrounded by 6 ligands.