Answered: What is the mass in grams of carbon…

What is the mass in grams of carbon dioxide that would be required to react with 79.7 g of LIOH in the following chemical reaction? 2 LİOH(s) + CO2(g) → Li¿CO3(s) +HÓ(1)

Chemistry for Engineering Students

4th Edition

ISBN:9781337398909

Author:Lawrence S. Brown, Tom Holme

Publisher:Lawrence S. Brown, Tom Holme

Chapter4: Stoichiometry

Section: Chapter Questions

Problem 4.19PAE: 4.19 How many metric tons of carbon are required to react with 7.83 metric tons of Fe2O3 according...

See similar textbooks

Related questions

Q: when 2.876g of a certain metal oxide is roasted in air, 2.368g of metal oxide is formed. if the…

A: In roasting, metal sulfide is converted into metal oxide. When 2.876 g of metal sulfide is roasted…

Q: How many moles of ammonia would be required to react exactly with 0.874 moles of copper(II) oxide in…

Q: What mass of CO is required to react with 25.13 g of Fe2O3 according to the equation Fe2 O3 + 3CO ⟶…

A: Applying concept of limiting reagent and mole concept.

Q: Calculate the theoretical yield in moles CO, from the complete reaction of 81.7 grams O2 according…

Q: Silicon nitride (Si3N4), a valuable ceramic, is made by the direct combination of silicon and…

A: Percent yield is defined as the percentage ratio of the actual yield to the theoretical yield…

Q: How many moles of ammonia would be required to react exactly with 0.646 moles of copper(II) oxide in…

A: 2 NH₃(g) + 3 CuO(s) → 3 Cu(s) + N₂(g) + 3 H₂O(g) By the eqn, As we can see that 2 moles of (NH3 )…

Q: What is the mass in grams of NO that will be produced from 12.7 g of NO, reacted with excess water…

A: From a balance equation we can calculate the mass of the product .

Q: What is the mass in grams of carbon dioxide that would be required to react with 43.9 g of LiOH in…

A: The above problem is based on mole concept (stoichiometry).

Q: What is the mass in grams of carbon dioxide that would be required to react with 19.8 g of LiOH in…

Q: How many moles of ammonia would be required to react exactly with 0.468 moles of copper(II) oxide in…

Q: What is the mass in grams of Cuo that would be required to produce 21.50 moles of nitrogen gas in…

Q: How many moles of ammonia would be required to react exactly with 0.634 moles of copper(II) oxide in…

A: Given Chemical Reaction :: 2 NH₃(g) + 3 CuO(s) → 3 Cu(s) + N₂(g) + 3 H₂O(g) Moles of CuO = 0.634…

Q: What mass of CO is required to react with 25.13 g of F*e_{2} * O_{3} according to the equation : Fe…

Q: How many moles of ammonia would be required to react exactly with 0.424 moles of copper(II) oxide in…

Q: How many moles of ammonia would be required to react exactly w 0.430 moles of copper(II) oxide in…

Q: How many grams of oxygen can be obtained by the determination of 223 g of reactant in the following…

A: For determining the amount of product, the mole ratio of reactants in a balanced reaction must be…

Q: How many grams of CuO would be required to produce 81.0 moles of nitrogen gas in the following…

A: The reaction available is 2NH3(g) +3CuO(s) →3Cu(s)+N2(g) +3H2O(g)

Q: What is the mass in grams of CuO that would be required to produce 40.50 moles of nitrogen gas in…

A: Ammonia reacts with CuO to form copper, nitrogen, and water. The equation for the balanced chemical…

Q: In the reaction, CuSO4(aq) + 4 NH3(aq) →Cu(NH3)4SO4(aq) a. What is the theoretical yield if 10.0 g…

Q: How many grams of carbon dioxide would be required to react with 37.9 g of LiOH in the following…

A: Stoichiometry, in balanced chemical reaction is defined by the ratio at which reactants are reacting…

Q: What is the mass in grams of carbon dioxide that would be required to react with 71.9 g of LiOH in…

A: We have to calculate the mass of carbon dioxide .

Q: What is the mass in grams of CuO that would be required to produce 10.50 moles of nitrogen gas in…

Q: How many moles of ammonia would be required to react exactly with 0.764 moles of copper(II) oxide in…

A: The balanced reaction can be given as

Q: What is the mass in grams of carbon dioxide that would be required to react with 68.1 g of LIOH in…

A: Given,

Q: What is the mass in grams of carbon dioxide that would be required to react with 80.2 g of LiOH in…

A: Mass of LiOH = 80.2 g Mass of CO2 required to react with 80.2 g LiOH = ? The balance chemical…

Q: How many moles of ammonia would be required to react exactly with 0.692 moles of copper(II) oxide in…

A: Moles of ammonia required is calculated as follows

Q: What is the mass in grams of carbon dioxide that would be required to react with 20.2 g of LiOH in…

Q: How many moles of ammonia would be required to react exactly with 0.550 moles of copper(II) oxide in…

A: Given chemical reaction, 2NH3(g) + 3CuO(s) ---> 3Cu(s) + N2(g) + 3H2O(g) Moles of Copper (II)…

Q: What is the mass in grams of carbon dioxide that would be required to react with 60.7 g of LiOH in…

A: Interpretation: The mass in grams of carbon dioxide required to react with 60.7 g of LiOH in the…

Q: How many moles of ammonia would be required to react exactly with 0.740 moles of copper(II) oxide in…

A: The given reaction is, 2NH₃(g) + 3CuO(s)---->3Cu(s) + N₂(g)+3H₂O(g)

Q: What is the mass in grams of carbon dioxide that would be required to react with 57.7 g of LiOH in…

A: 2 LiOH(s) + CO2(g) → Li2CO3(s) + H2O(l) Molar mass of lithium hydroxide=23.95 g/molmass of lithium…

Q: How many moles of ammonia would be required to react exactly with 0.816 moles of copper(II) oxide in…

A: The balance chemical reaction : 2NH3(g) + 3CuO(s) ----> 3Cu(s) + N2(g) + 3H2O(g) Number of moles…

Q: When elemental phosphorus oxidizes, it produces a covalently bonded molecule known as…

A: Given :- Mass of P4 = 1.33 g Mass of O2 = 5.07 g To calculate :- Theoretical yield of P4O10

Q: What is the mass in grams of CuO that would be required to produce 73.00 moles of nitrogen

A: We have to find mass in grams of CuO that would be required to produce 73.00 moles of nitrogen gas

Q: What is the mass in grams of carbon dioxide that would be required to react with 61.4 g of LiOH in…

A: Dear student, lithium hydroxide is used in the purification of air. The above reaction is very…

Q: How many moles of ammonia would be required to react exactly with 0.764 moles of copper (ii) oxide…

A: Given, 2NH3 + 3CuO → 3Cu + N2 + 3H2O moles of copper (ii) oxide (CuO) react = 0.764 moles moles of…

Q: How many moles of ammonia would be required to react exactly with 0.598 moles of copper(II) oxide in…

A: The given reaction is - - > 2 NH₃(g) + 3 CuO(s) → 3 Cu(s) + N₂(g) + 3H₂O(g) 2 moles NH3 reacts…

Q: What is the mass in grams of carbon dioxide that would be required to react with 53.1 g of LiOH in…

Q: What is the mass in grams of carbon dioxide that would be required to react with 32.3 g of LiOH in…

Q: How many moles of nitrogen gas would be produced if 3.40 moles of copper(II) oxide were reacted with…

A: Consider the given reaction. 2NH3g+3CuOs→3Cus+N2g+3H2Og

Q: Calcium phosphate used in fertilizers can be made in the reaction described by the following…

A: Given, Chemical Reaction : 2H3PO4 + 3Ca(OH)2 ---> Ca3 (PO4)2 + 6 H2O Molarity of H3PO4 = 5.00 M…

Q: How many moles of ammonia would be required to react exactly with 0.158 moles of copper(II) oxide in…

A: Well-balanced chemical reaction: 2 NH₃(g) + 3 CuO(s) → 3 Cu(s)…

Q: How many moles of ammonia would be required to react exactly with 0.352 moles of copper(II) oxide in…

A: Given: moles of CuO = 0.470 mol Chemical reaction is given by, 2NH3(g)+3CuO(s)→3Cu(s)+N2(g)+3H2O(g)

Q: what mass of CO2 is produced by the reaction?

A: Molar mass of carbon is 12.01 g/ mol. Molar mass of CO2= Atomic weight of C + 2× Atomic weight of O…

Q: What is the mass in grams of NO that will be produced from 30.0 g of NO, reacted with excess water…

Q: What is the mass in grams of carbon dioxide that would be required to react with 15.0 g of LiOH in…

A: The balanced reaction taking place is given as, => 2 LiOH (s) + CO2 (g) -------> Li2CO3 (s) +…

Q: What is the mass in grams of carbon dioxide that would be required to react with 16.4 g of LiOH in…

A: The no of moles of any substance is the ratio of given mass to that of molar mass of that substance.…

Q: How many moles of ammonia would be required to react exactly with 0.546 moles of copper(II) oxide in…

A: Given, 0.546 moles of copper(II) oxide Balanced reaction is, 2 NH₃(g) + 3 CuO(s) → 3 Cu(s) + N₂(g) +…

Q: How many grams of reactant are needed to obtain 291 g of oxygen in the following reaction? 2H2O2 →…

Q: What is the mass in grams of carbon dioxide that would be required to react with 84.6 g of LIOH in…

A: Stereochemical coefficients tells about the ratio in which the reactants the react in a chemical…

Concept explainers

Mole Concept

Mole concept is a method to determine the amount of any substance that consists of some elemental particles using a grouping unit called ‘mole’. The mole concept enables one to handle the large amount of small elementary particles. The mole concept can be used in many calculations related to mole calculation, molar amount, mole ratio, and so on, which are significant in chemistry.

Question

100%

What is the mass in grams of carbon dioxide that would be required to
react with 79.7 g of LIOH in the following chemical reaction?
2 LİOH(s) + CO2(g) → Li¿CO3(s) +HỐ(1)

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step by step

Solved in 2 steps

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

How many grams of beryllium (Be) are needed to react completely with 45.0 g of nitrogen (N2) in the synthesisof Be3N2?
How many moles of beryllium (Be) are needed to completely react with 10.0 moles of N2 in the synthesis of the compound Be3N2?
4.24 Ammonia gas can be prepared by the reaction CaO(s)+2NH4Cl(s)2NH3(g)+H2O(g)+CaCl2(s) If 112 g of CaO reacts with 224 g of NH4Cl, how many moles of reactants and products are there when the reaction is complete?
4.19 How many metric tons of carbon are required to react with 7.83 metric tons of Fe2O3 according to the following reaction? 2Fe2O3+3C3CO2+4Fe How many metric tons of iron are produced?
Tungsten (W) metal, which is used to make incandescent bulb filaments, is produced by the reaction WO3+3H23H2O+W How many grams of H2 are needed to produce 1.00 g of W?
Phosphoric acid, H3PO4, can be prepared by the reaction of phosphorus(V) oxide, P4O10, with water. 14P4O10(s)+32H2O(l)H3PO4(aq);H=96.2kJ What is H for the reaction involving 1 mol of P4O10? P4O10(s)+6H2O(l)4H3PO4(aq)
Nitrogen fixation in the root nodules of peas and other legumes occurs with a reaction involving a molybdenum-containing enzyme named nitrogenase. This enzyme contains two Mo atoms per molecule and is 0.0872% Mo by mass. Calculate the molar mass of the enzyme.
The active ingredient in some antiperspirants is aluminum chlorohydrate, Al2(OH)5Cl. Analysis of a 2.000-g sample of antiperspirant yields 0.334 g of aluminum. What percent (by mass) of aluminum chlorohydrate is present in the antiperspirant? (Assume that there are no other compounds containing aluminum in the antiperspirant.)
What is the molarity of each ion present in aqueous solutions of the following compounds prepared by dissolving 28.0 g of each compound in water to make 785 mL of solution? (a) potassium oxide (b) sodium hydrogen carbonate (c) scandium(III) iodite (d) magnesium phosphate
4.108 Elemental analysis is sometimes carried out by combustion of the sample. For a hydrocarbon, the only products formed are CO2 and H2O. If a 1.36-g sample of an unknown hydrocarbon is burned and 2.21 g of H2O is produced along with 4.07 g of CO2, what is the empirical formula of the hydrocarbon?
4.44 Industrial production of hydrogen gas uses the reaction shown below. If 1.00 metric ton of propane reacting with excess water yields 270 kg of H2, what is the percentage yield? C3H8(g)+3H2O(l)3CO(g)+7H2(g)