Answered: Which element is oxidized in the…

Which element is oxidized in the reaction below? Fe2+ + CrO42- + H2O→ Fe3+ + Cr3+ +OH- A. Cr6+ B. Fe2+ C. O2+ D. Fe3+ E. Cr3+

Fundamentals Of Analytical Chemistry

9th Edition

ISBN:9781285640686

Author:Skoog

Publisher:Skoog

Chapter19: Applications Of Standard Electrode Potentials

Section: Chapter Questions

Problem 19.3QAP

See similar textbooks

Related questions

Q: Arrange the following ions in terms of increasing strength as an oxidizing agent. Arrange the three…

Q: Which of the following species contains manganese with the highest oxidation number? A) Mn B) MnF₂…

Q: Which way will cloride ions move and why? Cl- F=23100 cal/V*mol Vm = -60mV R =2cal/mol*K T =…

A: According to the question, we need to determine the movement of chlorine ion as per the given…

Q: + 1.14 V TI Pt Cr3+ (1 M) Cr2+ (1 M) T13+ (1 M) T13+ (aq) + 3e- → TI (s) Cr2+ (aq) → Cr3+ (aq) + e-…

A: An electrochemical cell possesses cathode and anode. A cathode is a metal electrode which is…

Q: Show formulas and calculations. Given a solution with (A) or (B), which solution is more reducing?…

A: A substance is said to be a better reducing agent if it has a higher oxidation potential that is,…

Q: In the oxidation-reduction reaction Snat +2 Fe2+-→2 Fe3+ + Sn2* O a. Sn4+ is oxidized and Fe2+ is…

A: Gain of electrons is known as reduction and loss of electrons is known as oxidation.

Q: Determine the oxidation number

A: As per gudielines , if multiple questions posted , first question is allowed to answer, please post…

Q: Which one of the following, when added to a piece of Cu(s) in solution, is capable of oxidizing…

A: The reactivity series is of metal is: The metals at the top of the series are powerful reducing…

Q: 1.) How many minutes will it take to plate out 2.19 g of chromium metal from a solution of cr" using…

A: 1. mass of Cr = 2.19 g current = 35.2 A Note : Since there are multiple questions, as per policy…

Q: Complete the oxidation half reaction for S2032-/ S4O62- (2 pts) S20 (aq). S4O2-

A: The answer to the following question is-

Q: Using standard reduction potentials from the ALEKS Data tab, calculate the standard reaction free…

A: The solution of the given question is

Q: Determine the oxidation number of SS in H2SO3H2SO3 A. +4 B. +7 C. +3 D. +5 E. +6

Q: An aqueous Cu+2 solution is electrolyzed for 45 minutes. A 3.2 ampre current is used. What mass of…

A: Electrochemistry is the branch of chemistry that deals with the chemical processes that cause…

Q: Consider these metal ion/metal standard reduction potentials Cd2+(aq)|Cd(s): -0.40 V;…

A: ->The species which has high reduction potential that tends to reduce itself and oxidize other…

Q: Give the balanced Oxidation and Reduction half reactions for CO2(g)+H2O(l)C6H12O6+O2(g)

A: During photosynthesis in presence of sunlight (hv) carbon-di-oxide and water reacts to form…

Q: A balanced redox equation must have which of the following: I. The same number of each type of atom…

A: Oxidation reactions are associated with lose of electrons, addition of oxygen. Reduction reactions…

Q: Consider the diagram and reaction below to select the best possible answer for the following…

A: Given cell diagram is : Reaction is : Ni (s) + 2Ag+ (aq) ----------> Ni2+ (aq) + 2Ag (s) 1.…

Q: Cytochrome, a complicated molecule that we will represent as CyFe2+, reacts with the air we breathe…

A: Given: The reduction reactions along with their reduction potential values are, O2g+4H+aq+4e-→2H2Ol…

Q: Consider the following redox reaction under standard conditions: 2 Li+ (aq) + Fe (s) → Fe2+ (aq) + 2…

A: Given cell reaction, 2 Li+(aq) + Fe(s) → Fe2+(aq) + 2 Li(s)

Q: List the species that is reduced and the one that is oxidised. Mn2+ + H2O2 → MnO2 + H2O

A: Chemical species which accepts the electron is known as reduced species and chemical species which…

Q: ce of metal A is placed in a solutic ions of metal B, metal B plates out on the piece of. (a) Which…

A: Since you have posted a question with multiple subparts, we will solve the first three subparts for…

Q: 39. What should be the reaction at the cathode? 40. What will be the E°cell? 41. What will be the…

A: Here we are required to find the cell potential of the given electrochemical reaction .

Q: The strongest oxidising agent is (a) F2 (b) Cl2 (c) I2 (d) Br2

Q: Half-reaction E° (V) 0.96 Reduction of NO3(aq) to NO(g) (nitrate ion) 1.065 Reduction of Br₂(1) to…

A: we have to write the half reactions

Q: Which among the given substances is the BEST oxidizing agent by virtue of its thermodynamic tendency…

Q: Which species in each pair is a better oxidizing agent under standard-state conditions? a) Brz or…

A: The species that has higher value of standard reduction potential will undergo reduction of itself…

Q: Half-reaction containing acid : 3 N2 (g) + 2 H+ (aq) + 2 e- → 2 HX (aq) Eo red = -3.09 V 1. using…

A: Since you have posted a question with multiple sub-parts, we will solve the first three sub-parts…

Q: Given their standard reduction potentials, which of the species is going to be oxidized? Select…

A: Given :- Cu2+/Cu = 0.34V Zn2+/Zn = -0.76V To identify :- Oxidized species

Q: Using standard reduction potentials from the ALEKS Data tab, calculate the standard reaction free…

A: we need to calculate the standard reaction free energy for the given redox rection. The formula for…

Q: 3. Determine the molecular mass and identity of a +2 metal, X, that plates 46.3g of X in 6.75 hours…

Q: (a) What is the oxidation number of the vanadium atom(s) (V) in the following compounds and ions?…

Q: Of the following, which one is most likely to be the strongest reducing agent: O2, 02", 02 ?O22…

A: Strong reducing agent is O2+. Correct option is A.

Q: 34. 2K,Cr20, + 2H2O+ 3S → 3502 + 4KOH + 2Cr,03

A: “Hey, since there are multiple questions posted, we will answer first question. If you want any…

Q: a)Which metal will react spontaneously with a Cr3+ ion but not with a Ca2+ ion? * a Co b Li c Pb…

A: According to Q&A guidelines of Bartleby, we are supposed to answer only the first question out…

Q: Which of the following is the best reducing agent? Cl2 + 2e + 2Cr E° = 1.36 V Mg2+ + 2e + Mg E° =…

Q: 6.) Consider the following half-reaction containing acid HX below. 3 N2 (g) +2 H (aq) +2 e → 2 HX…

A: Solution: A) Yes, we can see the standard reduction potential is - 3.09 V. Since we know standard…

Q: A current of 4.48 A is passed through a Fe(NO,)2 solution. How long, in hours, would this current…

A: Given, Amperes of current passed =4.48 A Solution = Fe(NO3)2 Iron plated = 6.30 g

Q: one of the following is oxidizing agent O a. S406-2 O b. S205-2 O c. S203-2 O d. none of them

A: Given: Few species 1). S4O62-. 2). S2O52-. 3). S2O32-.

Q: Which of the following is the strongest oxidizing agent? Mn04 - + 4H+ + 3e- - Mn02 + 2H20 12 + 2e- +…

Q: In a process of electroplating silver, a current of 15.2 amps (A) was passed through an electrolytic…

A: Since you have posted multiple questions, we are solving the first question. Please post rest of the…

Q: Predict which species will be oxidized and which will be reduced in a molten salt mixture that…

A: The available species for oxidation and reduction are: Cd2+, I-, Na+, OH-, Al3+ and Cl-.

Q: 36. What is the oxidation half-reaction? 37. What is the reduction half-reaction? 38. What is…

A: Oxidation is the loss of electrons whereas reduction is the gain of electrons. Oxidation takes place…

Q: The standard reduction potentials are-0.13 V for Pb2+ and +0.80 V for Ag+. Calculate E'cell for the…

A: E°Cell = E°red - E°oxi Lower reduction potential values always undergo oxidation Higher reduction…

Q: O3- is an oxidizing agent that oxidizes : KI to I2 I2 to I- S2O3- to I

Q: A solution containing 0.20 M Pb²+ , 1.5 x 10-ó M Pb* , 1.5 × 10-6 M Mn²+ , 0.20 M MnO, , and 0.88 M…

A: “Since you have posted a question with multiple sub-parts, we will solve the first three subparts…

Q: 3. Consider the following galvanic cell: Fe(s) Cr(s) Salt bridge containing KNO,(aq) 1M Fe+ IM Cr+…

A: Given galvanic cell reaction between Fe and Cr. Which are the cathode and anode?

Q: Cr2072- + 6S203²- + 14H* → 2Cr3+ + 3S406²- + 7H20 What is the reducing agent here?

A: Those chemical species that lose their electrons during the reaction to reduce other atoms are known…

Q: A test for completeness of the reduction of copper(II) ions to metallic copper can be done via the…

A: The metal which has a more negative standard reduction potential value acts as a reducing agent.

Q: 1. Write the balanced net ionic equation for the reaction between MnO4" ion and Fe2+ ion in acid…

Question

100%

Which element is oxidized in the reaction below?

Fe²⁺ + CrO₄^2- + H₂O→ Fe³⁺ + Cr³⁺ +OH^-

A. Cr⁶⁺

B. Fe²⁺

C. O²⁺

D. Fe³⁺

E. Cr³⁺

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps with 1 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

The Ostwald process for the commercial production of nitric acid involves the following three steps: 4NH3(g)+5O2(g)4NO(g)+6H2O(g) 2NO(g)+O2(g)2NO2(g) 3NO2(g)+H2O(l)2HNO3,(aq)+NO(g) a. Which reactions in the Ostwald process are oxidationreduction reactions? b. Identify each oxidizing agent and reducing agent.
Consider the equation G = -nF. What are the four terms in this equation? Why does a minus sign appear in the equation? What does the superscript o indicate?
Chromium has been investigated as a coating for steel cans. The thickness of the chromium film is determined by dissolving a sample of a can in acid and oxidizing the resulting Cr3+ to Cr2O72 with the peroxydisulfate ion: S2O82(aq) + Cr3+(aq) + H2O(l) Cr2O72(aq) + SO42(aq) + H+(aq) (Unbalanced) After removal of unreacted S2O82 an excess of ferrous ammonium sulfate [Fe(NH4)2(SO4)26H2O] is added, reacting with Cr2O72 produced from the first reaction. The unreacted Fe2+ from the excess ferrous ammonium sulfate is titrated with a separate K2Cr2O7 solution. The reaction is: H+(aq) + Fe2+(aq) + Cr2O72(aq) Fe3+(aq) + Cr3+(aq) + H2O(l) (Unbalanced) a. Write balanced chemical equations for the two reactions. b. In one analysis, a 40.0-cm2 sample of a chromium-plated can was treated according to this procedure. After dissolution and removal of excess S2O82, 3.000 g of Fe(NH4)2(SO4)26H2O was added. It took 8.58 mL of 0.0520 M K2Cr2O7 solution to completely react with the excess Fe2+. Calculate the thickness of the chromium film on the can. (The density of chromium is 7.19 g/cm3)
When jump-starting a car with a dead battery, the ground jumper should be attached to a remote part of the engine block. Why?
The photographs below (a) show what occurs when a solution of iron(III) nitrate is treated with a few drops of aqueous potassium thiocyanate. The nearly colorless iron(III) ion is converted to a red [Fe(H2O)5SCN)2+ ion. (This is a classic test for the presence of iron(III) ions in solution.) [Fe(H2O)6]3+(aq) + SCN(aq) [Fe(H2O)5SCN]2+(aq) + H2O() (a) As more KSCN is added to the solution, the color becomes even more red. Explain this observation. (b) Silver ions form a white precipitate with SCN ions. What would you observe on adding a few drops of aqueous silver nitrate to a red solution of [Fe(H2O)5 SCN]+ ions? Explain your observation.
Why is it not possible for hydrogen ion (H+) to appear in either of the half-reactions or the overall equation when balancing oxidationreduction reactions in basic solution?
What is electrochemistry? What are redox reactions? Explain the difference between a galvanic and an electrolytic cell.