Write the IUPAC name for the compound below. Be sure to use correct punctuation. CH2-CH2-CH3 CH3-CH2-CH2-CH–CH2-CH2-CH2-CH2-CH3 The IUPAC name is

Q: -COCH3 _(6a)_ _(6b)__ → + H2O HO. COOH (7a)_ + 2 NaOH _(7b)_ + NazCO3. +. H2O

A:

Q: CH3 CH3-CH-CH2-CH2-CH3

A: The name of the given compound is as follows:

Q: CH3 CH3 CH3- CH,-CH2- CH– CH-CH- CH2- CH3 CH- CH3 CH3

A:

Q: Fill in the blank: What is the IUPAC name for the following compound?

A:

Q: 6- (CH3)3CCH2CH3 is named what, according to IUPACS naming system? t-butylpropane 2,2-dimethylbutane…

A: In the given question we have to write the IUPAC name of the following compound. first of all, we…

Q: Write the IUPAC name for the compound below. Be sure to use correct punctuation. ÇH3…

A:

Q: Give the IUPAC name of the following

A: Since you have posted a  question with sub-parts , we are entitled to answer the first three…

Q: CH3CHCHCH,CH,CH3 SCH,CH3 CH3

A: The IUPAC name of a branched alkane is determined in the following step-by-step manner: The longest…

Q: Give the different isomers formed by C5H8 along with their IUPAC name.

A: Isomers of any chemical compound are the molecules which have the same molecular formula but a…

Q: [Review Topics] [References] Write the IUPAC name for the compound below. Be sure to use correct…

A: IUPAC name of the given structures ---

Q: Choose the correct IUPAC name with its correct functional group. 1. CH3COOCH3 2. C5H11COOH 3.…

A:

Q: CH3 CH3-CH2-CH2-CH2-CH2-CH2-CH3 CH3-CH2-CH3

A: Nomenclature of Alkane Rules :  Select the longest chain of carbon containing maximum number of…

Q: Give the IUPAC name for this molecule. CH3 CH3CHCH2CH½CH2CH

A: Given : The above chemical compounds   To find:  Find IUPAC Name for the following compounds

Q: What is the IUPAC names of  1. CH3CH2COOCH2CH3 2. CH3CH2-CO-O-CO-CH2-CH2-CH3

A: The given first compound belongs to the class of esters in various organic compounds and the given…

Q: The following compound name is an incorrect IUPAC name: "2,3-diethylheptane" What is the proper…

A: First we have to know that why 2,3-diethylheptane is incorrect IUPAC name.     Because, here…

Q: Give the IUPAC name of the following compounds

A: It would be impossible to give each person a distinct name that we would remember. The International…

Q: Write the IUPAC name for the compound below. Be sure to use correct punctuation. CH3 H2C=CCH2CH3 The…

A: The IUPAC name of the below-given compound has to be determined: The given compound contains a C=C…

Q: Write the IUPAC name for the compound below. Be sure to use correct punctuation. CH2CH3…

A:

Q: Write the IUPAC name for the compound below. Be sure to use correct punctuation. CH3…

A: Steps involved: 1. Identify the parent chain, which is the longest carbon chain with C=C 2. Label…

Q: What is the correct IUPAC name for 3-butyl-2-isopropylpentane

A: The IUPAC name for 3-butyl-2-isopropylpentane is:4-ethyl-2,3-dimethyloctane. The structure for the…

Q: Write the IUPAC name for the compound below. Be sure to correct punctuation. CH3…

A: IUPAC stands for International Union of Pure and Applied Chemistry.  This method is used to naming…

Q: What is the correct IUPAC name for 2,5-Dipropylhexane

A: For the IUPAC name, the parent chain should possess the maximum number of carbon atoms.

Q: What is the correct IUPAC name for the compound with the following condensed structural formula?…

A:

Q: what is the correct IUPAC name for Ca(C₂H₃O₂)₂?

A: The IUPAC nomenclature of inorganic chemistry is a systematic method of naming inorganic chemical…

Q: What is the IUPAC name for the compound shown? CH3 H3C- CH CH2-CH2-CH3 ČH2-CH3 IUPAC name:…

A:

Q: What is the correct IUPAC name for: CH3 CH3 CH3CH2CHCH2CHCH3 O 1,1,3-trimethylpentane…

A:

Q: Give the COMMON NAME of the following compound * H3C-CH2-CH=CH2 Your answer Give the IUPAC NAME of…

A:

Q: OCH3 CH3

A: The IUPAC stands for Indian Union of Pure and Applied Chemistry. It is the System that provides the…

Q: Give the IUPAC NAME of the following compound: CH3 CH3-CH2-CH2-CH2-CH2-CH2-CH3 CH3-CH2-CH3

A: We have to predict the IUPAC nomenclature.

Q: What is the IUPAC name for the compound shown? Br H3C. CH3 IUPAC name:

A: During the IUPAC naming of a chemical compound, we have to remembered the main points are as given…

Q: CH,CH,CH3 CH,CCH,CH3 OH

A:

Q: Give the IUPAC name of the following:

A:

Q: CH2=CH–CH-CH2-CH-CH3

A: The first and the foremost step while naming the IUPAC name of an organic compound is the…

Q: What is the correct IUPAC name for 1. N 2. 3. СН3СН 3 | CH3CH₂CHCH₂CHCH3 H3C CH3

A:

Q: Write the IUPAC name for the compound below. Be sure to use correct punctuation. ÇH2-CH3…

A: Rules for naming the organic compound is as follows; Select the longest continuous carbon chain.…

Q: Write IUPAC name of the following compound: (CH3CH2)2NCH3

A: The given compound is an example of amine. Generally, there are three kinds of amines. Primary…

Q: What is the correct IUPAC name for CuHCO3?

A: To write the IUPAC name 1.firstly find out which type of compound it is. 2.Name the metal  3.then…

Q: What is the correct IUPAC name for (CH3)2CH(CH2)3CH3?

A: We have given that the organic compound we have to find the IUPAC Name of the given compound. 1.…

Q: What is the correct IUPAC name for the following compound CH3-CH(CH3)-CH(C2H5)-CH2-CH(CH3)-CH3?…

A: Basic Rule to write IUPAC Name (1)  Select the longest chain  (2)  Numbering start from those side…

Q: Write the IUPAC name for the compound below. Be sure to use correct punctuation. CHy-CH-CHy-CH,…

A: i) The longest carbon chain in the given compound contains nine carbon atoms. Therefore, the root…

Q: What is the correct IUPAC name for Cl₂O₇?

A: The most accepted name of a chemical compound is governed by IUPAC. The IUPAC name is governed by a…

Q: Name the following using correct IUPAC nomenclature: A) isopentane B) 2-methylpentane CH3CH2CCH3 C)…

A: The compound given is,

Q: CH3 CH3 CH3CH2CHCH2CHCH3

A: Rule of IUPAC- 1) Longest chain as parent chain. 2) Numbering start from those side where more prior…

Q: Write the IUPAC name for the compound below. Be sure to use correct punctuation. CH3 H2C=CCH2CH2CH3…

A:

Q: Provide the correct IUPAC name for the compound shown here. CH3 CH2=C-CH=CH2

A: In the given structure there is a methyl group which is attached on the 2nd carbon and two double…

Q: For each, draw a structural diagram (line, condensed or complete) IUPAC Name Condensed Formula…

A: Concept- In condensed formula, we will use the symbol of the atoms, in order to get the structure.…

Q: What is the correct IUPAC name for the compound above? a. 2,3,4-trimethylhexane b.…

A: Organic compounds are named as per the guidelines proposed by the International Union of Pure and…

Q: Write the IUPAC name for the compound below. Be sure to use correct punctuation. CH,CH3…

A: Steps involved: Find the parent chain: Parent chain is the longest carbon chain with alkene  Label…

Q: What is the IUPAC name of the molecule shown? 0 || CH3-CH₂-O-C-CH2-CH2-CH3 Write the correct…

A:

Q: The IUPAC name 4-hexylhexane is incorrect. What should be the correct name? o 3-propylnonane…

A: The systematic naming of organic compound is given by IUPAC. The naming of organic compound is done…