Write two complete balanced equations for each of the following reactions, one using condensed formulas and one using Lewis structures.(a) 1-butanol reacts with acetic acid(b) propionic acid is poured onto solid calcium carbonate

Q: Give the IUPAC name and it's Functional Group

A: The IUPAC name of the compound and its functional group has to be given. 11. 12.

Q: What type of functional group is represented by the following structure?

A:

Q: Two common pain relievers, acetylsalicylic acid (aspirin) and acetaminophen, are shown Identify the…

A: Functional group is a group of atom present in a compound that decides the chemical and physical…

Q: The IUPAC name of the following organic compound is CI CI

A:

Q: Write a complete structural formula, and determine theIUPAC name for each of the carboxylic acids of…

A: Compounds in which –COOH i.e. carboxylic acid group is attached to the last carbon of that molecule…

Q: Give the IUPAC name of the following compound

A: To solve this problem we will follow the following steps (1) Identify the longest carbon chain  (2)…

Q: a) Write the structural formulas of 3-octanol and pentanal. b) Write the neutralization reaction of…

A:

Q: Write a balanced equation for the incomplete combustion of hexane, assuming theformation of carbon…

A: Combustion reaction: The reaction in which substance is burn in presence of oxygen to release heat…

Q: Draw the following compounds using line structure and identify the class of organic compound. a.…

A:

Q: Give the IUPAC name of the following compound:

A:

Q: Draw the structure of methyl tert-butyl ether and n-butanol and identify the functional groups in…

A:

Q: Draw the structural formula and condensed structural formula for pentane, and identify the methyl…

A: In organic chemistry structural formula consists of lines to show the bonds between the atoms and a…

Q: Draw the line structures for the carboxylic acid and alcohol that can be used to prepare the ester…

A: Introduction: Esters are sweet smelling substances.These are used in making perfumes and as well as…

Q: If a compound has two carbon-carbon triple bonds and one carbon-carbon double bond, what class of…

A: The simplest organic compounds are the hydrocarbons, which contain only carbon and hydrogen.Alkanes…

Q: ne expanded molecular formula give the ne organic compound: CH3CHCHCH2CH2CH(CH2CH3)CH2CH3 (It might…

A: Nomenclature of organic compounds are done in accordance with the rules of International Union of…

Q: Draw the condensed structure of the compound formed from Butanoic acid and methanol Benzoic acid…

A: Condensed structure of Butanoic acid is given by,

Q: Write two complete, balanced equations for each of the following reactions, one using condensed…

A: Lewis structure is the structure of the molecule of a compound that depicts the bonding between the…

Q: If a cyclic alkene has 8 carbon atoms, what is its molecular formula?

A:

Q: What is the balanced chemical equation when gaseous butanol, C4H9OH, undergoes combustion?

A:

Q: chemical formula of NaOH denotes

A: Given: chemical compound =NaOH To determine =chemical formula

Q: Give the IUPAC Name of the following compound.

A: The given compound has alkyne main functional group. And longest parent chain is six membered.

Q: Give the empirical formula and structural formula for a cyclic ether containing four carbon atoms in…

A: If an organic compound has an oxygen atom that is connected to two carbon containing compounds (aryl…

Q: Give the IUPAC name or draw the organic structure for each of the following organic compounds

A: (6) The given structure is, From the numbering, the parent carbon chain is identified as butane and…

Q: Give the IUPAC name of the following compounds

A: Since you have posted a question with multiple sub-parts, we will solve first three sub-parts for…

Q: Write the condensed structural formula for each of the followingcompounds: (a) 2-pentanol, (b)…

A: Since there are multiple sub parts, we are authorized to answer the first three sub parts only. If…

Q: Condensed structural formula : methyl-hexanol

A:

Q: For the following two compounds, the given names do not correctly follow IUPAC naming conventions.…

A:

Q: Write a balanced chemical equation based on the following description: propanol, C₃H₇OH(l) burns in…

A: When propanol burns in air, water and carbon dioxide will be formed.

Q: Give the IUPAC names of the following compounds

A: We have to predict the iupac nomenclature.

Q: Give the IUPAC name of the following compounds:

A: The answer for first three parts are given below. Kindly post the other parts as separate question

Q: a. If butanol and ethanoic acid react in the presence of heat and an acid catalyst, give the name of…

A:

Q: draw the structure for 2-ethylphenol

A: Given, to draw the structure for 2-ethylphenol.The structure can be drawn as follows:Firstly, draw…

Q: Q: Select the IUPAC name of the compounds with Its respective molecular structure, and draw the…

A: IUPAC naming of the given compound is as follows: (1) Select the longest carbon chain. (2) Number…

Q: Give the IUPAC NAME of the following compound:

A:

Q: Write the word equation for the reaction of pentanoic acid and ethyl alcohol. Give all reactants and…

A: This is Fischer esterification reaction in which carboxylic acid reacts with alcohol in the presence…

Q: For the following compound, the given name is not correctly following the IUPAC naming conventions.…

A:

Q: Identify and name all the functional groups present in the molecule of Propranolol

A: 3 functional groups are present in propranolol.

Q: For the following compound, the given name is not correctly following the IUPAC naming conventions.…

A: IUPAC NOMENCLATURE RULES :

Q: Write the condensed structural formula for each of thefollowing compounds: (a) 2-ethyl-1-hexanol,…

A: To draw the structural formula of the compound first identify the parent chain and the functional…

Q: State the different kinds of arrows used in describing organic reactions ?

A: The various types of arrows used in organic chemistry are: 1) Forward arrow (→) 2) Equilibrium…

Q: write a structural formula for   compound. Q.) Propylene glycol

A: Q.) Propylene glycol

Q: Draw the condensed formula and give the correct IUPAC name for each. ( 2. Chloroethylmethylphenyl…

A: Draw the condensed formula and give the correct IUPAC name  2.Chloroethylmethylphenyl methane

Q: Draw the condensed structure of the compounds formedby condensation reactions between (a) benzoic…

A: The reaction between the carboxylic acid and an alcohol lead to the formation of an ester. This is…

Q: what is the structure for the IUPAC name for 3-methylhexane?

A: Given compound has IUPAC name  3-methylhexane.

Q: Write a condensed structural formula for a cyclic ketone with the formula C5H8O

A:

Q: Write two complete, balanced equations for each of the following reactions, one using condensed…

A: The formula  of Ethyl ammoniumchloride is CH3CH2NH4Cl    and sodium hydroxid is NaOH   First…

Q: identify the name of the compounds and it's functional group

A: here we are required to identify the name of the compounds and it's functional group

Q: Although both carboxylic acids and alcohols contain an —OH group, one is acidic in water and the…

A:

Diol

In chemistry there are so many chemical compounds that have a hydroxyl group but a chemical compound having two hydroxyl groups (-OH) is termed as a diol. It also implies the presence of two alcohols whereas polyols contain two or more than two hydroxyl groups (-OH). Glycol or 1,2-diol is an aliphatic diol that has two alcohol groups on adjacent carbon atoms. In industries, the most commonly used diol is ethylene glycol.