arrange the compounds in each set in order of decreasing solubility in water. Q. Ethanol, butane, diethyl ether

Q: Rank the following compounds in order of increasing boiling point.

A: The boiling point of the hydrocarbons is dependent upon the Van-der waale forces and strength of…

Q: Arrange the following compounds in order of increasing boiling point, briefly  explaining your…

A: When the crystals of any compound are impure due to any reason. They can be recrystallized by the…

Q: Arrange following compounds according to increasing boiling point:   2-Methylbutane…

A:

Q: What is/are the intermolecular forces of 1,3-diphenyl-2-propyn-1-one.

A: Intermolecular forces refer to the type of interactions which are present in between atoms or…

Q: the boiling point of a molecule is determined by its formula weight and the type of functional group…

A: Since you have posted two questions, we are entitled to answer the first only.

Q: Menthone and menthol are both isolated from mint. Explain why menthol is a solid at room temperature…

A: Menthone and menthol are both isolated from mint. The reason why menthol is a solid at room…

Q: Which compound in each pair has the higher boiling point?

A: Boiling point is the temperature of a compound at which a liquid is changes into gas phase. The…

Q: Give the IUPAC name for each compound.

A: (a) CH3-CH2-CH2-CH2-CH(CH3)-CH2-CH3  IUPAC name : 3-methylheptane (b)  IUPAC name :…

Q: For each pair of compounds listed, check the box next to the one with the higher boiling point.…

A: Answer: 1) CCl4  Reason: Due to higher molecular mass  Mass is directly proportional to boiling…

Q: Arrange these compounds in order of increasing boiling point.Explain your reasoning.a. CH4 b. CH3CH3…

A: Rules :  1) When the molecular mass of molecules are too different (i.e not approximately same) than…

Q: Explain why A is less water soluble than B, even though both compounds have the same functional…

A: Since in molecule 1, both C=O and the OH are near to each other. Hence they will have internal H…

Q: based on your data, is acetic acid more soluble in water or ethyl acetate? How about water versus…

A: Solubility of acetic acid is explain from the data which is given below.

Q: Explain why A is less water soluble than B, even though both compounds have the same functional…

A: Since the solubility of molecules in water depends on the interaction of the molecules with the…

Q: Give the IUPAC name of each compound.

A: Rules to write the IUPAC name. 1) First locate the longest carbon chain. 2) Then locate all the…

Q: Although diethyl ether and tetrahydrofuran are both four-carbon ethers, one compound is much more…

A: Given that both of the compounds have 4 carbon atoms but they have different solubilities in water.

Q: a) Which of the following molecules can hydrogen bond to another molecule like itself? (b) Which of…

A: The electrostatic forces that exist between the molecules are termed as intermolecular forces. These…

Q: Propanol is very soluble in water, but ethanethiol and chloroethane are only slightly soluble.…

A: Solubility of a substance in a solution follows the rule of like dissolves like. This shows that…

Q: Arrange these compounds in order of increasing boiling point. Explain your reasoning.a. H2S b. H2Se…

A: Boiling point is that point when liquid changes its form into vapor form. It is done when vapor…

Q: For the below the molecule, draw a) a diastereomer of the initial alcohol and b) an enantiomer of…

A: Enantiomers are the isomers that has non-superimposible mirror image to each other. Diastereomers…

Q: A B C D HIH H. H. H H `O-H H H

A: "Like dissolves like" is the thumb rule for dissolution of solute in solvent. Water is a protic…

Q: Rank the following compounds in order of increasing melting point.

A: The given molecules are represented as follows:

Q: Bile salts are derivative of cholestrol. However, the solubilities of these compounds in water are…

A: Cholesterol is highly hydrophobic that is cholesterol is insoluble in water while bile salt a…

Q: Why does hexane have the lower boiling point than acetic acid, when in fact, hexane has a high…

A: Boiling point is directly proportional to H-bonding. More H-bonding, higher will be the boiling…

Q: In general, the boiling point of primary alcohol is. of a linear ether of the same carbon chain…

A: Since you have asked multiple question, we will solve the first question for you. If you want any…

Q: what solvent acetic acid will be soluble in? Water or ether? What structural and/or molecular…

A: Acetic acid is CH3COOH having -COOH group.

Q: Give a common name for each compound CH3 (е) (CH,),С—о—ҫн CH3

A: General names of ether is given by using the names of alkyl groups directly bonded to oxygen atom

Q: Compare the following two compounds. Which is more soluble in water? Why?   A) Compound 1 is more…

A: The solubility of a compound depends on the nature of the solute and the solvent. If the nature of…

Q: Arrange the following compound groups in the increasing order of their property indicated: Propanol,…

A: Propanol (CH3CH2CH2-OH) has the highest boiling point because of the intermolecular hydrogen…

Q: Explain why A is less water soluble than B, even though both compounds have the same functional…

A: The solubility of a substance provides information about the extent of the substance moves into a…

Q: A mixture contains equal amounts of compounds A–D. (See attachment) Question:  If the mixture was…

A: Chemical compounds are sometimes pure or made up of a number of components. Crude oil is one such…

Q: Arrange the following compounds in order of increasing boiling point.

A: To compare the boiling point, first we need to identify the compounds.   -   It is a 8 carbon…

Q: What are the intermolecular forces of attraction that exist between the two, and which of these…

A: The different intermolecular forces of attraction are : Hydrogen bonding London dispersion forces…

Q: Quinapril (trade name Accupril) is a drug used to treat hypertension andcongestive heart failure.…

A: The site sites that can form hydrogen bond to acetone in quinapril can be shown as follows,

Q: Draw the constitutional isomer formed in attached reaction.

A: Constitutional isomers are defined as the compounds that have same molecular formula but the atoms…

Q: Which compound in each pair has the higher boiling point? Explain

A: The compound having higher boiling point in the given pair are as follows:

Q: Rank the following compounds in order of increasing boiling point.

A: Extent of the ability to form intermolecular H-bonding determines the boiling point.

Q: Arrange the follwing comounds according to their boiling points (lowest to highest) N-pentanol…

A: 1)2-Butanol Boiling point: 99 °C 2) 2-Methyl-1-butanol Boiling point: 129 °C 3)…

Q: 1-Butanol 1-Propanol 1,2-Propanediol Propane > >

A:

Q: Part A Arrange the following in order of increasing boiling point: CH4, CH3CH2CH3, CH3CH2CH2CI,…

A:

Q: Although diethyl ether and tetrahydrofuran are both four-carbon ethers, one compound is much more…

A: An ionic bond can be defined as the electrostatic force of attraction between cation and anions.…

Q: Predict which member of each pair will be more soluble in water. Explain the reasonsfor your…

A: The solubility depends on the extent of H bonding, higher, the hydrogen bonding, higher will be the…

Q: 2. (3)Consider the following pairs of compoùnds (in bulk). Select one of each pair that answers the…

A: Alcohol is an functional group whose general formula is R-OH, where R is any alkyl or aryl group.…

Q: Write down the IUPAC name of the structure shown. ноос-сн,-соон

A: Write IUPAC name of --- HOOC-CH2-COOH ?

Q: Predict which member of each pair will be more soluble in water. Explain the reasonsfor your…

A: To predict which of below is more soluble in water. heptan-1-ol or 4-methylphenol

Q: Rank the attached compounds in order of increasing boiling point.

A: It is given that the given organic compounds need to be arranged in increasing order of their…

Q: Which statement is correct? O Ethers have a general formula RCOR Ethers are very stable in the

A: Introduction: We have to tell which statement is correct.

Q: Pristane is a high molecular weight alkane present in shark liver oil, a lipid used as a folk remedy…

A: The structure of pristane is as shown below

Q: Rese 1-Propanol can form with but butane cannot. 2-Butanol is more soluble than dipropyl ether…

A: Water is a polar molecule. The hydrogen and oxygen atoms are present in the same molecule. So,…