Through photosynthesis, plants build molecules of sugar containing several carbon atoms from carbon dioxide. In the process, entropy is decreased. The reaction of CO2with formic acid to form oxalic acid provides a simple example of a reaction in which the number of carbon atoms in a compound increases:
(a) Calculate the standard entropy change for this reaction and discuss the sign of
(b) How do plants carry out reactions that increase the number of carbon atoms in a sugar, given the changes in entropy for reactions like this?
Want to see the full answer?
Check out a sample textbook solutionChapter 10 Solutions
Chemistry for Engineering Students
- The standard molar entropy of methanol vapor, CH3OH(g), is 239.8 J K1 mol-1. (a) Calculate the entropy change for the vaporization of 1 mol methanol (use data from Table 16.1 or Appendix J). (b) Calculate the enthalpy of vaporization of methanol, assuming that rS doesnt depend on temperature and taking the boiling point of methanol to be 64.6C.arrow_forwardWhat is the sign of the standard Gibbs free-energy change at low temperatures and at high temperatures for the synthesis of ammonia? 3H2(g) + N2(g) 2NH3(g)arrow_forwardUse data from Appendix D to calculate the standardentropy change at 25°C for the reaction CH3COOH(g)+NH3(g)CH3NH2(g)+CO2(g)+H2(g) Suppose that 1.00 mol each of solid acetamide, CH3CONH2(s), and water, H2O(l), react to give thesame products. Will the standard entropy change belarger or smaller than that calculated for the reactionin part (a)?arrow_forward
- Calculate the standard Gibbs free-energy change when SO3 forms from SO2 and O2 at 298 K. Why is sulfur trioxide an important substance to study? (Hint: What happens when it combines with water?)arrow_forwardWhat is the sign of the standard Gibbs free-energy change at low temperatures and at high temperatures for the combustion of acetaldehyde? CH3CHO(l)+52O2(g)2CO2+2H2O(l)arrow_forwardDetermine the entropy change for the combustion of liquid ethanol, C2H5OH, under the standard conditions to give gaseous carbon dioxide and liquid water.arrow_forward
- For each process, tell whether the entropy change of the system is positive or negative. (a) A glassblower heats glass (the system) to its softening temperature. (b) A teaspoon of sugar dissolves in a cup of coffee. (The system consists of both sugar and coffee.) (c) Calcium carbonate precipitates out of water in a cave to form stalactites and stalagmites. (Consider only the calcium carbonate to be the system.)arrow_forwardDescribe how the standard entropy of hydrogen gas at 25C can be obtained from heat measurements.arrow_forwardThe standard molar entropy of iodine vapor, I2(g), is 260.7 J Kl mol-1 and the standard molar enthalpy of formation is 62.4 kJ/mol. a) Calculate the entropy change for vaporization of 1 mol of solid iodine (use data from Table 16.1 or Appendix J). b) Calculate the enthalpy change for sublimation of iodine. c) Assuming that rSdoes not change with temperature, estimate the temperature at which iodine would sublime (change directly from solid to gas).arrow_forward
- Explain why absolute entropies can be measured.arrow_forwardWhat is the sign of the standard Gibbs free-energy change at low temperatures and at high temperatures for the formation of hydrogen sulfide from the elements? H2(g)+18S8(s)H2S(g)arrow_forwardChemists and engineers who design nuclear power plants have to worry about high-temperature reactions because it is possible for water to decompose. (a) Under what conditions does this reaction occur spontaneously? 2H2O(g) 2H2(g) + O2(g) (b) Under conditions where the decomposition of water is spontaneous, do nuclear engineers have to worry about an oxygen/hydrogen explosion? Justify your answer.arrow_forward
- Chemistry: The Molecular ScienceChemistryISBN:9781285199047Author:John W. Moore, Conrad L. StanitskiPublisher:Cengage LearningGeneral Chemistry - Standalone book (MindTap Cour...ChemistryISBN:9781305580343Author:Steven D. Gammon, Ebbing, Darrell Ebbing, Steven D., Darrell; Gammon, Darrell Ebbing; Steven D. Gammon, Darrell D.; Gammon, Ebbing; Steven D. Gammon; DarrellPublisher:Cengage LearningPrinciples of Modern ChemistryChemistryISBN:9781305079113Author:David W. Oxtoby, H. Pat Gillis, Laurie J. ButlerPublisher:Cengage Learning
- Chemistry: Principles and PracticeChemistryISBN:9780534420123Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward MercerPublisher:Cengage LearningChemistryChemistryISBN:9781305957404Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCostePublisher:Cengage Learning