Interpretation:
Chemist is testing by running the reaction when different R groups on each alcohol carbons are used; the correct statement has to be identified.
Concept Introduction:
Pinacol rearrangement: For all glycols Pinacol rearrangement occurs. Unsymmetrical vicinal
Step 1: Add proton (protonation of Pinacol using acid catalyst).
Step 2: Break a bond to give a stable molecules or ions (formation of carbocation).
Step 3: 1, 2-shift (migration of substituent from
Step 4: deprotonation occurs (take a proton away).
Trending nowThis is a popular solution!
Chapter 10 Solutions
Organic Chemistry
- Complete each acid-base reaction and predict whether the position of equilibrium lies toward the left or toward the right. (a) CH3CCH+CH3CH2ONa+CH3CH3OH (b) CH3CCCH2CH2OH+Na+NH2NH3(l)arrow_forwardEther groups are formed when alcohols are treated with acid. Consider the following question that focuses on acid-catalyzed ether formation using alcohol functional groups. There are 3 unique ether products will be formed when the following reaction is performed. Draw the product of the above reaction that has six carbon atoms and an ether functional group. **Be sure to include all lone pairs of electrons.**arrow_forwardDraw the structure of a molecule, an unknown aldehyde or ketone listed in the tables, that would show a negative Tollens’ test and a negative iodoform test. There is more than one correct answer. Draw one! (please help solve this question but also explain it!)arrow_forward
- 1. What type of TAG is given above?2. How many kinds of products will be formed from the saponification of this TAG?arrow_forwardFor each of the given reactions, pick the correct description and the correct reagent.arrow_forwardIf the base was changed from NaH to LDA, the major product changes(shown below). Think critically about the change in base, why is this change in major products observed? (1—3 sentences)arrow_forward
- Consider compound I below, which is structurally related to a natural product that was isolated from an extract of a Caribbean marine sponge (See J. Chem. Soc. 1994, 116, 6015). Answer the following questions about this compound ( Please Explain Answers) How primary alcohols are present? _________ How many secondary alcohols are present? _________ How many quaternary carbons are present? _______arrow_forwardWhat is the difference between a nucleophile and a base using a reaction as an example?arrow_forwardIdentify the most important aldehyde and ketone from Section 14.4 on the basis of amount used, and list at least one characteristic for each that contributes to its usefulness.arrow_forward
- Organic ChemistryChemistryISBN:9781305580350Author:William H. Brown, Brent L. Iverson, Eric Anslyn, Christopher S. FootePublisher:Cengage LearningChemistry for Today: General, Organic, and Bioche...ChemistryISBN:9781305960060Author:Spencer L. Seager, Michael R. Slabaugh, Maren S. HansenPublisher:Cengage LearningOrganic Chemistry: A Guided InquiryChemistryISBN:9780618974122Author:Andrei StraumanisPublisher:Cengage Learning