Write an IUPAC name for the following alkane/cycloalkane

Q: 1- Alkanes are a)- Saturated hydrocarbons b)-Unsaturated hydrocarbons

A: Note: according to guidelines we can able to answer first question only.

Q: What is the systematic name of the alkane

A:

Q: Give IUPAC name of the following: 1. 2. 3.

A: 1.   2.  3. The IUPAC name of the above compounds has to be given below,

Q: Provide the IUPAC name the compound CH3(CH2)4-C=C-CH2CH=CH(CH2)7CH3. Parent name: Locants: IUPAC…

A: Given compound is :

Q: Give the correct IUPAC name for the following compound. For alkenes, when appropriate, indicate…

A: In this question we have to tell the IUPAC name of the given compound.

Q: Name these branched-chain alkanes

A: Select the longest chain i.e. the principle carbon chain  Numbering Naming (prefix + word root +…

Q: Draw the structure of each alkane and cycloalkane from the given incorrect name. Then, give the…

A: The given name is, 4-ethyl-3-isopropylheptane

Q: Naming of Alkanes, Cycloalkanes, and Alkynes 13. Write the IUPAC name for the given molecule

A:

Q: Describe the structure of a cycloalkane.

A: Cycloalkane refers to those organic compounds which are cyclic in nature. The C atom is sp3…

Q: Define A Disubstituted Cycloalkane ?

A: Alkane: Saturated hydrocarbons are called alkanes. The cyclic forms of alkanes are known as…

Q: Write an IUPAC name for the following alkane/cycloalkane: Name:

A:

Q: Explain the process of Naming Cycloalkanes ?

A: In order to name a Cycloalkane, a cyclic ring must be present in the given compound. There is a list…

Q: Discuss the concept of alkanes and cycloalkanes and why is it important to know about these…

A: It is given to discuss about the concept of alkanes and cyclo alkanes.They are also called aliphatic…

Q: What are the Common names for some polycyclic alkanes ?

A: The joining of the two individual cycloalkane rings are termed as polycyclic molecules. Two types of…

Q: Draw line structures for the following cycloalkanes:(a) 1,1-Dimethylcyclopropane(b)…

A: Since we only answer up to 3 sub-parts, we’ll answer the first3. Please resubmit the question and…

Q: Name the alkane while usi

A: These are three types  1. Fused bicyclic 2. Bridged bicyclic 3. Spiro    Rules to naming fuced…

Q: Describe the IUPAC rules for naming cycloalkanes.

A: IUPAC nomenclature is the International Union of Pure and Applied Chemistry. It is the method for…

Q: IUPAC naming cycloalkane

A: IUPAC naming of compound...

Q: Naming an Alkane Give the IUPAC name for the following compound.

A: To name the given organic compound, the below mentioned IUPAC rules are followed: 1) Select the…

Q: How many hydrogen atoms are present in a cycloalkane that contains four carbon atoms?

A: Explained as follows

Q: .) Classify the following compound as an alkane, alkene, or alkyne and give the correct IUPAC…

A: Organic compounds which contain single, double and triple bonds between consecutive carbon atoms are…

Q: Which molecular formula corresponds to a straight-chain alkane?

A:

Q: Naming Cycloalkanes

A:

Q: What is the general formula of cycloalkanes?

A: Cycloalkanes are cyclic saturated hydrocarbons, which mean all the carbon-carbon bonds in the ring…

Q: Complete Structure # of Carbons Shortcut Alkanes Structure Cycloalkanes (If applicable) 1 2 5 6 7 8…

A: 1- methane  2- enthane 3- propane 4-butane 5 - pentane 6- hexane 7- heptane 8- octane

Q: Name the following alkane:

A: The name of the given alkanes can be written as

Q: What is the IUPAC name of the following cycloalkanes.

A: (a) The given compound is,

Q: Write the skeletal structure and name of the first 10 cycloalkanes

A: The general formula of cycloalkane is CnH2n. They are called cyclic saturated hydrocarbons as they…

Q: State the carbon atoms of Cycloalkanes ?

A: Cycloalkanes are rings which can be one or more than one rings. The general formula of the…

Q: A. Give the complete IUPAC names of the 1. 3. 2.

A: “Since you have posted a question with multiple sub-parts, we will solve first three sub- parts for…

Q: Name these alkenes and cycloalkenes

A: IUPAC stands for International Union for Pure and Applied Chemistry. IUPAC Rules for Alkane…

Q: Br А. CH3 CH3CH CH3 В. CHCH2CH3

A:

Q: Naming Cycloalkane

A: NOTE: The compounds given are not cycloalkanes but are rather alkynes due to the presence of…

Q: Applying the IUPAC nomenclature system, the parent chain of this alkane is: O nonane O heptane O…

A: Organic compounds can be defined as the compounds that are made up of carbon and hydrogen atoms.

Q: Give the correct IUPAC name for the following compound. For alkenes, when appropriate, indicate…

A: The given organic structure is    The correct IUPAC name of the compound is

Q: How To Name a Cycloalkane Using the IUPAC System ?

A: IUPAC nomenclature of Cycloalkanes- General rules for IUPAC nomenclature of alkanes- Select parent…

Q: What is the IUPAC name of the following cycloalkane?

A: According to the IUPAC nomenclature, the name of the cycloalkane is given such that the substituents…

Q: Give the correct IUPAC name for the following compound. For alkenes, when appropriate, indicate…

A: Alkenes can be defined as the organic compounds containing double bonds between carbon atoms.

Q: Which of the following is an alkane with the highest boiling point? LIS. JEN. BLA.

A: Boiling point of cyclic compound is generally greater than acyclic because of comparatively strong…

Q: designation. Give the IUPAC name of the following cycloalkane, including the cis or trans CH3 CH3

A: Rule of IUPAC, 1) First  numbering the longest chain as parent name. 2)For cyclic used word cyclo.…

Q: Give the systematic name of the following alkane?

A: We have to predict the nomenclature of given structure.

Q: Which alkane would have a higher boiling point? a) ethane Ob) pentane c) heptane

A: Given,  a) ethane b) pentane C) heptane The molecule which have a higher boiling point is:

Q: Write thě IUPAC hame för

A:

Q: Define Substituted Cycloalkanes ?

A: Cycloalkenes are the closed ring of hydrocarbon and some of the example of cycloalkanes is shown…

Q: Name these alkenes and cycloalkenes

A: IUPAC name alkene : [2Z]-3-(2'-methylpropyl)-octa-2-ene

Q: uj (e) (f)

A: d) The compound given is as shown below. In the above compound, the longest possible carbon chain…

Alkanes and Cycloalkanes

Alkanes are saturated organic compounds which are made up of C and H atoms. Alkanes have the general formula of CnH2n+2. Alkane contains sp3 hybridized carbon atoms with four sigmas (σ) bonds & every hydrogen atom is connected with one of the carbon atoms. The size of the alkane could be determined by the number of carbon atoms located in it.