Menthene, a compound found in mint plants, has the formula C10H18 and the IUPAC name 1-isopropyl- 4-methylcyclohexene. What is the structure of menthene?

Q: Give the systematic (IUPAC) names of the following alkenes. (a) CH2=CH-CH,-CH(CH3)2 (b)…

A: IUPAC rules: Assign the numbering from functional group on parent hydro carbon.  write the…

Q: V OH 0= NH₂ B Which of the following molecules can be classified as an alkene? OH NH₂ A) Compound A…

A: Alkenes are hydrocarbons which contain carbon-carbon double bonds in their structures. General…

Q: Draw the Structure for the heterocyclic compound with the following systematic name:…

A: The 1,3-thiazine is a six-membered heterocyclic ring that contains a nitrogen and sulfur heteroatom…

Q: What is the line structure and structural formula of 4,5-dihydroxy-6-methyl-n-heptanal?

A:

Q: Among the structures What is the structure for the trans-1,2-dimethylcyclohexane? What is the…

A:

Q: What is the line structure for Cyclopentylcyclopentane and trans-4-Isobutylcyclohexanol

A:

Q: CH3 CH3 A - Enantionmers B - cis/trans isomers C - structural isomers D - the same molecule IL

A:

Q: What is the skeletal structure of 2-sec-butyl-4-isopropyl-1-(1-methylbutyl)cyclohexane ?

A: The skeletal structure or bond-line structure in organic chemistry can be defined as the structure…

Q: The compound having Molecular formula CgH12 is an O alkene O alkane O alkyne O cycloalkene

A: The question is based on the concept of molecular formula. we have to identify the compound by…

Q: What happens when (i) Chlorobenzene is treated with Cl2/FeCl3 (ii) ethyl chloride is treated with…

A: Nuclear halogenation means the halogen group is directly bonded with the benzene ring. Example:…

Q: Give the IUPAC name for the following compounds. (i) H3CH2C. CH2CH3 (ii) Draw the structure for the…

A: The IUPAC name of the compound can be written on the basis of the number of carbon atoms in the main…

Q: 1. Give IUPAC for the following compound = CH3 CH3 „CHCH2CH2ĊHCH3

A: The compound given is Hence the alkyl chain has longest possible carbon chain of 6 carbon as shown…

Q: CO7T01Q5547 Give the IUPAC name for the following compound:

A: Organic compounds are the compounds which are mainly composed C and H atoms. The branch of chemistry…

Q: Give the systematic (IUPAC) names of the following alkenes. (d) CH—С—CH—CH—CH> CH3 (e) (f) (g) CH3

A: Since you have posted questions with multiple sub-parts, we are entitled to answer the first 3 only.…

Q: Which of the following structures represent * trans-1,3-dimethylcyclopentane?

A: Since you have asked multiple questions, we will solve the first question for you. If you want any…

Q: Please draw the skeletal structure of 2-sec-butyl-1-isopentyl-4-isopropylcyclohexane

A: The given compound contains a cyclohexane ring:

Q: Draw the structure for these molecules. (a) 3-phenylmethylhex-4-en-1-yne; (b)…

A: We’ll answer the first question since the exact one wasn’t specified. Please submit a new question…

Q: 7. The general formula for noncyclic alkenes is: (a) C„H (b) C_H (c) C̟H2 (d) C̟H_-2 (e) CH,

A: General formula for noncyclic alkenes

Q: _____ are hydrocarbons in which the carbon atoms are shared between rings.  a. aromatic hydrocarbons…

A: Answer- Polyaromatic hydrocarbon are hydrocarbon in which more than one aromatic ring fused…

Q: Draw the structure that corresponds to each name and indicatewhich structures can exist as…

A: Alkenes is the class of hydrocarbons which contains a carbon-carbon double bond and it is an…

Q: (a) Five organic compounds have the following structures. B H HHHH C C T H HHH H H H H Br HH H HH…

A: Here  we required to identify the organic compound which matches with the given description

Q: Kim Chem referred to a compound as "2-methylcyclohexene" Give the correct name for this compound.

A:

Q: What happens when  (i) chlorobenzene is treated with Cl2​/FeCl3​, (ii) ethyl chloride is treated…

A: Aromatic electrophilic substitution reaction: Benzene and other aromatic compound gives mainly…

Q: How many alkenes, including stereoisomers, contain a tert-butyl group and have the molecular formula…

A:

Q: Name the following aromatic compounds: (in letter (f), treat the benzene ring as a substituent) CH₂…

A: The name of the aromatic compounds are given below

Q: Draw the structure of the product expected in the following Sonogashira reactions:

A: Note: As per the Q&A guidelines, I am answering only the first three subparts of a question. So…

Q: Is this correct? Benzene reacts with CH3CH(CH2CH2CH3)CH(Cl)CH2CH3, catalyst ALCl3

A: Friedel Crafts Reaction is a reaction in which alkyl halide or aryl halide is treated with benzene…

Q: Draw the structural formula for each (i) 3-methyl-5-(2,2-dimethylpropyl) nonane (ii)…

A: Here we are asked to write the structural formula for each of thefollowing compounds, the given…

Q: Give the structure corresponding to each IUPAC name. d. 1-ethyl-2,3dimethylcyclopentane e.…

A: D)

Q: What hydrocarbon with molecular formula C4H10 forms only two monochlorinated products? Both products…

A:

Q: Write structural formulas for all ketones with the molecular formula C6H12O and give each its IUPAC…

A: Ketones are carbonyl group-containing compounds. It is the functional group with the structure R2C=O…

Q: What is the structural formula of ethyl 3-methylbutanoate? A CH,CH,COOCH,CH,CH(CH,), B…

A:

Q: What is the general molecular formula of an acyclic alkane? a) CnH2n c) C₂H₂n-2 b) C,Hzn+z d) CH20-4…

A: Acyclic alkanes consist of carbon atoms arranged in a chain without the presence of double or triple…

Q: How many allylic hydrogen atoms are present in 1-ethylcyclohexene?

A: Note: Since you have posted multiple questions, we are entitled to answer the first only. Please…

Q: When cyclopropane is treated with HI, 1-idopropane is formed. A similar type of reaction does not…

A: Most cycloalkans will participat in similar reactions compared to acyclic alkanes.But there are…

Q: CH3 CH3 F Br A. B. B. C. C. 9. 10. ÇI Č2H5 ČI A. A. B. B. C. C.

A: Rules for IUPAC Nomenclature : 1.Selection of the longest carbon chain which is called parent chain.…

Q: what is the structure corresponding to cis-1,3-dichloropentane?

A: There is a mistake in the given question. If the given molecule is cis-1,3-dichloropentane then…

Q: 2-chloro-3-methyl-2-butene can exist in cis and trans isomers. Draw them

A:

Q: Draw the skeletal structure of 2-sec-butyl-1-isopropyl-4-(2-methylbutyl)cyclohexane

A:

Q: What term describes the structural relationship between (2R,3R,4S)-2,3,4-trichloroheptane and…

A: Enantiomers are the chemical I so much that are non superimposable Mirror image of each other this…

Q: What alkane, with molecular formula C7H16, forms seven monochlorinated products (disregarding…

A: Monochlorinated products are those where substitution of one chlorine in alkane product gives…

Q: Draw all the possible noncyclic structural isomers of C5H10. Name each compound.

A: Isomers are the compounds having same molecular formula but different structures.

Q: c) For the IUPAC names below, provide an unambiguous structure! 1) (1R, 2R,…

A: Naming of organic compounds is done by the naming scheme called the IUPAC (International Union of…

Q: General formula of alkenes is a. CnH2n-2 b. CnH2n c. Cn-2Hn d. CnH2n+2

A: Alkene is the unsaturated hydrocarbon having carbon carbon double bond.

Q: What happens when(i) Chlorobenzene is treated with Cl2/FeCl3,(ii) Ethyl chloride is treated with…

A: The given reactions are (i) Chlorobenzene is treated with Cl2/FeCl3,(ii) Ethyl chloride is treated…

Q: 2.1. Write the alkyl substituent names for ethane, octane, cyclohexane and the structures, CH3 CH3…

A: Given :  Write the alkyl substituent names for ethane, octane, cyclohexane and the structures.

Diol

In chemistry there are so many chemical compounds that have a hydroxyl group but a chemical compound having two hydroxyl groups (-OH) is termed as a diol. It also implies the presence of two alcohols whereas polyols contain two or more than two hydroxyl groups (-OH). Glycol or 1,2-diol is an aliphatic diol that has two alcohol groups on adjacent carbon atoms. In industries, the most commonly used diol is ethylene glycol.