(a)
Interpretation: The statements which are true out of the given statements at the given values of temperature and standard enthalpy change for the given reaction are to be determined.
Concept Introduction: The relation between standard free energy change, standard entropy change and standard free energy change is determined by using the formula,
To determine: The authenticity of the statement, “The given reaction is an endothermic reaction”.
(b)
Interpretation: The statements which are true out of the given statements at the given values of temperature and standard enthalpy change for the given reaction are to be determined.
Concept Introduction: The relation between standard free energy change, standard entropy change and standard free energy change is determined by using the formula,
To determine: The authenticity of the statement, “The
(c)
Interpretation: The statements which are true out of the given statements at the given values of temperature and standard enthalpy change for the given reaction are to be determined.
Concept Introduction: The relation between standard free energy change, standard entropy change and standard free energy change is determined by using the formula,
To determine: The authenticity of the statement, “If temperature is increased in the given reaction, the ratio
(d)
Interpretation: The statements which are true out of the given statements at the given values of temperature and standard enthalpy change for the given reaction are to be determined.
Concept Introduction: The relation between standard free energy change, standard entropy change and standard free energy change is determined by using the formula,
To determine: The authenticity of the statement, “The
(e)
Interpretation: The statements which are true out of the given statements at the given values of temperature and standard enthalpy change for the given reaction are to be determined.
Concept Introduction: The relation between standard free energy change, standard entropy change and standard free energy change is determined by using the formula,
To determine: The authenticity of the statement, “When
Want to see the full answer?
Check out a sample textbook solutionChapter 16 Solutions
Chemistry: An Atoms First Approach
- Elemental boron, in the form of thin fibers, can be made by reducing a boron halide with H2. BCl3(g) + 32 H2(g) B(s) + 3 HCl(g) Calculate rH, rS, and rG at 25 C for this reaction. Is the reaction predicted to be product-favored at equilibrium at 25 C? If so, is it enthalpy- or entropy-driven? [S for B(s) is 5.86 J/K mol.]arrow_forwardTetrachloromethane (carbon tetrachloride), CCl4, has a normal boiling point of 76.7C and an enthalpy of vaporization, Hvap, of 29.82 kJ/mol. Estimate the entropy of vaporization, Svap. Estimate the free energy of vaporization, Gvap, at 25C.arrow_forwardConsider the following reaction at 298 K: 2SO2(g)+O2(g)2SO3(g) An equilibrium mixture contains O2(g) and SO3(g) at partial pressures of 0.50 atm and 2.0 atm, respectively. Using data from Appendix 4, determine the equilibrium partial pressure of SO2 in the mixture. Will this reaction be most favored at a high or a low temperature, assuming standard conditions?arrow_forward
- For the decomposition of formic acid, HCOOH(l)H2O(l)+CO(g) H = +29 kJ/mol at 25C. a Does the tendency of this reaction to proceed to a state of minimum energy favor the formation of water and carbon monoxide or formic acid? Explain. b Does the tendency of this reaction to proceed to a state of maximum entropy favor the formation of products or reactants? Explainarrow_forwardIndicate which substance in the given pairs has the higher entropy value. Explain your choices.. (a) C2H5OH(l) or C3H7OH(l). (b) C2H5OH(l) or C2H5OH(g). (c) 2H(g) or H(g)arrow_forwardThe vaporization of ethanol C2H5OH(l) C2H5OH(g) at its normal boiling point, 351 K, has S = 110. J/K mol Calculate E for the vaporization process at 1 atm and 351 Karrow_forward
- The decomposition of diamond to graphite [C(diamond) C(graphite)] is thermodynamically favored, but occurs slowly at room temperature. a. Use fG values from Appendix L to calculate rG and Keq for the reaction under standard conditions and 298.15 K. b. Use fH and S values from Appendix L to estimate rG and Keq for the reaction at 1000 K. Assume that enthalpy and entropy values are valid at these temperatures. Does heating shift the equilibrium toward the formation of diamond or graphite? c. Why is the formation of diamond favored at high pressures? d. The phase diagram shows that diamond is thermodynamically favored over graphite at 20,000 atmospheres pressure (about 2 GPa) at room temperature. Why is this conversion actually done at much higher temperatures and pressures?arrow_forwardUse data given in Tables 6.2 and 18.1 to obtain the value of Kp at 1000C for the reaction C(graphite)+CO2(g)2CO(g) Carbon monoxide is known to form during combustion of carbon at high temperatures. Do the data agree with this? Explain.arrow_forwardA crucial reaction for the production of synthetic fuels is the production of H2 by the reaction of coal with steam. The chemical reaction is C(s) + H2O(g) CO(g) + H2(g) (a) Calculate rG for this reaction at 25 C, assuming C(s) is graphite. (b) Calculate Kp for the reaction at 25 C. (c) Is the reaction predicted to be product-favored at equilibrium at 25 C? If not, at what temperature will it become so?arrow_forward
- The standard free energies of formation and the standard enthalpies of formation at 298 K for difluoroacetylene (C2F2) and hexafluorobenzene (C6F6) are Gfo(KJ/mol) Hfo(KJ/mol) C2F2(g) 191.2 241.3 Hexane 78.2 132.8 For the following reaction: C6F6(g)3C2F2(g) a. calculate S at 298 K. b. calculate K at 298 K. c. estimate K at 3000. K, assuming H and S do not depend on temperature.arrow_forwardCells use the hydrolysis of adenosine triphosphate, abbreviated as ATP, as a source of energy. Symbolically, this reaction can be written as ATP(aq)+H2O(l)ADP(aq)+H2PO4(aq) where ADP represents adenosine diphosphate. For this reaction, G =30.5 kJ/mol. a. Calculate K at 25C. b. If all the free energy from the metabolism of glucose C6H12O6(s)+6O2(g)6CO2(g)+6H2O(l) goes into forming ATP from ADP, how many ATP molecules can be produced for every molecule of glucose?arrow_forwardElemental boron, in the form of thin fibers, can be made by reducing a boron halide with H2. BCl3(g) + 3/2 H2(g) B(s) + 3HCl(g) Calculate H, S, and G at 25 C for this reaction. Is the reaction predicted to be product favored at equilibrium at 25 C? If so, is it enthalpy driven or entropy driven?arrow_forward
- Chemistry: The Molecular ScienceChemistryISBN:9781285199047Author:John W. Moore, Conrad L. StanitskiPublisher:Cengage LearningGeneral Chemistry - Standalone book (MindTap Cour...ChemistryISBN:9781305580343Author:Steven D. Gammon, Ebbing, Darrell Ebbing, Steven D., Darrell; Gammon, Darrell Ebbing; Steven D. Gammon, Darrell D.; Gammon, Ebbing; Steven D. Gammon; DarrellPublisher:Cengage LearningChemistry & Chemical ReactivityChemistryISBN:9781133949640Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage Learning
- Chemistry & Chemical ReactivityChemistryISBN:9781337399074Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage LearningChemistry: An Atoms First ApproachChemistryISBN:9781305079243Author:Steven S. Zumdahl, Susan A. ZumdahlPublisher:Cengage Learning