Concept explainers
Using Hess’s law, write out all of the formation reactions that add up to, and calculate
(This reaction occurs when one uses baking soda to smother a fire in the kitchen.)
Want to see the full answer?
Check out a sample textbook solutionChapter 2 Solutions
Physical Chemistry
- Gasohol, a mixture of gasoline and ethanol, C2H5OH, is used as automobile fuel. The alcohol releases energy in a combustion reaction with O2. C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) If 0.115 g ethanol evolves 3.62 kJ when burned at constant pressure, calculate the combustion enthalpy for ethanol.arrow_forwardGive the definition of the standard enthalpy of formation for a substance. Write separate reactions for the formation of NaCl, H2O , C6H12O6, and PbSO4 that have H values equal to Hf for each compound.arrow_forwardUse Appendix L to find the standard enthalpies of formation of oxygen atoms, oxygen molecules (O2), and ozone (O3). What is the standard state of oxygen? Is the formation of oxygen atoms from O2 exothermic? What is the enthalpy change for the formation of 1 mol of O3 from O2?arrow_forward
- White phosphorus, P4, ignites in air to produce P4O10. When 3.56 g P4 is burned, 85.8 kJ of thermal energy is evolved at constant pressure. Calculate the combustion enthalpy of P4.arrow_forwardOne step in the manufacturing of sulfuric acid is the conversion of SO2(g) to SO3(g). The thermochemical equation for this process is SO2(g)+12O2(g)SO3(g)H=98.9kJ The second step combines the SO3 with H2O to make H2SO4. (a) Calculate the enthalpy change that accompanies the reaction to make 1.00 kg SO3(g). (b) Is heat absorbed or released in this process?arrow_forwardThe head of a strike anywhere match contains tetraphosphorus trisulfide, P4S3. In an experiment, a student burned this compound in an excess of oxygen and found that it evolved 3651 kJ of heat per mole of P4S3 at a constant pressure of 1 atm. She wrote the following thermochemical equation: P4S3(s)+8O2(g)P4O10(s)+3SO2(g);H=3651kJ Calculate the standard enthalpy of formation of P4S3, using this students result and the following standard enthalpies of formation: P4O10(s), 3009.9 kJ/mol; SO2(g), 296.8 kJ/mol. How does this value compare with the value given in Appendix C?arrow_forward
- An industrial process for manufacturing sulfuric acid, H2SO4, uses hydrogen sulfide, H2S, from the purification of natural gas. In the first step of this process, the hydrogen sulfide is burned to obtain sulfur dioxide, SO2. 2H2S(g)+3O2(g)2H2O(l)+2SO2(g);H=1124kJ The density of sulfur dioxide at 25C and 1.00 atm is 2.62 g/L, and the molar heat capacity is 30.2 J/(mol C). (a) How much heat would be evolved in producing 1.00 L of SO2 at 25C and 1.00 atm? (b) Suppose heat from this reaction is used to heat 1.00 L of the SO2 from 25C to 500C for its use in the next step of the process. What percentage of the heat evolved is required for this?arrow_forwardAnother reaction that is used to propel rockets is N2O4(l)+2N2H4(l)3N2(g)+4H2O(g) This reaction has the advantage that neither product is toxic, so no dangerous pollution is released. When the reaction consumes 10.0 g liquid N2O4, it releases 124 kJ of heat. (a) Is the sign of the enthalpy change positive or negative? (b) What is the value of H for the chemical equation if it is understood to be written in molar quantities?arrow_forwardHydrogen sulfide, H2S, is a poisonous gas with the odor of rotten eggs. The reaction for the formation of H2S from the elements is H2(g)+18S3(rhombic)H2S(g) Use Hesss law to obtain the enthalpy change for this reaction from the following enthalpy changes: H2S(g)+32O2(g)H2O(g)+SO2(g);H=518kJH2(g)+12O2(g)H2O(g);H=242kJ18S8(rhombic)+O2(g)SO2(g);H=297kJarrow_forward
- Use Hesss law to calculate the enthalpy change for the formation of CS2() from C(s) and S(s) [C(s) + 2 S(s) CS2()] from the following enthalpy values. C(s)+O2(g)CO2(g)rH1=393.5kJ/mol-rxnS(s)+O2(g)SO2(g)rH2=296.8kJ/mol-rxnCS2(l)+3O2(g)CO2(g)+2SO2(g)rH3=1103.9kJ/mol-rxnarrow_forwardThe specific heat capacity of copper is 0.385 J g1 C1, whereas it is 0.128 J g1 C1 for gold. Assume you place 100. g of each metal, originally at 25 C, in a boiling water bath at 100 C. If energy is transferred to each metal at the same rate, determine which piece of metal will reach 100 C first.arrow_forwardThe process of dissolving ammonium nitrate, NH4NO3, in water is an endothermic process. What is the sign of q? If you were to add some ammonium nitrate to water in a flask, would you expect the flask to feel warm or cool?arrow_forward
- Chemistry & Chemical ReactivityChemistryISBN:9781337399074Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage LearningChemistry: Principles and PracticeChemistryISBN:9780534420123Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward MercerPublisher:Cengage LearningChemistry: The Molecular ScienceChemistryISBN:9781285199047Author:John W. Moore, Conrad L. StanitskiPublisher:Cengage Learning
- Chemistry: Principles and ReactionsChemistryISBN:9781305079373Author:William L. Masterton, Cecile N. HurleyPublisher:Cengage LearningGeneral Chemistry - Standalone book (MindTap Cour...ChemistryISBN:9781305580343Author:Steven D. Gammon, Ebbing, Darrell Ebbing, Steven D., Darrell; Gammon, Darrell Ebbing; Steven D. Gammon, Darrell D.; Gammon, Ebbing; Steven D. Gammon; DarrellPublisher:Cengage Learning